Jarvis OS
PYQ papersPricingSign inGet started
  1. Home
  2. /JEE Chemistry PYQs
  3. /d- and f-Block Elements

d- and f-Block Elements — JEE Previous Year Questions

Every d- and f-Block Elements question asked in JEE Main and JEE Advanced across the last 186 papers — 202 questions, each with its correct answer. Free to read, no account needed.

Questions

202

Papers it appeared in

126/186

Appearance rate

68%

All 202 d- and f-Block Elements questions

Most recent papers first.

Q1·ChemistrySingle correctJEE Main 2026
Given below are two statements for catalytic properties of transition metals. Statement I: First row transition metals which act as catalyst utilise their 3d electrons only for formation of bonds between reactant molecules and atoms on the surface of catalyst. Statement II: There is increase in the concentration of reactants on the surface of catalyst which strengthens the bonds in reacting molecules. In the light of the above statements, choose the correct answer from the options given below:
  1. (A)Both Statement I and Statement II are correct
  2. (B)Both Statement I and Statement II are incorrect
  3. (C)Statement I is correct but Statement II is incorrect
  4. (D)Statement I is incorrect but Statement II is correct

Correct answer: (B)

Step-by-step solution →
Q2·ChemistrySingle correctJEE Main 2026
Given below are two statements: Statement I: The number of pairs among [Ti4+,V2+][Ti^{4+}, V^{2+}][Ti4+,V2+], [V2+,Mn2+][V^{2+}, Mn^{2+}][V2+,Mn2+], [Mn2+,Fe3+][Mn^{2+}, Fe^{3+}][Mn2+,Fe3+] and [V2+,Cr2+][V^{2+}, Cr^{2+}][V2+,Cr2+] in which both ions are coloured is 3. Statement II: The number of pairs among [La3+,Yb2+][La^{3+}, Yb^{2+}][La3+,Yb2+], [Lu3+,Ce4+][Lu^{3+}, Ce^{4+}][Lu3+,Ce4+] and [Ac3+,Lr3+][Ac^{3+}, Lr^{3+}][Ac3+,Lr3+] ions in which both are diamagnetic is 3. In the light of the above statements, choose the correct from the options given below:
  1. (A)Both Statement I and Statement II are correct
  2. (B)Both Statement I and Statement II are incorrect
  3. (C)Statement I is correct but Statement II is incorrect
  4. (D)Statement I is incorrect but Statement II is correct

Correct answer: (A)

Step-by-step solution →
Q3·ChemistrySingle correctJEE Main 2026
The correct order of first (ΔiH1)(\Delta_{i}H_{1})(Δi​H1​) and second (ΔiH2)(\Delta_{i}H_{2})(Δi​H2​) ionisation enthalpy values of Cr and Mn are : A. ΔiH1\Delta_{i}H_{1}Δi​H1​ : Cr > Mn B. ΔiH2\Delta_{i}H_{2}Δi​H2​ : Cr > Mn C. ΔiH1\Delta_{i}H_{1}Δi​H1​ : Mn > Cr D. ΔiH2\Delta_{i}H_{2}Δi​H2​ : Mn > Cr Choose the correct answer from the options given below :
  1. (A)A and B only
  2. (B)B and C only
  3. (C)A and D only
  4. (D)C and D only

Correct answer: (B)

Step-by-step solution →
Q4·ChemistrySingle correctJEE Main 2026
The correct statements among the following are. A. Basic vanadium oxide is used in the manufacture of H₂SO₄. B. The spin-only magnetic moment value of the transition metal halide employed in Ziegler-Natta polymerization is 2.84 BM. C. The p-block metal compound employed in Ziegler-Natta polymerization has the metal in +3 oxidation state. D. The number of electrons present in the outer most 'd' orbital of metal halide employed in Wacker process is 8. Choose the correct answer from the options given below:
  1. (A)A and B Only
  2. (B)A, C and D Only
  3. (C)C and D Only
  4. (D)B, C and D Only

Correct answer: (C)

Step-by-step solution →
Q5·ChemistrySingle correctJEE Main 2026
Which of the following is NOT a physical or chemical characteristics of interstitial compounds?
  1. (A)They have high melting points, higher than those of pure metals.
  2. (B)They are very soft and ionic in nature.
  3. (C)They retain metallic conductivity.
  4. (D)They are chemically inert and usually non-stoichiometric.

Correct answer: (B)

Step-by-step solution →
Q6·ChemistrySingle correctJEE Main 2026
The correct statements among the following are, A. Mo(VI)Mo(VI)Mo(VI) and W(VI)W(VI)W(VI) are less stable than Cr(VI)Cr(VI)Cr(VI). B. Ce4+Ce^{4+}Ce4+ and Tb4+Tb^{4+}Tb4+ are oxidant while Eu2+Eu^{2+}Eu2+ and Yb2+Yb^{2+}Yb2+ are reductant. C. CmCmCm and AmAmAm have seven unpaired electrons. D. Actinoid contraction is greater from element to element than lanthanoid contraction. Choose the correct answer from the options given below:
  1. (A)A and B Only
  2. (B)C and D Only
  3. (C)B and D Only
  4. (D)A and C Only

Correct answer: (C)

Step-by-step solution →
Q7·ChemistrySingle correctJEE Main 2026
Consider ∣x∣|x|∣x∣ is the difference in oxidation states of Mn in highest manganese fluoride and highest manganese oxide. The ions with ∣x∣|x|∣x∣ number of unpaired electrons from the following are: A. Sc3+Sc^{3+}Sc3+ B. Zn2+Zn^{2+}Zn2+ C. V2+V^{2+}V2+ D. Fe2+Fe^{2+}Fe2+ E. Co2+Co^{2+}Co2+ Choose the correct answer from the options given below:
  1. (A)A and B Only
  2. (B)C, D and E Only
  3. (C)C and E Only
  4. (D)B and E Only

Correct answer: (C)

Step-by-step solution →
Q8·ChemistrySingle correctJEE Main 2026
Correct statements from the following are A. Potassium dichromate is an oxidising agent and it oxidises FeSO4FeSO_4FeSO4​ to Fe2(SO4)3Fe_2(SO_4)_3Fe2​(SO4​)3​ in acidic medium. B. Sodium dichromate can be used as primary standard in volumetric estimation. C. CrO42−CrO_4^{2-}CrO42−​ and Cr2O72−Cr_2O_7^{2-}Cr2​O72−​ are interconvertible in aqueous solution by varying the pHpHpH of the solution. D. Cr-O-CrCr\text{-}O\text{-}CrCr-O-Cr bond angle in Cr2O72−Cr_2O_7^{2-}Cr2​O72−​ is 126∘126^{\circ}126∘. Choose the correct answer from the options given below:
  1. (A)A, B and C Only
  2. (B)A, C and D Only
  3. (C)A and C Only
  4. (D)B and D Only

Correct answer: (B)

Step-by-step solution →
Q9·ChemistrySingle correctJEE Main 2026
Pairs of elements with the same number of electrons in their respective 4f orbital are [Atomic number. Eu-63, Gd-64, Dy-66, Ho-67, Tm-69, Yb-70, Lu-71, Hf-72] A. (Eu and Gd) B. (Dy and Ho) C. (Yb and Hf) D. (Lu and Tm) Choose the correct answer from the options given below:
  1. (A)B and C Only
  2. (B)A and B Only
  3. (C)A and D Only
  4. (D)A and C Only

Correct answer: (D)

Step-by-step solution →
Q10·ChemistrySingle correctJEE Main 2026
Given below are two statements: Statement I: Among ZnZnZn, MnMnMn, ScScSc and CuCuCu, the energy required to remove the third valence electron is highest for ZnZnZn and lowest for ScScSc. Statement II: The correct order of the following complexes in terms of CFSE is [Co(H2O)6]2+<[Co(H2O)6]3+<[Co(en)3]3+[Co(H_2O)_6]^{2+} < [Co(H_2O)_6]^{3+} < [Co(en)_3]^{3+}[Co(H2​O)6​]2+<[Co(H2​O)6​]3+<[Co(en)3​]3+. In the light of the above statements, choose the correct answer from the options given below:
  1. (A)Both Statement I and Statement II are true
  2. (B)Both Statement I and Statement II are false
  3. (C)Statement I is true but Statement II is false
  4. (D)Statement I is false but Statement II is true

Correct answer: (A)

Step-by-step solution →
Q11·ChemistrySingle correctJEE Main 2026
Among Fe2+,Fe3+,Cr2+Fe^{2+}, Fe^{3+}, Cr^{2+}Fe2+,Fe3+,Cr2+ and Zn2+Zn^{2+}Zn2+, the ion that shows positive borax bead test and with highest ionisation enthalpy is:
  1. (A)Fe2+Fe^{2+}Fe2+
  2. (B)Zn2+Zn^{2+}Zn2+
  3. (C)Cr2+Cr^{2+}Cr2+
  4. (D)Fe3+Fe^{3+}Fe3+

Correct answer: (D)

Step-by-step solution →
Q12·ChemistryNumericalJEE Main 2026
Number of paramagnetic ions among the following d- and f-block metal ions is ________. Mn2+,Cu2+,Zn2+,Yb2+,Sc3+,La3+,Gd3+,Lu3+,Ti4+,Ce4+Mn^{2+}, Cu^{2+}, Zn^{2+}, Yb^{2+}, Sc^{3+}, La^{3+}, Gd^{3+}, Lu^{3+}, Ti^{4+}, Ce^{4+}Mn2+,Cu2+,Zn2+,Yb2+,Sc3+,La3+,Gd3+,Lu3+,Ti4+,Ce4+ (Atomic number of Mn=25,Cu=29,Zn=30,Yb=70,Sc=21,La=57,Gd=64,Lu=71,Ti=22,Ce=58Mn = 25, Cu = 29, Zn = 30, Yb = 70, Sc = 21, La = 57, Gd = 64, Lu = 71, Ti = 22, Ce = 58Mn=25,Cu=29,Zn=30,Yb=70,Sc=21,La=57,Gd=64,Lu=71,Ti=22,Ce=58)

Correct answer: 3

Step-by-step solution →
Q13·ChemistrySingle correctJEE Main 2026
Which of the following sets includes all the species that will change the orange colour of K2Cr2O7\mathrm{K_{2}Cr_{2}O_{7}}K2​Cr2​O7​ in acidic medium?
  1. (A)Fe2+,Sn2+,I−,S2−\mathrm{Fe^{2+}}, \mathrm{Sn^{2+}}, \mathrm{I^{-}}, \mathrm{S^{2-}}Fe2+,Sn2+,I−,S2−
  2. (B)S2−,Fe3+,I−,C2O42−\mathrm{S^{2-}}, \mathrm{Fe^{3+}}, \mathrm{I^{-}}, \mathrm{C_{2}O_{4}^{2-}}S2−,Fe3+,I−,C2​O42−​
  3. (C)Fe2+,NO2−,SO2,Sn4+\mathrm{Fe^{2+}}, \mathrm{NO_{2}^{-}}, \mathrm{SO_{2}}, \mathrm{Sn^{4+}}Fe2+,NO2−​,SO2​,Sn4+
  4. (D)Fe3+,SO42−,S2−,Sn4+\mathrm{Fe^{3+}}, \mathrm{SO_{4}^{2-}}, \mathrm{S^{2-}}, \mathrm{Sn^{4+}}Fe3+,SO42−​,S2−,Sn4+

Correct answer: (A)

Step-by-step solution →
Q14·ChemistrySingle correctJEE Main 2026
Given below are two statements : Statement I : The number of pairs, from the following, in which both the ions are coloured in aqueous solution is 3. [Sc3+^{3+}3+, Ti3+^{3+}3+], [Mn2+^{2+}2+, Cr2+^{2+}2+], [Cu2+^{2+}2+, Zn2+^{2+}2+] and [Ni2+^{2+}2+, Ti4+^{4+}4+] Statement II : Th4+^{4+}4+ is the strongest reducing agent among Th4+^{4+}4+, Ce4+^{4+}4+, Gd3+^{3+}3+ and Eu2+^{2+}2+. In the light of the above statements, choose the correct answer from the options given below
  1. (A)Statement I is true but Statement II is false
  2. (B)Statement I is false but Statement II is true
  3. (C)Both Statement I and Statement II are false
  4. (D)Both Statement I and Statement II are true

Correct answer: (C)

Step-by-step solution →
Q15·ChemistrySingle correctJEE Main 2026
Consider the following statements about manganate and permanganate ions. Identify the correct statements : A. The geometry of both manganate and permanganate ions is tetrahedral. B. The oxidation states of Mn in manganate and permanganate are +7 and +6, respectively. C. Oxidation of Mn(II) salt by peroxodisulphate gives manganate ion as the final product. D. Manganate ion is paramagnetic and permanganate ions is diamagnetic. E. Acidified permanganate ion reduces oxalate, nitrite and iodide ions. Choose the correct answer from the options given below:
  1. (A)A, C and D Only
  2. (B)A, B and C Only
  3. (C)A, D and E Only
  4. (D)A and D Only

Correct answer: (D)

Step-by-step solution →
Q16·ChemistrySingle correctJEE Main 2026
"X" is an oxoanion of the lightest element of group 7 (in the periodic table). The metal is in +6 oxidation state in "X". The color of the potassium salt of X is
  1. (A)green
  2. (B)purple
  3. (C)yellow
  4. (D)orange

Correct answer: (A)

Step-by-step solution →
Q17·ChemistrySingle correctJEE Main 2026
Given below are two statements : Statement-I L: The first ionization enthalpy of Cr is lower than that of Mn. Statement-II : The second and third ionization enthalpies of Cr are higher than those of Mn. In the light of the above statements, choose the correct answer from the options given below :
  1. (A)Both Statement-I and Statement-II are false.
  2. (B)Statement-I is true but Statement-II is false.
  3. (C)Both Statement-I and Statement-II are true.
  4. (D)Statement-I is false but Statement-II is true.

Correct answer: (B)

Step-by-step solution →
Q18·ChemistryNumericalJEE Main 2026
Among the following oxides of 3d elements, the number of mixed oxides are_________. Ti2O3Ti_{2}O_{3}Ti2​O3​, V2O4V_{2}O_{4}V2​O4​, Cr2O3Cr_{2}O_{3}Cr2​O3​, Mn3O4Mn_{3}O_{4}Mn3​O4​, Fe3O4Fe_{3}O_{4}Fe3​O4​, Fe2O3Fe_{2}O_{3}Fe2​O3​, Co3O4Co_{3}O_{4}Co3​O4​

Correct answer: 3

Step-by-step solution →
Q19·ChemistrySingle correctJEE Main 2026
On heating a mixture of common salt and K2Cr2O7\text{K}_{2}\text{Cr}_{2}\text{O}_{7}K2​Cr2​O7​ in equal amount along with concentrated H2SO4\text{H}_{2}\text{SO}_{4}H2​SO4​ in a test tube, a gas is evolved. Formula of the gas evolved and oxidation state of the central metal atom in the gas respectively are :
  1. (A)CrO2Cl2\text{CrO}_{2}\text{Cl}_{2}CrO2​Cl2​ and +5+5+5
  2. (B)CrO2Cl2\text{CrO}_{2}\text{Cl}_{2}CrO2​Cl2​ and +6+6+6
  3. (C)Cr2O2Cl2\text{Cr}_{2}\text{O}_{2}\text{Cl}_{2}Cr2​O2​Cl2​ and +6+6+6
  4. (D)Cr2O2Cl2\text{Cr}_{2}\text{O}_{2}\text{Cl}_{2}Cr2​O2​Cl2​ and +3+3+3

Correct answer: (B)

Step-by-step solution →
Q20·ChemistrySingle correctJEE Main 2026
MnO42−MnO_4^{2-}MnO42−​ , in acidic medium, disproportionates to :
  1. (A)Mn2O7Mn_2O_7Mn2​O7​ and MnO2MnO_2MnO2​
  2. (B)MnO4−MnO_4^-MnO4−​ and MnO
  3. (C)MnO4−MnO_4^-MnO4−​ and MnO2MnO_2MnO2​
  4. (D)Mn2O7Mn_2O_7Mn2​O7​ and MnO

Correct answer: (C)

Step-by-step solution →
Q21·ChemistrySingle correctJEE Main 2026
Given below are some of the statements about Mn and Mn2O7\text{Mn}_{2}\text{O}_{7}Mn2​O7​. Identify the correct statements A. Mn forms the oxide Mn2O7\text{Mn}_{2}\text{O}_{7}Mn2​O7​ in which Mn is in its highest oxidation state. B. Oxygen stabilizes the Mn in higher oxidation states by forming multiple bonds with Mn C. Mn2O7\text{Mn}_{2}\text{O}_{7}Mn2​O7​ is an ionic oxide. D. The structure of Mn2O7\text{Mn}_{2}\text{O}_{7}Mn2​O7​ consists of one bridged oxygen. Choose the correct answer from the options given below:
  1. (A)A, B, C and D
  2. (B)A, B and D Only
  3. (C)A, C and D Only
  4. (D)A, B and C Only

Correct answer: (B)

Step-by-step solution →
Q22·ChemistryNumericalJEE Main 2026
Consider the following reactions: NaCl+K2_22​Cr2_22​O7_77​+H2_22​SO4_44​→A+KHSO4_44​+NaHSO4_44​+H2_22​O A + NaOH → B + NaCl + H2_22​O B + H2_22​SO4_44​ + H2_22​O2_22​ → C + Na2_22​SO4_44​ + H2_22​O In the product 'C', 'X' is the number of O22−_2^{2-}22−​ units, 'Y' is the total number oxygen atoms present and 'Z' is the oxidation state of Cr. The value of X + Y + Z is ________ .

Correct answer: 13

Step-by-step solution →
Q23·ChemistryMultiple correctJEE Advanced 2025
The pair(s) of diamagnetic ions is(are)
  1. (A)La3+,Ce4+La^{3+}, Ce^{4+}La3+,Ce4+
  2. (B)Yb2+,Lu3+Yb^{2+}, Lu^{3+}Yb2+,Lu3+
  3. (C)La2+,Ce3+La^{2+}, Ce^{3+}La2+,Ce3+
  4. (D)Yb3+,Lu2+Yb^{3+}, Lu^{2+}Yb3+,Lu2+

Correct answer: (A), (B)

Step-by-step solution →
Q24·ChemistrySingle correctJEE Advanced 2025
One of the products formed from the reaction of permanganate ion with iodide ion in neutral aqueous medium is
  1. (A)I2I_2I2​
  2. (B)IO3−IO_3^-IO3−​
  3. (C)IO4−IO_4^-IO4−​
  4. (D)IO2−IO_2^-IO2−​

Correct answer: (B)

Step-by-step solution →
Q25·ChemistrySingle correctJEE Main 2025
The correct decreasing order of spin only magnetic moment (BM) of Cu+Cu^+Cu+, Cu2+Cu^{2+}Cu2+, Cr2+Cr^{2+}Cr2+ and Cr3+Cr^{3+}Cr3+ ions is:
  1. (A)Cu+>Cu2+>Cr2+>Cr3+Cu^+>Cu^{2+}>Cr^{2+}>Cr^{3+}Cu+>Cu2+>Cr2+>Cr3+
  2. (B)Cu2+>Cu+>Cr2+>Cr3+Cu^{2+}>Cu^+>Cr^{2+}>Cr^{3+}Cu2+>Cu+>Cr2+>Cr3+
  3. (C)Cr2+>Cr3+>Cu2+>Cu+Cr^{2+}>Cr^{3+}>Cu^{2+}>Cu^+Cr2+>Cr3+>Cu2+>Cu+
  4. (D)Cr3+>Cr2+>Cu2+>Cu+Cr^{3+}>Cr^{2+}>Cu^{2+}>Cu^+Cr3+>Cr2+>Cu2+>Cu+

Correct answer: (C)

Step-by-step solution →
Q26·ChemistrySingle correctJEE Main 2025
The first transition series metal M has the highest enthalpy of atomisation in its series. One of its aquated ion (M2+M^{2+}M2+) exists in green colour. The nature of the oxide formed by the above M2+M^{2+}M2+ ion is:
  1. (A)neutral
  2. (B)acidic
  3. (C)basic
  4. (D)amphoteric

Correct answer: (D)

Step-by-step solution →
Q27·ChemistrySingle correctJEE Main 2025
The number of valence electrons present in the metal among Cr, Co, Fe and Ni which has the lowest enthalpy of atomisation is
  1. (A)8
  2. (B)9
  3. (C)6
  4. (D)10

Correct answer: (C)

Step-by-step solution →
Q28·ChemistrySingle correctJEE Main 2025
Pair of transition metal ions having the same number of unpaired electrons is:
  1. (A)V2+,Co2+V^{2+}, Co^{2+}V2+,Co2+
  2. (B)Ti2+,Co2+Ti^{2+}, Co^{2+}Ti2+,Co2+
  3. (C)Fe3+,Cr2+Fe^{3+}, Cr^{2+}Fe3+,Cr2+
  4. (D)Ti3+,Mn2+Ti^{3+}, Mn^{2+}Ti3+,Mn2+

Correct answer: (A)

Step-by-step solution →
Q29·ChemistrySingle correctJEE Main 2025
The incorrect relationship in the following pairs in relation to ionisation enthalpies is:
  1. (A)Mn+<Cr+Mn^+ < Cr^+Mn+<Cr+
  2. (B)Mn2+<Mn+Mn^{2+} < Mn^+Mn2+<Mn+
  3. (C)Fe2+<Fe3+Fe^{2+} < Fe^{3+}Fe2+<Fe3+
  4. (D)Mn2+<Fe2+Mn^{2+} < Fe^{2+}Mn2+<Fe2+

Correct answer: (D)

Step-by-step solution →
Q30·ChemistrySingle correctJEE Main 2025
'X' is the number of electrons in t2gt_{2g}t2g​ orbitals of the most stable complex ion among [Fe(NH3)6]3+[Fe(NH_3)_6]^{3+}[Fe(NH3​)6​]3+, [Fe(Cl)6]3−[Fe(Cl)_6]^{3-}[Fe(Cl)6​]3−, [Fe(C2O4)3]3−[Fe(C_2O_4)_3]^{3-}[Fe(C2​O4​)3​]3− and [Fe(H2O)6]3+[Fe(H_2O)_6]^{3+}[Fe(H2​O)6​]3+. The nature of oxide of vanadium of the type V2OxV_2O_xV2​Ox​ is:
  1. (A)Acidic
  2. (B)Neutral
  3. (C)Basic
  4. (D)Amphoteric

Correct answer: (D)

Step-by-step solution →
Q31·ChemistryIntegerJEE Main 2025
Among Sc, Mn, Co and Cu, identify the element with highest enthalpy of atomisation. The spin only magnetic moment value of that element in its +2 oxidation state is __________ BM (in nearest integer).

Correct answer: 4

Step-by-step solution →
Q32·ChemistrySingle correctJEE Main 2025
The metal ions that have the calculated spin only magnetic moment value of 4.9 B.M. are: (A) Cr2+Cr^{2+}Cr2+ (B) Fe2+Fe^{2+}Fe2+ (C) Fe3+Fe^{3+}Fe3+ (D) Co3+Co^{3+}Co3+ (E) Mn2+Mn^{2+}Mn2+. Choose the correct answer from the options given below:
  1. (A)(A), (C) and (E) only
  2. (B)(A), (D) and (E) only
  3. (C)(B) and (E) only
  4. (D)(A), (B) and (E) only

Correct answer: (D)

Step-by-step solution →
Q33·ChemistrySingle correctJEE Main 2025
Given below are two statements: Statement I: CrO3CrO_3CrO3​ is a stronger oxidizing agent than MoO3MoO_3MoO3​. Statement II: Cr(VI) is more stable than Mo(VI). In the light of the above statements, choose the correct answer from the options given below:
  1. (A)Statement I is false but Statement II is true
  2. (B)Statement I is true but Statement II is false
  3. (C)Both Statement I and Statement II are true
  4. (D)Both Statement I and Statement II are false

Correct answer: (B)

Step-by-step solution →
Q34·ChemistryIntegerJEE Main 2025
Consider the following reactions: A+NaCl+H2SO4(little amount)→CrO2Cl2+Side ProductsA+NaCl+H_2SO_4(\text{little amount})\to CrO_2Cl_2+\text{Side Products}A+NaCl+H2​SO4​(little amount)→CrO2​Cl2​+Side Products; CrO2Cl2(vapour)+NaOH→B+NaCl+H2OCrO_2Cl_2(\text{vapour})+NaOH\to B+NaCl+H_2OCrO2​Cl2​(vapour)+NaOH→B+NaCl+H2​O; B+H+→C+H2OB+H^+\to C+H_2OB+H+→C+H2​O. The number of terminal 'O' present in the compound 'C' is __________.

Correct answer: 6

Step-by-step solution →
Q35·ChemistryIntegerJEE Main 2025
The spin-only magnetic moment value of Mn+M^{n+}Mn+ ion formed among Ni, Zn, Mn and Cu that has the least enthalpy of atomisation is ______. (in nearest integer)

Correct answer: 0

Step-by-step solution →
Q36·ChemistryIntegerJEE Main 2025
The molar mass of the water insoluble product formed from the fusion of chromite ore (FeCr2_22​O4_44​) with Na2_22​CO3_33​ in presence of O2_22​ is ______ g mol−1^{-1}−1.

Correct answer: 160

Step-by-step solution →
Q37·ChemistrySingle correctJEE Main 2025
The correct option with order of melting points of the pairs (Mn, Fe), (Tc, Ru) and (Re, Os) is:
  1. (A)Fe < Mn, Ru < Tc and Re < Os
  2. (B)Mn < Fe, Tc < Ru and Re < Os
  3. (C)Mn < Fe, Tc < Ru and Os < Re
  4. (D)Fe < Mn, Ru < Tc and Os < Re

Correct answer: (C)

Step-by-step solution →
Q38·ChemistrySingle correctJEE Main 2025
The metal ion whose electronic configuration is not affected by the nature of the ligand and which gives a violet colour in non-luminous flame under hot condition in borax bead test is
  1. (A)Ti3+^{3+}3+
  2. (B)Ni2+^{2+}2+
  3. (C)Mn2+^{2+}2+
  4. (D)Cr3+^{3+}3+

Correct answer: (B)

Step-by-step solution →
Q39·ChemistrySingle correctJEE Main 2025
Which of the following oxidation reactions are carried out by both K2_22​Cr2_22​O7_77​ and KMnO4_44​ in acidic medium? A. I−→^-\to−→ I2_22​ B. S2−→^{2-}\to2−→ S C. Fe2+→^{2+}\to2+→ Fe3+^{3+}3+ D. I−→^-\to−→ IO3−_3^-3−​ E. S2_22​O32−→_3^{2-}\to32−​→ SO42−_4^{2-}42−​. Choose the correct answer from the options given below:
  1. (A)B, C and D only
  2. (B)A, D and E only
  3. (C)A, B and C only
  4. (D)C, D and E only

Correct answer: (C)

Step-by-step solution →
Q40·ChemistryIntegerJEE Main 2025
The spin only magnetic moment (μ\muμ) value (B.M.) of the compound with strongest oxidising power among Mn2_22​O3_33​, TiO and VO is ______ B.M. (Nearest integer).

Correct answer: 5

Step-by-step solution →
Q41·ChemistrySingle correctJEE Main 2025
Consider 'n' is the number of lone pair of electrons present in the equatorial position of the most stable structure of ClF3_33​. The ions from the following with 'n' number of unpaired electrons are: A. V3+^{3+}3+ B. Ti3+^{3+}3+ C. Cu2+^{2+}2+ D. Ni2+^{2+}2+ E. Ti2+^{2+}2+. Choose the correct answer from the options given below:
  1. (A)A and C only
  2. (B)A, D and E only
  3. (C)B and C only
  4. (D)B and D only

Correct answer: (B)

Step-by-step solution →
Q42·ChemistrySingle correctJEE Main 2025
The amphoteric oxide among V2_22​O3_33​, V2_22​O4_44​ and V2_22​O5_55​ upon reaction with alkali leads to formation of an oxide anion. The oxidation state of V in the oxide anion is:
  1. (A)+3
  2. (B)+7
  3. (C)+5
  4. (D)+4

Correct answer: (C)

Step-by-step solution →
Q43·ChemistrySingle correctJEE Main 2025
Which of the following ions is the strongest oxidizing agent ? (Atomic Number of Ce = 58, Eu = 63, Tb = 65, Lu = 71)
  1. (A)Lu3+Lu^{3+}Lu3+
  2. (B)Eu2+Eu^{2+}Eu2+
  3. (C)Tb4+Tb^{4+}Tb4+
  4. (D)Ce3+Ce^{3+}Ce3+

Correct answer: (C)

Step-by-step solution →
Q44·ChemistrySingle correctJEE Main 2025
Preparation of potassium permanganate from MnO₂ involves two step process in which the 1st step is a reaction with KOH and KNO₃ to produce
  1. (A)K4[Mn(OH)6]K_4[Mn(OH)_6]K4​[Mn(OH)6​]
  2. (B)K3MnO4K_3MnO_4K3​MnO4​
  3. (C)KMnO4KMnO_4KMnO4​
  4. (D)K2MnO4K_2MnO_4K2​MnO4​

Correct answer: (D)

Step-by-step solution →
Q45·ChemistrySingle correctJEE Main 2025
Match List-I (Transition metal ion) with List-II (Spin only magnetic moment B.M.). Choose the correct answer from the options given below:
List-I (Transition metal ion)List-II (Spin only magnetic moment B.M.)
A.Ti3+Ti^{3+}Ti3+I.3.87
B.V2+V^{2+}V2+II.0.00
C.Ni2+Ni^{2+}Ni2+III.1.73
D.Sc3+Sc^{3+}Sc3+IV.2.84
  1. (A)(A)-(III), (B)-(I), (C)-(II), (D)-(IV)
  2. (B)(A)-(III), (B)-(I), (C)-(IV), (D)-(II)
  3. (C)(A)-(IV), (B)-(II), (C)-(III), (D)-(I)
  4. (D)(A)-(II), (B)-(IV), (C)-(I), (D)-(III)

Correct answer: (B)

Step-by-step solution →
Q46·ChemistrySingle correctJEE Main 2025
The correct set of ions (aqueous solution) with same colour from the following is :
  1. (A)V²⁺, Cr³⁺, Mn³⁺
  2. (B)Zn²⁺, V³⁺, Fe³⁺
  3. (C)Ti⁴⁺, V⁴⁺, Mn²⁺
  4. (D)Sc³⁺, Ti³⁺, Cr²⁺

Correct answer: (A)

Step-by-step solution →
Q47·ChemistrySingle correctJEE Main 2025
Consider the following reactions: K2Cr2O7→KOH, −H2O[A]→H2SO4, −H2O[B]+K2SO4K_2Cr_2O_7\xrightarrow{KOH,\,-H_2O}[A]\xrightarrow{H_2SO_4,\,-H_2O}[B]+K_2SO_4K2​Cr2​O7​KOH,−H2​O​[A]H2​SO4​,−H2​O​[B]+K2​SO4​. The products [A] and [B], respectively are :
  1. (A)K2Cr(OH)4K_2Cr(OH)_4K2​Cr(OH)4​ and Cr2O3Cr_2O_3Cr2​O3​
  2. (B)K2CrO4K_2CrO_4K2​CrO4​ and Cr2O3Cr_2O_3Cr2​O3​
  3. (C)K2CrO4K_2CrO_4K2​CrO4​ and K2Cr2O7K_2Cr_2O_7K2​Cr2​O7​
  4. (D)K2CrO4K_2CrO_4K2​CrO4​ and CrOCrOCrO

Correct answer: (C)

Step-by-step solution →
Q48·ChemistrySingle correctJEE Main 2025
Lanthanoid ions with 4f⁷ configuration are: (A) Eu²⁺ (B) Gd³⁺ (C) Eu³⁺ (D) Tb³⁺ (E) Sm²⁺. Choose the correct answer from the options given below:
  1. (A)(A) and (B) only
  2. (B)(A), (B) and (E) only
  3. (C)(B) and (E) only
  4. (D)(B) and (D) only

Correct answer: (A)

Step-by-step solution →
Q49·ChemistryIntegerJEE Main 2025
Niobium (Nb) and ruthenium (Ru) have 'x' and 'y' number of electrons in their respective 4d orbitals. The value of x + y is ______.

Correct answer: 11

Step-by-step solution →
Q50·ChemistryNumericalJEE Main 2024
A transition metal 'M' among Sc, Ti, V, Cr, Mn and Fe has the highest second ionisation enthalpy. The spin-only magnetic moment value of M+M^{+}M+ ion is _______ BM (nearest integer). (Given atomic number Sc: 21, Ti: 22, V: 23, Cr: 24, Mn: 25, Fe: 26)

Correct answer: 6

Step-by-step solution →
Q51·ChemistrySingle correctJEE Main 2024
The electronic configuration of Einsteinium is: (Given atomic number of Einsteinium = 99)
  1. (A)[Rn]5f126d07s2[Rn]5f^{12}6d^{0}7s^{2}[Rn]5f126d07s2
  2. (B)[Rn]5f116d07s2[Rn]5f^{11}6d^{0}7s^{2}[Rn]5f116d07s2
  3. (C)[Rn]5f136d07s2[Rn]5f^{13}6d^{0}7s^{2}[Rn]5f136d07s2
  4. (D)[Rn]5f116d17s2[Rn]5f^{11}6d^{1}7s^{2}[Rn]5f116d17s2

Correct answer: (B)

Step-by-step solution →
Q52·ChemistrySingle correctJEE Main 2024
Given below are two statements: Statement I: The higher oxidation states are more stable down the group among transition elements unlike p-block elements. Statement II: Copper can not liberate hydrogen from weak acids. In the light of the above statements, choose the correct answer from the options given below:
  1. (A)Both Statement I and Statement II are false
  2. (B)Statement I is false but Statement II is true
  3. (C)Both Statement I and Statement II are true
  4. (D)Statement I is true but Statement II is false

Correct answer: (C)

Step-by-step solution →
Q53·ChemistryNumericalJEE Main 2024
Number of colourless lanthanoid ions among the following is _____. Eu3+,Lu3+,Nd3+,La3+,Sm3+Eu^{3+}, Lu^{3+}, Nd^{3+}, La^{3+}, Sm^{3+}Eu3+,Lu3+,Nd3+,La3+,Sm3+

Correct answer: 2

Step-by-step solution →
Q54·ChemistrySingle correctJEE Main 2024
The electronic configuration of Cu(II) is 3d93d^93d9 whereas that of Cu(I) is 3d103d^{10}3d10. Which of the following is correct ?
  1. (A)Cu(II) is less stable
  2. (B)Stability of Cu(I) and Cu(II) depends on nature of copper salts
  3. (C)Cu(II) is more stable
  4. (D)Cu(I) and Cu(II) are equally stable

Correct answer: (C)

Step-by-step solution →
Q55·ChemistrySingle correctJEE Main 2024
The equilibrium Cr2O72−⇌2CrO42−\text{Cr}_2\text{O}_7^{2-}\rightleftharpoons 2\text{CrO}_4^{2-}Cr2​O72−​⇌2CrO42−​ is shifted to the right in:
  1. (A)an acidic medium
  2. (B)a basic medium
  3. (C)a weakly acidic medium
  4. (D)a neutral medium

Correct answer: (B)

Step-by-step solution →
Q56·ChemistryNumericalJEE Main 2024
The "spin only" magnetic moment value of MO42−MO_4^{2-}MO42−​ is ___ BM. (Where M is a metal having least metallic radii among Sc, Ti, V, Cr, Mn and Zn). (Given atomic number: Sc =21=21=21, Ti =22=22=22, V =23=23=23, Cr =24=24=24, Mn =25=25=25 and Zn =30=30=30)

Correct answer: 0

Step-by-step solution →
Q57·ChemistrySingle correctJEE Main 2024
Given below are two statements: Statement (I): Fusion of MnO2\text{MnO}_2MnO2​ with KOH and an oxidising agent gives dark green K2MnO4\text{K}_2\text{MnO}_4K2​MnO4​. Statement (II): Manganate ion on electrolytic oxidation in alkaline medium gives permanganate ion. In the light of the above statements, choose the correct answer from the options given below.
  1. (A)Both Statement I and Statement II is true
  2. (B)Both Statement I and Statement II is false
  3. (C)Statement I is true but Statement II is false
  4. (D)Statement I is false but Statement II is true

Correct answer: (A)

Step-by-step solution →
Q58·ChemistrySingle correctJEE Main 2024
The number of elements from the following that do not belong to lanthanoids is: EuEuEu, CmCmCm, ErErEr, TbTbTb, YbYbYb and LuLuLu.
  1. (A)3
  2. (B)4
  3. (C)1
  4. (D)5

Correct answer: (C)

Step-by-step solution →
Q59·ChemistryNumericalJEE Main 2024
Among VO2+VO_2^{+}VO2+​, MnO4−MnO_4^{-}MnO4−​ and Cr2O72−Cr_2O_7^{2-}Cr2​O72−​, the spin-only magnetic moment value of the species with least oxidising ability is _______ BM (Nearest integer). (Given atomic number V = 23, Mn = 25, Cr = 24)

Correct answer: 0

Step-by-step solution →
Q60·ChemistryNumericalJEE Main 2024
Among CrO, Cr2O3Cr_2O_3Cr2​O3​ and CrO3CrO_3CrO3​, the sum of spin-only magnetic moment values of the basic and amphoteric oxides is _______ ×10−2\times10^{-2}×10−2 BM (nearest integer). (Given atomic number of Cr is 24)

Correct answer: 877

Step-by-step solution →
Q61·ChemistryNumericalJEE Main 2024
The difference in the 'spin-only' magnetic moment values of KMnO4KMnO_4KMnO4​ and the manganese product formed during titration of KMnO4KMnO_4KMnO4​ against oxalic acid in acidic medium is _______ BM (nearest integer).

Correct answer: 6

Step-by-step solution →
Q62·ChemistrySingle correctJEE Main 2024
Arrange the following elements in the increasing order of number of unpaired electrons in it. (A) Sc (B) Cr (C) V (D) Ti (E) Mn. Choose the correct answer from the options given below:
  1. (A)(C) < (E) < (B) < (A) < (D)
  2. (B)(B) < (C) < (D) < (E) < (A)
  3. (C)(A) < (D) < (C) < (B) < (E)
  4. (D)(A) < (D) < (C) < (E) < (B)

Correct answer: (D)

Step-by-step solution →
Q63·ChemistryNumericalJEE Main 2024
The spin-only magnetic moment value of the ion among Ti2+\text{Ti}^{2+}Ti2+, V2+\text{V}^{2+}V2+, Co3+\text{Co}^{3+}Co3+ and Cr2+\text{Cr}^{2+}Cr2+ that acts as a strong oxidising agent in aqueous solution is ___ BM (nearest integer). (Given atomic numbers: Ti = 22, V = 23, Cr = 24, Co = 27)

Correct answer: 5

Step-by-step solution →
Q64·ChemistrySingle correctJEE Main 2024
The metal that shows the highest and maximum number of oxidation states is:
  1. (A)Fe
  2. (B)Mn
  3. (C)Ti
  4. (D)Co

Correct answer: (B)

Step-by-step solution →
Q65·ChemistrySingle correctJEE Main 2024
While preparing crystals of Mohr's salt, dil. H2SO4\text{H}_2\text{SO}_4H2​SO4​ is added to a mixture of ferrous sulphate and ammonium sulphate before dissolving this mixture in water. Dil. H2SO4\text{H}_2\text{SO}_4H2​SO4​ is added here to:
  1. (A)prevent the hydrolysis of ferrous sulphate
  2. (B)prevent the hydrolysis of ammonium sulphate
  3. (C)make the medium strongly acidic
  4. (D)increase the rate of formation of crystals

Correct answer: (A)

Step-by-step solution →
Q66·ChemistrySingle correctJEE Main 2024
The number of ions from the following that have the ability to liberate hydrogen from a dilute acid is: Ti2+\text{Ti}^{2+}Ti2+, Cr2+\text{Cr}^{2+}Cr2+ and V2+\text{V}^{2+}V2+.
  1. (A)0
  2. (B)2
  3. (C)3
  4. (D)1

Correct answer: (C)

Step-by-step solution →
Q67·ChemistryNumericalJEE Main 2024
The fusion of chromite ore with sodium carbonate in the presence of air leads to the formation of products A and B along with the evolution of CO2\text{CO}_2CO2​. The sum of the spin-only magnetic moment values of A and B is __________ B.M. (Nearest integer). (Given atomic numbers: C: 6, Na: 11, O: 8, Fe: 26, Cr: 24)

Correct answer: 6

Step-by-step solution →
Q68·ChemistryNumericalJEE Main 2024
In a borax bead test under hot condition, a metal salt (one from the given) is heated at point B of the flame (shown in the figure), resulting in a green-coloured bead. The spin-only magnetic moment value of the salt is ___ (nearest integer). [Given atomic numbers: Cu = 29, Ni = 28, Mn = 25, Fe = 26]

Correct answer: 6

Step-by-step solution →
Q69·ChemistryNumericalJEE Main 2024
A first row transition metal with highest enthalpy of atomisation, upon reaction with oxygen at high temperature forms oxides of formula M2On\text{M}_2\text{O}_nM2​On​ (where n=3,4,5n=3,4,5n=3,4,5). The 'spin-only' magnetic moment value of the amphoteric oxide from the above metal is ______ BM (nearest integer).

Correct answer: 0

Step-by-step solution →
Q70·ChemistrySingle correctJEE Main 2024
A first row transition metal in its +2+2+2 oxidation state has a spin-only magnetic moment value of 3.86 BM. The atomic number of the metal is
  1. (A)25
  2. (B)26
  3. (C)22
  4. (D)23

Correct answer: (D)

Step-by-step solution →
Q71·ChemistrySingle correctJEE Main 2024
The element which shows only one oxidation state other than its elemental form is:
  1. (A)Cobalt
  2. (B)Scandium
  3. (C)Titanium
  4. (D)Nickel

Correct answer: (B)

Step-by-step solution →
Q72·ChemistryNumericalJEE Main 2024
Consider the following reaction MnO2+KOH+O2→A+H2OMnO_2+KOH+O_2\to A+H_2OMnO2​+KOH+O2​→A+H2​O. Product "A" in neutral or acidic medium disproportionate to give products "B" and "C" along with water. The sum of spin-only magnetic moment values of B and C is ___ BM. (nearest integer) (Given atomic number of Mn is 252525)

Correct answer: 4

Step-by-step solution →
Q73·ChemistrySingle correctJEE Main 2024
Given below are two statements: one is labelled as Assertion (A) and the other is labelled as Reason (R). Assertion (A): In aqueous solutions Cr2+\text{Cr}^{2+}Cr2+ is reducing and Mn3+\text{Mn}^{3+}Mn3+ is oxidising in nature. Reason (R): Extra stability to half filled electronic configuration is observed than incompletely filled electronic configuration. In the light of the above statement, choose the most appropriate answer from the options given below:
  1. (A)Both (A) and (R) are true and (R) is the correct explanation of (A)
  2. (B)Both (A) and (R) are true but (R) is not the correct explanation of (A)
  3. (C)(A) is false but (R) is true
  4. (D)(A) is true but (R) is false

Correct answer: (A)

Step-by-step solution →
Q74·ChemistrySingle correctJEE Main 2024
Which of the following compounds show colour due to d–d transition?
  1. (A)CuSO4⋅5H2O\text{CuSO}_4\cdot 5\text{H}_2\text{O}CuSO4​⋅5H2​O
  2. (B)K2Cr2O7\text{K}_2\text{Cr}_2\text{O}_7K2​Cr2​O7​
  3. (C)K2CrO4\text{K}_2\text{CrO}_4K2​CrO4​
  4. (D)KMnO4\text{KMnO}_4KMnO4​

Correct answer: (A)

Step-by-step solution →
Q75·ChemistrySingle correctJEE Main 2024
The transition metal having highest 3rd3^{\text{rd}}3rd ionisation enthalpy is:
  1. (A)Cr
  2. (B)Mn
  3. (C)V
  4. (D)Fe

Correct answer: (B)

Step-by-step solution →
Q76·ChemistrySingle correctJEE Main 2024
Choose the correct statements from the following A. Mn2O7Mn_2O_7Mn2​O7​ is an oil at room temperature B. V2O4V_2O_4V2​O4​ reacts with acid to give VO2+VO_2^+VO2+​ C. CrOCrOCrO is a basic oxide D. V2O5V_2O_5V2​O5​ does not react with acid Choose the correct answer from the options given below:
  1. (A)A, B and D only
  2. (B)A and C only
  3. (C)A, B and C only
  4. (D)B and C only

Correct answer: (B)

Step-by-step solution →
Q77·ChemistrySingle correctJEE Main 2024
Identify correct statements from below: A. The chromate ion is square planar. B. Dichromates are generally prepared from chromates. C. The green manganate ion is diamagnetic. D. Dark green coloured K2MnO4K_2MnO_4K2​MnO4​ disproportionates in a neutral or acidic medium to give permanganate. E. With increasing oxidation number of transition metal, ionic character of the oxides decreases. Choose the correct answer from the options given below:
  1. (A)B, C, D only
  2. (B)A, D, E only
  3. (C)A, B, C only
  4. (D)B, D, E only

Correct answer: (D)

Step-by-step solution →
Q78·ChemistryNumericalJEE Main 2024
In the reaction of potassium dichromate, potassium chloride and sulfuric acid (conc.), the oxidation state of the chromium in the product is (+)(+)(+) ______.

Correct answer: 6

Step-by-step solution →
Q79·ChemistrySingle correctJEE Main 2024
Diamagnetic Lanthanoid ions are:
  1. (A)Nd3+Nd^{3+}Nd3+ and Eu3+Eu^{3+}Eu3+
  2. (B)La3+La^{3+}La3+ and Ce4+Ce^{4+}Ce4+
  3. (C)Nd3+Nd^{3+}Nd3+ and Ce4+Ce^{4+}Ce4+
  4. (D)Lu3+Lu^{3+}Lu3+ and Eu3+Eu^{3+}Eu3+

Correct answer: (B)

Step-by-step solution →
Q80·ChemistrySingle correctJEE Main 2024
The orange colour of K2Cr2O7K_2Cr_2O_7K2​Cr2​O7​ and purple colour of KMnO4KMnO_4KMnO4​ is due to:
  1. (A)Charge transfer transition in both.
  2. (B)ddd-ddd transition in KMnO4KMnO_4KMnO4​ and charge transfer transitions in K2Cr2O7K_2Cr_2O_7K2​Cr2​O7​.
  3. (C)ddd-ddd transition in K2Cr2O7K_2Cr_2O_7K2​Cr2​O7​ and charge transfer transition in KMnO4KMnO_4KMnO4​.
  4. (D)ddd-ddd transition in both.

Correct answer: (A)

Step-by-step solution →
Q81·ChemistrySingle correctJEE Main 2024
Match List-I with List-II. Choose the correct answer from the options given below:
List-I (Species)List-II (Electronic distribution)
A.Cr2+Cr^{2+}Cr2+I.3d83d^83d8
B.Mn+Mn^{+}Mn+II.3d34s13d^3 4s^13d34s1
C.Ni2+Ni^{2+}Ni2+III.3d43d^43d4
D.V+V^{+}V+IV.3d54s13d^5 4s^13d54s1
  1. (A)(A)-I, (B)-II, (C)-III, (D)-IV
  2. (B)(A)-III, (B)-IV, (C)-I, (D)-II
  3. (C)(A)-IV, (B)-III, (C)-I, (D)-II
  4. (D)(A)-II, (B)-I, (C)-IV, (D)-III

Correct answer: (B)

Step-by-step solution →
Q82·ChemistrySingle correctJEE Main 2024
Alkaline oxidative fusion of MnO2MnO_2MnO2​ gives "A" which on electrolytic oxidation in alkaline solution produces B. A and B respectively are:
  1. (A)Mn2O3Mn_2O_3Mn2​O3​ and MnO4−MnO_4^-MnO4−​
  2. (B)MnO42−MnO_4^{2-}MnO42−​ and MnO4−MnO_4^-MnO4−​
  3. (C)Mn2O3Mn_2O_3Mn2​O3​ and MnO42−MnO_4^{2-}MnO42−​
  4. (D)MnO42−MnO_4^{2-}MnO42−​ and Mn2O3Mn_2O_3Mn2​O3​

Correct answer: (B)

Step-by-step solution →
Q83·ChemistrySingle correctJEE Main 2024
A and B formed in the following reactions are: CrO2Cl2+4NaOH→A+2NaCl+2H2OCrO_2Cl_2 + 4NaOH \rightarrow A + 2NaCl + 2H_2OCrO2​Cl2​+4NaOH→A+2NaCl+2H2​O A+2HCl+2H2O2→B+3H2OA + 2HCl + 2H_2O_2 \rightarrow B + 3H_2OA+2HCl+2H2​O2​→B+3H2​O
  1. (A)A=Na2CrO4, B=CrO5A = Na_2CrO_4,\ B = CrO_5A=Na2​CrO4​, B=CrO5​
  2. (B)A=Na2Cr2O7, B=CrO4A = Na_2Cr_2O_7,\ B = CrO_4A=Na2​Cr2​O7​, B=CrO4​
  3. (C)A=Na2Cr2O7, B=CrO3A = Na_2Cr_2O_7,\ B = CrO_3A=Na2​Cr2​O7​, B=CrO3​
  4. (D)A=Na2Cr2O7, B=CrO5A = Na_2Cr_2O_7,\ B = CrO_5A=Na2​Cr2​O7​, B=CrO5​

Correct answer: (A)

Step-by-step solution →
Q84·ChemistrySingle correctJEE Main 2024
KMnO4KMnO_4KMnO4​ decomposes on heating at 513 K to form O2O_2O2​ along with
  1. (A)MnO2MnO_2MnO2​ & K2O2K_2O_2K2​O2​
  2. (B)K2MnO4K_2MnO_4K2​MnO4​ & Mn
  3. (C)Mn & KO2KO_2KO2​
  4. (D)K2MnO4K_2MnO_4K2​MnO4​ & MnO2MnO_2MnO2​

Correct answer: (D)

Step-by-step solution →
Q85·ChemistrySingle correctJEE Main 2024
In chromyl chloride test for confirmation of Cl−Cl^-Cl− ion, a yellow solution is obtained. Acidification of the solution and addition of amyl alcohol and 10% H2O2H_2O_2H2​O2​ turns organic layer blue indicating formation of chromium pentoxide. The oxidation state of chromium in that is
  1. (A)+6+6+6
  2. (B)+5+5+5
  3. (C)+10+10+10
  4. (D)+3+3+3

Correct answer: (A)

Step-by-step solution →
Q86·ChemistrySingle correctJEE Main 2024
Which of the following statements are correct about Zn, Cd and Hg? A. They exhibit high enthalpy of atomization as the d-subshell is full. B. Zn and Cd do not show variable oxidation state while Hg shows +I and +II. C. Compounds of Zn, Cd and Hg are paramagnetic in nature. D. Zn, Cd and Hg are called soft metals. Choose the most appropriate from the options given below:
  1. (A)B, D only
  2. (B)B, C only
  3. (C)A, D only
  4. (D)C, D only

Correct answer: (A)

Step-by-step solution →
Q87·ChemistrySingle correctJEE Main 2024
The correct IUPAC name of K2MnO4K_2MnO_4K2​MnO4​ is:
  1. (A)Potassium tetraoxopermanganate (VI)
  2. (B)Potassium tetraoxidomanganate (VI)
  3. (C)Dipotassium tetraoxidomanganate (VII)
  4. (D)Potassium tetraoxidomanganese (VI)

Correct answer: (B)

Step-by-step solution →
Q88·ChemistrySingle correctJEE Main 2024
Which of the following acts as a strong reducing agent? (Atomic number: Ce = 58, Eu = 63, Gd = 64, Lu = 71)
  1. (A)Lu3+Lu^{3+}Lu3+
  2. (B)Gd3+Gd^{3+}Gd3+
  3. (C)Eu2+Eu^{2+}Eu2+
  4. (D)Ce4+Ce^{4+}Ce4+

Correct answer: (C)

Step-by-step solution →
Q89·ChemistrySingle correctJEE Main 2024
Identify the incorrect pair from the following : (1) Photography – AgBr (2) Polythene preparation – TiCl4TiCl_4TiCl4​, Al(CH3)3Al(CH_3)_3Al(CH3​)3​ (3) Rubber process – Pt (4) Wacker process – PtCl2PtCl_2PtCl2​
  1. (A)Photography – AgBr
  2. (B)Polythene preparation – TiCl4TiCl_4TiCl4​, Al(CH3)3Al(CH_3)_3Al(CH3​)3​
  3. (C)Rubber process – Pt
  4. (D)Wacker process – PtCl2PtCl_2PtCl2​

Correct answer: (D)

Step-by-step solution →
Q90·ChemistrySingle correctJEE Main 2024
NaCl reacts with conc. H2SO4\text{H}_2\text{SO}_4H2​SO4​ and K2Cr2O7\text{K}_2\text{Cr}_2\text{O}_7K2​Cr2​O7​ to give reddish fumes (B), which react with NaOH to give yellow solution (C). (B) and (C) respectively are:
  1. (A)CrO2Cl2,  Na2CrO4\text{CrO}_2\text{Cl}_2,\;\text{Na}_2\text{CrO}_4CrO2​Cl2​,Na2​CrO4​
  2. (B)Na2CrO4,  CrO2Cl2\text{Na}_2\text{CrO}_4,\;\text{CrO}_2\text{Cl}_2Na2​CrO4​,CrO2​Cl2​
  3. (C)CrO2Cl2,  KHSO4\text{CrO}_2\text{Cl}_2,\;\text{KHSO}_4CrO2​Cl2​,KHSO4​
  4. (D)CrO2Cl2,  Na2Cr2O7\text{CrO}_2\text{Cl}_2,\;\text{Na}_2\text{Cr}_2\text{O}_7CrO2​Cl2​,Na2​Cr2​O7​

Correct answer: (A)

Step-by-step solution →
Q91·ChemistrySingle correctJEE Main 2024
Given below are two statements : Statement (I) : In the Lanthanoids, the formation of Ce+4Ce^{+4}Ce+4 is favoured by its noble gas configuration. Statement (II) : Ce+4Ce^{+4}Ce+4 is a strong oxidant reverting to the common +3 state. In the light of the above statements, choose the most appropriate answer from the options given below :
  1. (A)Statement I is false but Statement II is true
  2. (B)Both Statement I and Statement II are true
  3. (C)Statement I is true but Statement II is false
  4. (D)Both Statement I and Statement II are false

Correct answer: (B)

Step-by-step solution →
Q92·ChemistrySingle correctJEE Main 2024
Consider the following complex ions P=[FeF6]3−P=[\text{FeF}_6]^{3-}P=[FeF6​]3−, Q=[V(H2O)6]2+Q=[\text{V}(\text{H}_2\text{O})_6]^{2+}Q=[V(H2​O)6​]2+, R=[Fe(H2O)6]2+R=[\text{Fe}(\text{H}_2\text{O})_6]^{2+}R=[Fe(H2​O)6​]2+. The correct order of the complex ions, according to their spin only magnetic moment values (in B.M.) is:
  1. (A)R<Q<PR<Q<PR<Q<P
  2. (B)R<P<QR<P<QR<P<Q
  3. (C)Q<R<PQ<R<PQ<R<P
  4. (D)Q<P<RQ<P<RQ<P<R

Correct answer: (C)

Step-by-step solution →
Q93·ChemistrySingle correctJEE Main 2024
Choose the correct option having all the elements with d10d^{10}d10 electronic configuration from the following :
  1. (A)27_{27}27​Co, 28_{28}28​Ni, 24_{24}24​Cr
  2. (B)29_{29}29​Cu, 30_{30}30​Zn, 48_{48}48​Cd, 47_{47}47​Ag
  3. (C)46_{46}46​Pd, 28_{28}28​Ni, 26_{26}26​Fe, 24_{24}24​Cr
  4. (D)28_{28}28​Ni, 24_{24}24​Cr, 26_{26}26​Fe, 29_{29}29​Cu

Correct answer: (B)

Step-by-step solution →
Q94·ChemistrySingle correctJEE Main 2024
Which of the following electronic configuration would be associated with the highest magnetic moment?
  1. (A)[Ar] 3d7[\text{Ar}]\,3d^7[Ar]3d7
  2. (B)[Ar] 3d8[\text{Ar}]\,3d^8[Ar]3d8
  3. (C)[Ar] 3d3[\text{Ar}]\,3d^3[Ar]3d3
  4. (D)[Ar] 3d6[\text{Ar}]\,3d^6[Ar]3d6

Correct answer: (D)

Step-by-step solution →
Q95·ChemistrySingle correctJEE Advanced 2023
In the scheme given below, X and Y, respectively, are
  1. (A)CrO42−\mathrm{CrO_4^{2-}}CrO42−​ and Br2\mathrm{Br_2}Br2​
  2. (B)MnO42−\mathrm{MnO_4^{2-}}MnO42−​ and Cl2\mathrm{Cl_2}Cl2​
  3. (C)MnO4−\mathrm{MnO_4^{-}}MnO4−​ and Cl2\mathrm{Cl_2}Cl2​
  4. (D)MnSO4\mathrm{MnSO_4}MnSO4​ and HOCl\mathrm{HOCl}HOCl

Correct answer: (C)

Step-by-step solution →
Q96·ChemistryNumericalJEE Main 2023
In Chromyl chloride, the oxidation state of chromium is (+)_______

Correct answer: 6

Step-by-step solution →
Q97·ChemistrySingle correctJEE Main 2023
The pair of lanthanides in which both elements have high third-ionization energy is:
  1. (A)Eu, Gd
  2. (B)Eu, Yb
  3. (C)Lu, Yb
  4. (D)Dy, Gd

Correct answer: (B)

Step-by-step solution →
Q98·ChemistrySingle correctJEE Main 2023
Given below are two statements: one is labelled as Assertion A and the other is labelled as Reason R. Assertion A: 5f electrons can participate in bonding to a far greater extent than 4f electrons. Reason R: 5f orbitals are not as buried as 4f orbitals. In the light of the above statements, choose the correct answer from the options given below:
  1. (A)Both A and R are true but R is NOT the correct explanation of A
  2. (B)Both A and R are true and R is the correct explanation of A
  3. (C)A is false but R is true
  4. (D)A is true but R is false

Correct answer: (B)

Step-by-step solution →
Q99·ChemistrySingle correctJEE Main 2023
Which of the following statements are correct? (A) The M3+^{3+}3+/M2+^{2+}2+ reduction potential for iron is greater than manganese. (B) The higher oxidation states of first row d-block elements get stabilized by oxide ion. (C) Aqueous solution of Cr2+^{2+}2+ can liberate hydrogen from dilute acid. (D) Magnetic moment of V2+^{2+}2+ is observed between 4.4-5.2 BM. Choose the correct answer from the options given below:
  1. (A)(B), (C) only
  2. (B)(C), (D) only
  3. (C)(A), (B), (D) only
  4. (D)(A), (B) only

Correct answer: (A)

Step-by-step solution →
Q100·ChemistrySingle correctJEE Main 2023
Prolonged heating is avoided during the preparation of ferrous ammonium sulphate to
  1. (A)prevent oxidation
  2. (B)prevent reduction
  3. (C)prevent hydrolysis
  4. (D)prevent breaking

Correct answer: (A)

Step-by-step solution →
Q101·ChemistrySingle correctJEE Main 2023
In chromyl chloride, the number of d-electrons present on chromium is same as in (Given at. no. of Ti : 22, V : 23, Cr : 24, Mn : 25, Fe : 26)
  1. (A)Ti (III)
  2. (B)Fe (III)
  3. (C)V (IV)
  4. (D)Mn (VII)

Correct answer: (D)

Step-by-step solution →
Q102·ChemistryNumericalJEE Main 2023
In ammonium-phosphomolybdate, the oxidation state of Mo is +++_____.

Correct answer: 6

Step-by-step solution →
Q103·ChemistrySingle correctJEE Main 2023
Strong reducing and oxidizing agents among the following, respectively, are:
  1. (A)Eu2+Eu^{2+}Eu2+ and Yb2+Yb^{2+}Yb2+
  2. (B)Ce3+Ce^{3+}Ce3+ and Tb4+Tb^{4+}Tb4+
  3. (C)Ce4+Ce^{4+}Ce4+ and Tb4+Tb^{4+}Tb4+
  4. (D)Eu2+Eu^{2+}Eu2+ and Ce4+Ce^{4+}Ce4+

Correct answer: (D)

Step-by-step solution →
Q104·ChemistrySingle correctJEE Main 2023
Highest oxidation state of Mn is exhibited in Mn2O7\text{Mn}_2\text{O}_7Mn2​O7​. The correct statements about Mn2O7\text{Mn}_2\text{O}_7Mn2​O7​ are: (A) Mn is tetrahedrally surrounded by oxygen atoms. (B) Mn is octahedrally surrounded by oxygen atoms. (C) Contains Mn-O-Mn bridge. (D) Contains Mn-Mn bond. Choose the correct answer from the options given below:
  1. (A)A and C only
  2. (B)A and D only
  3. (C)B and C only
  4. (D)B and D only

Correct answer: (A)

Step-by-step solution →
Q105·ChemistrySingle correctJEE Main 2023
Given below are two statements: one is labelled as Assertion (A) and the other is labelled as Reason (R). Assertion (A): Cu2+Cu^{2+}Cu2+ in water is more stable than Cu+Cu^{+}Cu+. Reason (R): Enthalpy of hydration for Cu2+Cu^{2+}Cu2+ is much less than that of Cu+Cu^{+}Cu+. In the light of the above statements, choose the correct answer from the options given below:
  1. (A)Both (A) and (R) are correct and (R) is the correct explanation of (A)
  2. (B)(A) is not correct but (R) is correct
  3. (C)(A) is correct but (R) is not correct
  4. (D)Both (A) and (R) are correct but (R) is not the correct explanation of (A)

Correct answer: (A)

Step-by-step solution →
Q106·ChemistrySingle correctJEE Main 2023
Given below are two statements: one is labelled as Assertion (A) and the other is labelled as Reason (R). Assertion (A): The first ionization enthalpy of 3d series elements is more than that of group 2 metals. Reason (R): In 3d series of elements successive filling of d-orbitals takes place. In the light of the above statements, choose the correct answer from the options given below:
  1. (A)Both (A) and (R) are true but (R) is not the correct explanation of (A)
  2. (B)Both (A) and (R) are true and (R) is the correct explanation of (A)
  3. (C)(A) is true but (R) is false
  4. (D)(A) is false but (R) is true

Correct answer: (B)

Step-by-step solution →
Q107·ChemistrySingle correctJEE Main 2023
Which of the following elements have half-filled f-orbitals in their ground state? (Given atomic number Sm=62; Eu=63; Tb=65; Gd=64; Pm=61) A. Sm B. Eu C. Tb D. Gd E. Pm. Choose the correct answer from the options given below:
  1. (A)A and B only
  2. (B)A and E only
  3. (C)C and D only
  4. (D)B and D only

Correct answer: (D)

Step-by-step solution →
Q108·ChemistrySingle correctJEE Main 2023
Nd2+Nd^{2+}Nd2+ =
  1. (A)4f34f^34f3
  2. (B)4f46s24f^46s^24f46s2
  3. (C)4f44f^44f4
  4. (D)4f26s24f^26s^24f26s2

Correct answer: (C)

Step-by-step solution →
Q109·ChemistrySingle correctJEE Main 2023
The correct order of basicity of oxides of vanadium is
  1. (A)V2O5>V2O4>V2O3V_2O_5 > V_2O_4 > V_2O_3V2​O5​>V2​O4​>V2​O3​
  2. (B)V2O4>V2O3>V2O5V_2O_4 > V_2O_3 > V_2O_5V2​O4​>V2​O3​>V2​O5​
  3. (C)V2O3>V2O5>V2O4V_2O_3 > V_2O_5 > V_2O_4V2​O3​>V2​O5​>V2​O4​
  4. (D)V2O3>V2O4>V2O5V_2O_3 > V_2O_4 > V_2O_5V2​O3​>V2​O4​>V2​O5​

Correct answer: (D)

Step-by-step solution →
Q110·ChemistrySingle correctJEE Main 2023
A solution of CrO5CrO_5CrO5​ in amyl alcohol has a _______ colour.
  1. (A)Green
  2. (B)Orange-Red
  3. (C)Yellow
  4. (D)Blue

Correct answer: (D)

Step-by-step solution →
Q111·ChemistrySingle correctJEE Main 2023
The set of correct statements is: (i) Manganese exhibits +7+7+7 oxidation state in its oxide. (ii) Ruthenium and Osmium exhibit +8+8+8 oxidation in their oxides. (iii) Sc shows +4+4+4 oxidation state which is oxidizing in nature. (iv) Cr shows oxidising nature in +6+6+6 oxidation state.
  1. (A)(ii) and (iii)
  2. (B)(i), (ii) and (iv)
  3. (C)(ii), (iii) and (iv)
  4. (D)(i) and (iii)

Correct answer: (B)

Step-by-step solution →
Q112·ChemistryNumericalJEE Main 2023
How many of the following metal ions have similar value of spin only magnetic moment in gaseous state? (Given atomic number: V, 23; Cr, 24; Fe, 26; Ni, 28) V3+,Cr3+,Fe2+,Ni3+V^{3+}, Cr^{3+}, Fe^{2+}, Ni^{3+}V3+,Cr3+,Fe2+,Ni3+. The number is _______.

Correct answer: 2

Step-by-step solution →
Q113·ChemistrySingle correctJEE Main 2023
The magnetic moment of a transition metal compound has been calculated to be 3.87 B.M. The metal ion is:
  1. (A)Cr2+\text{Cr}^{2+}Cr2+
  2. (B)Ti2+\text{Ti}^{2+}Ti2+
  3. (C)V2+\text{V}^{2+}V2+
  4. (D)Mn2+\text{Mn}^{2+}Mn2+

Correct answer: (C)

Step-by-step solution →
Q114·ChemistrySingle correctJEE Main 2023
Which one amongst the following are good oxidizing agents? (A) Sm2+Sm^{2+}Sm2+ (B) Ce2+Ce^{2+}Ce2+ (C) Ce4+Ce^{4+}Ce4+ (D) Tb4+Tb^{4+}Tb4+. Choose the most appropriate answer from the options given below:
  1. (A)D only
  2. (B)C only
  3. (C)C and D only
  4. (D)A and B only

Correct answer: (C)

Step-by-step solution →
Q115·ChemistrySingle correctJEE Main 2023
K2Cr2O7K_2Cr_2O_7K2​Cr2​O7​ paper acidified with dilute H2SO4H_2SO_4H2​SO4​ turns green when exposed to
  1. (A)Carbon dioxide
  2. (B)Sulphur trioxide
  3. (C)Sulphur dioxide
  4. (D)Hydrogen sulphide

Correct answer: (C)

Step-by-step solution →
Q116·ChemistrySingle correctJEE Main 2022
In following pairs, the one in which both transition metal ions are colourless is :
  1. (A)Sc3+Sc^{3+}Sc3+, Zn2+Zn^{2+}Zn2+
  2. (B)Ti4+Ti^{4+}Ti4+, Cu2+Cu^{2+}Cu2+
  3. (C)V2+V^{2+}V2+, Ti3+Ti^{3+}Ti3+
  4. (D)Zn2+Zn^{2+}Zn2+, Mn2+Mn^{2+}Mn2+

Correct answer: (A)

Step-by-step solution →
Q117·ChemistrySingle correctJEE Main 2022
Which of the following 3d-metal ion will give the lowest enthalpy of hydration (Δhyd_{hyd}hyd​H) when dissolved in water ?
  1. (A)Cr2+^{2+}2+
  2. (B)Mn2+^{2+}2+
  3. (C)Fe2+^{2+}2+
  4. (D)Co2+^{2+}2+

Correct answer: (B)

Step-by-step solution →
Q118·ChemistryNumericalJEE Main 2022
The disproportionation of MnO42−_4^{2-}42−​ in acidic medium resulted in the formation of two manganese compounds A and B. If the oxidation state of Mn in B is smaller than that of A, then the spin-only magnetic moment (μ) value of B in BM is __________. (Nearest integer)

Correct answer: 4

Step-by-step solution →
Q119·ChemistrySingle correctJEE Main 2022
Which of the following has least tendency to liberate H2_22​ from mineral acids ?
  1. (A)Cu
  2. (B)Mn
  3. (C)Ni
  4. (D)Zn

Correct answer: (A)

Step-by-step solution →
Q120·ChemistrySingle correctJEE Main 2022
Which of the following pair is not isoelectronic species? (At. no. Sm, 62; Er, 68: Yb, 70: Lu, 71; Eu, 63: Tb, 65; Tm, 69)
  1. (A)Sm2+\mathrm{Sm^{2+}}Sm2+ and Er3+\mathrm{Er^{3+}}Er3+
  2. (B)Yb2+\mathrm{Yb^{2+}}Yb2+ and Lu3+\mathrm{Lu^{3+}}Lu3+
  3. (C)Eu2+\mathrm{Eu^{2+}}Eu2+ and Tb4+\mathrm{Tb^{4+}}Tb4+
  4. (D)Tb2+\mathrm{Tb^{2+}}Tb2+ and Tm4+\mathrm{Tm^{4+}}Tm4+

Correct answer: (D)

Step-by-step solution →
Q121·ChemistrySingle correctJEE Main 2022
Given below are two statements: Statement I : Iron (III) catalyst, acidified K2Cr2O7K_{2}Cr_{2}O_{7}K2​Cr2​O7​ and neutral KMnO4KMnO_{4}KMnO4​ have the ability to oxidise I−I^{-}I− to I2I_{2}I2​ independently. Statement II: Manganate ion is paramagnetic in nature and involves pπ –pπ bonding. In the light of the above statements, choose the correct answer from the options.
  1. (A)Both statement I and Statement II are ture
  2. (B)Both statement I and Statement II are false
  3. (C)Statement I is true but Statement II is false
  4. (D)Statement I is false but Statement II is true

Correct answer: (B)

Step-by-step solution →
Q122·ChemistrySingle correctJEE Main 2022
In neutral or alkaline solution, MnO4−_{4}^{-}4−​ oxidises thiosulphate to:
  1. (A)S2_{2}2​O72−_{7}^{2-}72−​
  2. (B)S2_{2}2​O82−_{8}^{2-}82−​
  3. (C)SO32−_{3}^{2-}32−​
  4. (D)SO42−_{4}^{2-}42−​

Correct answer: (D)

Step-by-step solution →
Q123·ChemistrySingle correctJEE Main 2022
The total number of Mn = O bonds in Mn2O7Mn_{2}O_{7}Mn2​O7​ is ____
  1. (A)4
  2. (B)5
  3. (C)6
  4. (D)3

Correct answer: (C)

Step-by-step solution →
Q124·ChemistryNumericalJEE Main 2022
The oxidation state of manganese in the product obtained in a reaction of potassium permanganate and hydrogen peroxide in basic medium is______.

Correct answer: 4

Step-by-step solution →
Q125·ChemistryNumericalJEE Main 2022
The spin-only magnetic moment value of the compound with strongest oxidizing ability among MnF4MnF_{4}MnF4​, MnF3MnF_{3}MnF3​ and MnF2MnF_{2}MnF2​ is ______ B.M. [nearest integer]

Correct answer: 5

Step-by-step solution →
Q126·ChemistryNumericalJEE Main 2022
Among Co3+Co^{3+}Co3+, Ti2+Ti^{2+}Ti2+, V2+V^{2+}V2+ and Cr2+Cr^{2+}Cr2+ions, one if used as a reagent cannot liberate H2H_{2}H2​ from dilute mineral acid solution, its spin-only magnetic moment in gaseous state is ……B.M. (Nearest integer)

Correct answer: 5

Step-by-step solution →
Q127·ChemistryNumericalJEE Main 2022
An acidified manganate solution undergoes disproportionation reaction. The spin-only magnetic moment value of the product having manganese in higher oxidation state is _______ B.M. (Nearest integer)

Correct answer: 0

Step-by-step solution →
Q128·ChemistryNumericalJEE Main 2022
The number of terminal oxygen atoms present in the product B obtained from the following reaction is _______ . FeCr2O4FeCr_2O_4FeCr2​O4​ + Na2CO3Na_2CO_3Na2​CO3​ + O2O_2O2​ → A + Fe2O3Fe_2O_3Fe2​O3​ + CO2CO_2CO2​ A + H+H^+H+ → B + H2OH_2OH2​O + Na+Na^+Na+

Correct answer: 6

Step-by-step solution →
Q129·ChemistrySingle correctJEE Main 2022
The electronic configuration of Pt (atomic number 78) is:
  1. (A)[Xe] 4f145d96s14f^{14} 5d^9 6s^14f145d96s1
  2. (B)[Kr] 4f145d104f^{14} 5d^{10}4f145d10
  3. (C)[Xe] 4f145d104f^{14} 5d^{10}4f145d10
  4. (D)[Xe] 4f145d86s24f^{14} 5d^8 6s^24f145d86s2

Correct answer: (A)

Step-by-step solution →
Q130·ChemistrySingle correctJEE Main 2022
Which one of the lanthanoids given below is the most stable in divalent form?
  1. (A)Ce (Atomic Number 58)
  2. (B)Sm (Atomic Number 62)
  3. (C)Eu (Atomic Number 63)
  4. (D)Yb (Atomic Number 70)

Correct answer: (C)

Step-by-step solution →
Q131·ChemistrySingle correctJEE Main 2022
In 3d series, the metal having the highest M2+^{2+}2+/M standard electrode potential is
  1. (A)Cr
  2. (B)Fe
  3. (C)Cu
  4. (D)Zn

Correct answer: (C)

Step-by-step solution →
Q132·ChemistryNumericalJEE Main 2022
The number of statement(s) correct from the following for copper (at no. 29) is/are _______ (A) Cu(II) complexes are always paramagnetic (B) Cu(I) complexes are generally colourless (C) Cu(I) is easily oxidized (D) In Fehling solution, the active reagent has Cu(I)

Correct answer: 3

Step-by-step solution →
Q133·ChemistryNumericalJEE Main 2022
Acidified potassium permanganate solution oxidises oxalic acid. The spin-only magnetic moment of the manganese product formed from the above reaction is ______ B.M. (Nearest Integer)

Correct answer: 6

Step-by-step solution →
Q134·ChemistrySingle correctJEE Main 2022
The 'f' orbitals are half and completely filled, respectively in lanthanide ions (Given: Atomic no. Eu, 63; Sm, 62; Tm, 69; Tb, 65; Yb, 70; Dy, 66]
  1. (A)Eu2+^{2+}2+ and Tm2+^{2+}2+
  2. (B)Sm2+^{2+}2+ and Tm3+^{3+}3+
  3. (C)Tb4+^{4+}4+ and Yb2+^{2+}2+
  4. (D)Dy3+^{3+}3+ and Yb3+^{3+}3+

Correct answer: (C)

Step-by-step solution →
Q135·ChemistrySingle correctJEE Main 2022
The most common oxidation state of Lanthanoid elements is +3. Which of the following is likely to deviate easily from +3 oxidation state?
  1. (A)Ce (At. No. 58)
  2. (B)La (At. No. 57)
  3. (C)Lu (At. No. 71)
  4. (D)Gd (At. No. 64)

Correct answer: (A)

Step-by-step solution →
Q136·ChemistryNumericalJEE Main 2022
The spin–only magnetic moment value of the most basic oxide of vanadium among V2O3V_{2}O_{3}V2​O3​, V2O4V_{2}O_{4}V2​O4​ and V2O5V_{2}O_{5}V2​O5​ is ______ B.M. (Nearest Integer)

Correct answer: 3

Step-by-step solution →
Q137·ChemistrySingle correctJEE Main 2022
The metal ion (in gaseous state) with lowest spin-only magnetic moment value is
  1. (A)V2+^{2+}2+
  2. (B)Ni2+^{2+}2+
  3. (C)Cr2+^{2+}2+
  4. (D)Fe2+^{2+}2+

Correct answer: (B)

Step-by-step solution →
Q138·ChemistrySingle correctJEE Main 2022
Among the following, which is the strongest oxidizing agent ?
  1. (A)Mn3+Mn^{3+}Mn3+
  2. (B)Fe3+Fe^{3+}Fe3+
  3. (C)Ti3+Ti^{3+}Ti3+
  4. (D)Cr3+Cr^{3+}Cr3+

Correct answer: (A)

Step-by-step solution →
Q139·ChemistrySingle correctJEE Main 2022
Cerium (IV) has a noble gas configuration. Which of the following is correct statement about it?
  1. (A)It will not prefer to undergo redox reactions.
  2. (B)It will prefer to gain electron and act as an oxidizing agent
  3. (C)It will prefer to give away an electron and behave as reducing agent
  4. (D)It acts as both, oxidizing and reducing agent.

Correct answer: (B)

Step-by-step solution →
Q140·ChemistryNumericalJEE Main 2022
Manganese (VI) has ability to disproportionate in acidic solution. The difference in oxidation states of two ions it forms in acidic solution is_______

Correct answer: 3

Step-by-step solution →
Q141·ChemistryNumericalJEE Main 2022
The difference in oxidation state of chromium in chromate and dichromate salts is ________

Correct answer: 0

Step-by-step solution →
Q142·ChemistrySingle correctJEE Main 2021
In the given chemical reaction, colors of the Fe2+^{2+}2+ and Fe3+^{3+}3+ ions, are respectively : 5Fe2+^{2+}2+ + MnO4−_{4}^{-}4−​ + 8H+^{+}+ → Mn2+^{2+}2+ + 4H2_{2}2​O + 5Fe3+^{3+}3+
  1. (A)Yellow, Orange
  2. (B)Yellow, Green
  3. (C)Green, Orange
  4. (D)Green, Yellow

Correct answer: (D)

Step-by-step solution →
Q143·ChemistrySingle correctJEE Main 2021
Identify the element for which electronic configuration in +3 oxidation state is [Ar]3d5^{5}5:
  1. (A)Ru
  2. (B)Mn
  3. (C)Co
  4. (D)Fe

Correct answer: (D)

Step-by-step solution →
Q144·ChemistrySingle correctJEE Main 2021
The Eu2+\mathrm{Eu^{2+}}Eu2+ ion is a strong reducing agent in spite of its ground state electronic configuration (outermost) : [Atomic number of Eu = 63]
  1. (A)4f76s24f^{7}6s^{2}4f76s2
  2. (B)4f64f^{6}4f6
  3. (C)4f74f^{7}4f7
  4. (D)4f66s24f^{6}6s^{2}4f66s2

Correct answer: (C)

Step-by-step solution →
Q145·ChemistrySingle correctJEE Main 2021
Which one of the following lanthanides exhibits +2 oxidation state with diamagnetic nature ? (Given Z for Nd = 60, Yb = 70, La = 57, Ce = 58)
  1. (A)Nd
  2. (B)Yb
  3. (C)La
  4. (D)Ce

Correct answer: (B)

Step-by-step solution →
Q146·ChemistrySingle correctJEE Main 2021
In the structure of the dichromate ion, there is a :
  1. (A)linear symmetrical Cr–O–Cr bond.
  2. (B)non-linear symmetrical Cr–O–Cr bond.
  3. (C)linear unsymmetrical Cr–O–Cr bond.
  4. (D)non-linear unsymmetrical Cr–O–Cr bond.

Correct answer: (B)

Step-by-step solution →
Q147·ChemistrySingle correctJEE Main 2021
Potassium permanganate on heating at 513 K gives a product which is :
  1. (A)paramagnetic and colourless
  2. (B)diamagnetic and green
  3. (C)diamagnetic and colourless
  4. (D)paramagnetic and green

Correct answer: (D)

Step-by-step solution →
Q148·ChemistrySingle correctJEE Main 2021
The addition of dilute NaOH to Cr3+^{3+}3+ salt solution will give :
  1. (A)a solution of [Cr(OH)4_{4}4​]−^{-}−
  2. (B)precipitate of Cr2_{2}2​O3_{3}3​(H2_{2}2​O)n_{n}n​
  3. (C)precipitate of [Cr(OH)6_{6}6​]3−^{3-}3−
  4. (D)precipitate of Cr(OH)3_{3}3​

Correct answer: (B)

Step-by-step solution →
Q149·ChemistrySingle correctJEE Main 2021
The nature of oxides V2O3\mathrm{V_2O_3}V2​O3​ and CrO is indexed as 'X' and 'Y' type respectively. The correct set of X and Y is:
  1. (A)X = basic Y = amphoteric
  2. (B)X = amphoteric Y = basic
  3. (C)X = acidic Y = acidic
  4. (D)X = basic Y = basic

Correct answer: (D)

Step-by-step solution →
Q150·ChemistryNumericalJEE Main 2021
The number of fff electrons in the ground state electronic configuration of Np (Z = 93) is ________ . (Nearest integer)

Correct answer: 4

Step-by-step solution →
Q151·ChemistrySingle correctJEE Main 2021
Which one of the following when dissolved in water gives coloured solution in nitrogen atmosphere?
  1. (A)CuCl2\mathrm{CuCl_2}CuCl2​
  2. (B)AgCl\mathrm{AgCl}AgCl
  3. (C)ZnCl2\mathrm{ZnCl_2}ZnCl2​
  4. (D)Cu2Cl2\mathrm{Cu_2Cl_2}Cu2​Cl2​

Correct answer: (A)

Step-by-step solution →
Q152·ChemistryNumericalJEE Main 2021
The number of 4f4f4f electrons in the ground state electronic configuration of Gd2+Gd^{2+}Gd2+ is _________. [Atomic number of Gd = 64]

Correct answer: 7

Step-by-step solution →
Q153·ChemistrySingle correctJEE Main 2021
The spin only magnetic moments (in BM) for free Ti3+,V2+Ti^{3+}, V^{2+}Ti3+,V2+ and Sc3+Sc^{3+}Sc3+ ions respectively are (At. No. Sc: 21; Ti:22; V:23)
  1. (A)1.73,0,3.87
  2. (B)0,3.87,1.73
  3. (C)3.87,1.73,0
  4. (D)1.73, 3.87,0

Correct answer: (D)

Step-by-step solution →
Q154·ChemistryNumericalJEE Main 2021
Number of electrons present in 4f orbital of Ho3+^{3+}3+ ion is____________________. (Given atomic number of Ho = 67)

Correct answer: 10

Step-by-step solution →
Q155·ChemistrySingle correctJEE Main 2021
The set having ions which are coloured and paramagnetic both is :
  1. (A)Ni2+,Mn7+,Hg2+Ni^{2+},Mn^{7+},Hg^{2+}Ni2+,Mn7+,Hg2+
  2. (B)Cu+,Zn2+,Mn4+Cu^{+},Zn^{2+},Mn^{4+}Cu+,Zn2+,Mn4+
  3. (C)Sc3+,V5+,Ti4Sc^{3+},V^{5+},Ti^{4}Sc3+,V5+,Ti4
  4. (D)Cu2+,Cr3+,Sc+Cu^{2+},Cr^{3+},Sc^{+}Cu2+,Cr3+,Sc+

Correct answer: (D)

Step-by-step solution →
Q156·ChemistrySingle correctJEE Main 2021
Which one of the following species doesn't have a magnetic moment of 1.73 BM, (spin only value)?
  1. (A)CuI\mathrm{CuI}CuI
  2. (B)[Cu(NH3)4]Cl2\mathrm{[Cu(NH_3)_4]Cl_2}[Cu(NH3​)4​]Cl2​
  3. (C)O2−\mathrm{O_2^-}O2−​
  4. (D)O2+\mathrm{O_2^+}O2+​

Correct answer: (A)

Step-by-step solution →
Q157·ChemistrySingle correctJEE Main 2021
The oxide that shows magnetic property is :
  1. (A)SiO2_{2}2​
  2. (B)Mn3_{3}3​O4_{4}4​
  3. (C)Na2_{2}2​O
  4. (D)MgO

Correct answer: (B)

Step-by-step solution →
Q158·ChemistrySingle correctJEE Main 2021
Given below are two statements: Statement I : Potassium permanganate on heating at 573 K forms potassium manganate. Statement II : Both potassium permanganate and potassium manganate are tetrahedral and paramagnetic in nature. In the light of the above statements, choose the most appropriate answer from the options given below:
  1. (A)Statement I is true but statement II is false
  2. (B)Both statement I and statement II are true
  3. (C)Statement I is false but statement II is true
  4. (D)Both statement I and statement II are false

Correct answer: (A)

Step-by-step solution →
Q159·ChemistryNumericalJEE Main 2021
In the ground state of atomic Fe(Z = 26), the spin-only magnetic moment is ______ ×\times× 10−1^{-1}−1 BM. (Round off to the Nearest Integer). [Given : 3\sqrt{3}3​ = 1.73, 2\sqrt{2}2​ = 1.41]

Correct answer: 49

Step-by-step solution →
Q160·ChemistrySingle correctJEE Main 2021
The common positive oxidation states for an element with atomic number 24, are :
  1. (A)+2 to +6
  2. (B)+1 and +3 to +6
  3. (C)+1 and +3
  4. (D)+1 to +6

Correct answer: (A)

Step-by-step solution →
Q161·ChemistrySingle correctJEE Main 2021
What is the spin-only magnetic moment value (BM) of a divalent metal ion with atomic number 25, in it's aqueous solution?
  1. (A)5.92
  2. (B)5.0
  3. (C)zero
  4. (D)5.26

Correct answer: (A)

Step-by-step solution →
Q162·ChemistrySingle correctJEE Main 2021
Arrange the following metal complex/compounds in the increasing order of spin only magnetic moment. Presume all the three, high spin system. (Atomic numbers Ce = 58, Gd = 64 and Eu = 63.) (a) (NH4_{4}4​)2_{2}2​[Ce(NO3_{3}3​)6_{6}6​] (b) Gd(NO3_{3}3​)3_{3}3​ and (c) Eu(NO3_{3}3​)3_{3}3​ Answer is :
  1. (A)(b) < (a) < (c)
  2. (B)(c) < (a) < (b)
  3. (C)(a) < (b) < (c)
  4. (D)(a) < (c) < (b)

Correct answer: (D)

Step-by-step solution →
Q163·ChemistrySingle correctJEE Main 2021
Fex2_{2}2​ and Fey3_{3}3​ are known when x and y are :
  1. (A)x = F, Cl, Br, I and y = F, Cl, Br
  2. (B)x = F, Cl, Br and y = F, Cl, Br, I
  3. (C)x = Cl, Br, I and y = F, Cl, Br, I
  4. (D)x = F, Cl, Br, I and y = F, Cl, Br, I

Correct answer: (A)

Step-by-step solution →
Q164·ChemistrySingle correctJEE Main 2021
Given below are two statement : one is labelled as Assertion A and the other is labelled as Reason R : Assertion A : Size of Bk3+^{3+}3+ ion is less than Np3+^{3+}3+ ion. Reason R : The above is a consequence of the lanthanoid contraction. In the light of the above statements, choose the correct answer from the options given below :
  1. (A)A is false but R is true
  2. (B)Both A and R are true but R is not the correct explanation of A
  3. (C)Both A and R are true and R is the correct explanation of A
  4. (D)A is true but R is false

Correct answer: (D)

Step-by-step solution →
Q165·ChemistrySingle correctJEE Main 2021
Given below are two statements : Statement I : The E° value of Ce4+^{4+}4+ / Ce3+^{3+}3+ is + 1.74 V. Statement II : Ce is more stable in Ce4+^{4+}4+ state than Ce3+^{3+}3+ state. In the light of the above statements, choose the most appropriate answer from the options given below :
  1. (A)Both statement I and statement II are correct
  2. (B)Statement I is incorrect but statement II is correct
  3. (C)Both statement I and statement II are incorrect
  4. (D)Statement I is correct but statement II is incorrect

Correct answer: (D)

Step-by-step solution →
Q166·ChemistryNumericalJEE Main 2021
Dichromate ion is treated with base, the oxidation number of Cr in the product formed is :

Correct answer: 6

Step-by-step solution →
Q167·ChemistrySingle correctJEE Main 2021
Which one of the following lanthanoids does not form MO2_22​ ? [M is lanthanoid metal]
  1. (A)Nd
  2. (B)Yb
  3. (C)Dy
  4. (D)Pr

Correct answer: (B)

Step-by-step solution →
Q168·ChemistrySingle correctJEE Main 2021
Given below are two statements: Statement-I : CeO2_{2}2​ can be used for oxidation of aldehydes and ketones. Statement-II : Aqueous solution of EuSO4_{4}4​ is a strong reducing agent.
  1. (A)Statement I is true, statement II is false
  2. (B)Statement I is false, statement II is true
  3. (C)Both Statement I and Statement II are false
  4. (D)Both Statement I and Statement II are true

Correct answer: (D)

Step-by-step solution →
Q169·ChemistrySingle correctJEE Main 2021
In which of the following pairs, the outer most electronic configuration will be the same?
  1. (A)Fe2+^{2+}2+ and Co+^{+}+
  2. (B)Cr+^{+}+ and Mn2+^{2+}2+
  3. (C)Ni2+^{2+}2+ and Cu+^{+}+
  4. (D)V2+^{2+}2+ and Cr+^{+}+

Correct answer: (B)

Step-by-step solution →
Q170·ChemistrySingle correctJEE Main 2021
The major components of German Silver are :
  1. (A)Cu, Zn and Ag
  2. (B)Ge, Cu and Ag
  3. (C)Zn, Ni and Ag
  4. (D)Cu, Zn and Ni

Correct answer: (D)

Step-by-step solution →
Q171·ChemistryNumericalJEE Main 2021
5 = [1+(2-1)3/4]×0.52 ×m (2) The spin only magnetic moment of a divalent ion in aqueous solution (atomic number 29) is ____BM.

Correct answer: 2

Step-by-step solution →
Q172·ChemistrySingle correctJEE Main 2021
The electrode potential of M2+/M\mathrm{M^{2+}/M}M2+/M of 3d− series elements shows positive value for:
  1. (A)Zn
  2. (B)Co
  3. (C)Fe
  4. (D)Cu

Correct answer: (D)

Step-by-step solution →
Q173·ChemistrySingle correctJEE Main 2021
What is the correct order of the following elements with respect to their density ?
  1. (A)Cr < Fe < Co < Cu < Zn
  2. (B)Cr < Zn < Co < Cu < Fe
  3. (C)Zn < Cu < Co < Fe < Cr
  4. (D)Zn < Cr < Fe < Co < Cu

Correct answer: (D)

Step-by-step solution →
Q174·ChemistrySingle correctJEE Main 2021
The incorrect statement among the following is :
  1. (A)VOSO4VOSO_{4}VOSO4​ is a reducing agent
  2. (B)Red colour of ruby is due to the presence of CO3+CO^{3+}CO3+
  3. (C)Cr2O3Cr_{2}O_{3}Cr2​O3​ is an amphoteric oxide
  4. (D)RuO4RuO_{4}RuO4​ is an oxidizing agent

Correct answer: (B)

Step-by-step solution →
Q175·ChemistryIntegerJEE Advanced 2020
An acidified solution of potassium chromate was layered with an equal volume of amyl alcohol. When it was shaken after the addition of 1 mL of 3% H2O2H_{2}O_{2}H2​O2​, a blue alcohol layer was obtained. The blue color is due to the formation of a chromium (VI) compound 'X'. What is the number of oxygen atoms bonded to chromium through only single bonds in a molecule of X?

Correct answer: 4

Step-by-step solution →
Q176·ChemistrySingle correctJEE Main 2020
The lanthanoid that does NOT show +4 oxidation state is:
  1. (A)Dy
  2. (B)Ce
  3. (C)Eu
  4. (D)Tb

Correct answer: (C)

Step-by-step solution →
Q177·ChemistrySingle correctJEE Main 2020
The INCORRECT statement is:
  1. (A)bronze is an alloy of copper and tin
  2. (B)cast iron is used to manufacture wrought iron
  3. (C)german silver is an alloy of zinc, copper and nickel
  4. (D)brass is an alloy of copper and nickel.

Correct answer: (D)

Step-by-step solution →
Q178·ChemistrySingle correctJEE Main 2020
The set that contains atomic numbers of only transition elements, is
  1. (A)37, 42, 50, 64
  2. (B)21, 25, 42, 72
  3. (C)9, 17, 34, 38
  4. (D)21, 32, 53, 64

Correct answer: (B)

Step-by-step solution →
Q179·ChemistrySingle correctJEE Main 2020
Mischmetal is an alloy consisting mainly of:
  1. (A)lanthanoid metals
  2. (B)actinoid and transition metals
  3. (C)lanthanoid and actinoid metals
  4. (D)actionoid metals

Correct answer: (A)

Step-by-step solution →
Q180·ChemistrySingle correctJEE Main 2020
The correct electronic configuration and spin – only magnetic moment (BM) of Gd3+Gd^{3+}Gd3+ (Z = 64), respectively, are:
  1. (A)[Xe]4f74f^74f7 and 7.9
  2. (B)[Xe]4f74f^74f7 and 8.9
  3. (C)[Xe]5f75f^75f7 and 8.9
  4. (D)[Xe]5f75f^75f7 and 7.9

Correct answer: (A)

Step-by-step solution →
Q181·ChemistrySingle correctJEE Main 2020
The incorrect statement(s) among (a) - (c) is (are): (a) W(VI) is more stable than Cr(VI). (b) in the presence of HCl, permanganate titrations provide satisfactory results. (c) some lanthanoid oxides can be used as phosphors.
  1. (A)(b) and (c) only
  2. (B)(a) only
  3. (C)(b) only
  4. (D)(a) and (b) only

Correct answer: (C)

Step-by-step solution →
Q182·ChemistrySingle correctJEE Main 2020
The incorrect statement is
  1. (A)In manganate and permanganateions, the π - bounding takes place by overlap of p –orbitals of oxygen and d – orbitals of manganese
  2. (B)Manganate ion is green in colour and permanganateion is purple in colour
  3. (C)Manganate and permanganate ions are paramagnetic
  4. (D)Manganate and permanganate ions are tetrahedral

Correct answer: (C)

Step-by-step solution →
Q183·ChemistrySingle correctJEE Main 2020
The electronic configurations of bivalent europium and trivalent cerium are: (atomic number: Xe = 54, Ce = 58, Eu = 63)
  1. (A)[Xe] 4f7^77 6s2^22 and [Xe] 4f2^226s2^22
  2. (B)[Xe] 4f7^77 and [Xe] 4f1^11
  3. (C)[Xe] 4f2^22 and [Xe] 4f7^77
  4. (D)[Xe] 4f4^44 and [Xe] 4f9^99

Correct answer: (B)

Step-by-step solution →
Q184·ChemistryNumericalJEE Main 2020
The sum of the total number of bonds between chromium and oxygen atoms in chromate and dichromate ions is ________________

Correct answer: 12

Step-by-step solution →
Q185·ChemistrySingle correctJEE Main 2020
The third ionization enthalpy is minimum for :
  1. (A)Ni
  2. (B)Co
  3. (C)Mn
  4. (D)Fe

Correct answer: (D)

Step-by-step solution →
Q186·ChemistryNumericalJEE Main 2020
Consider the following reactions: NaCl+K2Cr2O7+H2SO4(Conc.)⟶(A)+side products\mathrm{NaCl + K_2Cr_2O_7 + H_2SO_4(Conc.) \longrightarrow (A) + side\ products}NaCl+K2​Cr2​O7​+H2​SO4​(Conc.)⟶(A)+side products (A)+NaOH⟶(B)+Side products\mathrm{(A) + NaOH \longrightarrow (B) + Side\ products}(A)+NaOH⟶(B)+Side products (B)+H2SO4+H2O2(dilute)⟶(C)+Side products\mathrm{(B) + H_2SO_4 + H_2O_2(dilute) \longrightarrow (C) + Side\ products}(B)+H2​SO4​+H2​O2​(dilute)⟶(C)+Side products The sum of the total number of atoms in one molecule each of (A), (B) and (C) is __________

Correct answer: 18

Step-by-step solution →
Q187·ChemistryMultiple correctJEE Advanced 2019
Consider the following reactions (unbalanced) Zn + hot conc. H2_{2}2​SO4_{4}4​ ⟶\longrightarrow⟶ G + R + X Zn + conc.NaOH ⟶\longrightarrow⟶ T + Q G + H2_{2}2​S + NH4_{4}4​OH ⟶\longrightarrow⟶ Z(a precipitate) + X + Y Choose the correct option(s)
  1. (A)The oxidation state of Zn in T is +1
  2. (B)R is a V-shaped molecule
  3. (C)Z is dirty white in colour
  4. (D)Bond order of Q is 1 in its ground state

Correct answer: (B), (C), (D)

Step-by-step solution →
Q188·ChemistryMultiple correctJEE Advanced 2019
Fusion of MnO2_{2}2​ with KOH in presence of O2_{2}2​ produces a salt W. Alkaline solution of W upon electrolytic oxidation yields another salt X. The manganese containing ions present in W and X, respectively, are Y and Z. Correct statement(s) is(are)
  1. (A)In aqueous acidic solution, Y undergoes disproportionation reaction to give Z and MnO2_{2}2​
  2. (B)In both Y and Z, π\piπ-bonding occurs between p-orbitals of oxygen and d-orbitals of manganese
  3. (C)Y is diamagnetic in nature while Z is paramagnetic
  4. (D)Both Y and Z are coloured and have tetrahedral shape

Correct answer: (A), (B), (D)

Step-by-step solution →
Q189·ChemistrySingle correctJEE Main 2019
The pair that has similar atomic radii is:
  1. (A)Ti and Hf
  2. (B)Mn and Re
  3. (C)Sc and Ni
  4. (D)Mo and W

Correct answer: (D)

Step-by-step solution →
Q190·ChemistrySingle correctJEE Main 2019
Thermal decomposition of a Mn compound (X) at 513 K results in compound Y, MnO2_22​ and a gaseous product. MnO2_22​ reacts with NaCl and concentrated H2_22​SO4_44​ to give a pungent gas Z. X, Y and Z, respectively.
  1. (A)K2_22​MnO4_44​, KMnO4_44​ and SO2_22​
  2. (B)K3_33​MnO4_44​, K2_22​MnO4_44​ and Cl2_22​
  3. (C)K2_22​MnO4_44​, KMnO4_44​ and Cl2_22​
  4. (D)KMnO4_44​, K2_22​MnO4_44​ and Cl2_22​

Correct answer: (D)

Step-by-step solution →
Q191·ChemistrySingle correctJEE Main 2019
The highest possible oxidation states of uranium and plutonium, respectively, are
  1. (A)6 and 4
  2. (B)7 and 6
  3. (C)4 and 6
  4. (D)6 and 7

Correct answer: (D)

Step-by-step solution →
Q192·ChemistrySingle correctJEE Main 2019
The correct order of the first ionization enthalpies is
  1. (A)Mn < Ti < Zn < Ni
  2. (B)Zn < Ni < Mn < Ti
  3. (C)Ti < Mn < Zn < Ni
  4. (D)Ti < Mn < Ni < Zn

Correct answer: (D)

Step-by-step solution →
Q193·ChemistrySingle correctJEE Main 2019
Consider the hydrated ions of Ti2+^{2+}2+, V2+^{2+}2+, Ti3+^{3+}3+ and Sc3+^{3+}3+. The correct order of their spin-only magnetic moments is:
  1. (A)Ti3+^{3+}3+ < T2+^{2+}2+ < Sc3+^{3+}3+ < V2+^{2+}2+
  2. (B)Sc3+^{3+}3+ < Ti3+^{3+}3+ < Ti2^{2}2 < V2+^{2+}2+
  3. (C)V2+^{2+}2+ < Ti2+^{2+}2+ < Ti3+^{3+}3+ < Sc3+^{3+}3+
  4. (D)Sc3+^{3+}3+ < Ti3+^{3+}3+ < V2+^{2+}2+ < Ti2+^{2+}2+

Correct answer: (B)

Step-by-step solution →
Q194·ChemistrySingle correctJEE Main 2019
The maximum number of possible oxidation states of actinoids are shown by
  1. (A)berkelium (Bk) and californium (Cf)
  2. (B)nobelium (No) and lawrencium (Lr)
  3. (C)actinium (Ac) and thorium (Th)
  4. (D)neptunium (Np) and plutonium (Pu)

Correct answer: (D)

Step-by-step solution →
Q195·ChemistrySingle correctJEE Main 2019
The lanthanoide that would show colour is:
  1. (A)Gd3+Gd^{3+}Gd3+
  2. (B)La3+La^{3+}La3+
  3. (C)Lu3+Lu^{3+}Lu3+
  4. (D)Sm3+Sm^{3+}Sm3+

Correct answer: (D)

Step-by-step solution →
Q196·ChemistrySingle correctJEE Main 2019
The statement that is INCORRECT about the interstitial compound is:
  1. (A)they have metallic conductivity
  2. (B)they have high melting points
  3. (C)they are chemically reactive
  4. (D)they are very hard

Correct answer: (C)

Step-by-step solution →
Q197·ChemistrySingle correctJEE Main 2019
The correct order of atomic radii is :
  1. (A)Nd > Ce > Eu > Ho
  2. (B)Ho > Nd > Eu > Ce
  3. (C)Ce > Eu > Ho > Nd
  4. (D)Eu > Ce > Nd > Ho

Correct answer: (D)

Step-by-step solution →
Q198·ChemistrySingle correctJEE Main 2019
The element the usually does NOT show variable oxidation states is:
  1. (A)Cu
  2. (B)Ti
  3. (C)Sc
  4. (D)V

Correct answer: (C)

Step-by-step solution →
Q199·ChemistrySingle correctJEE Main 2019
A‾\underline{A}A​ →4KOH,O2\xrightarrow{4KOH,O_2}4KOH,O2​​ 2B‾\underline{B}B​ + 2 H2_22​O (Green) 3B‾\underline{B}B​ →4HCl\xrightarrow{4HCl}4HCl​ 2C‾\underline{C}C​ + MnO2_22​ + 2H2_22​O (Purple) 2C‾\underline{C}C​ →H2O,KI\xrightarrow{H_2O,KI}H2​O,KI​ 2A‾\underline{A}A​ + 2KOH + D‾\underline{D}D​ In the above sequence of reactions, A‾\underline{A}A​ and D‾\underline{D}D​, respectively are:
  1. (A)Ki and KMnO4_44​
  2. (B)MnO2_22​ and KIO3_33​
  3. (C)KIO3_33​ and MnO2_22​
  4. (D)KI and K2_22​MnO4_44​

Correct answer: (B)

Step-by-step solution →
Q200·ChemistrySingle correctJEE Main 2019
The effect of lanthanoid contraction in the lanthanoid series of elements by the large means
  1. (A)increase in both atomic and ionic radii
  2. (B)decrease in atomic radii and increase in ionic radii
  3. (C)decrease in both atomic and ionic radii
  4. (D)increase in atomic radii and decrease in ionic radii

Correct answer: (C)

Step-by-step solution →
Q201·ChemistrySingle correctJEE Main 2019
The transition element that has lowest enthalpy of atomisation is
  1. (A)Fe
  2. (B)Cu
  3. (C)V
  4. (D)Zn

Correct answer: (D)

Step-by-step solution →
Q202·ChemistryMultiple correctJEE Advanced 2015
The correct statement(s) about Cr2+\mathrm{Cr^{2+}}Cr2+ and Mn3+\mathrm{Mn^{3+}}Mn3+ is(are) [Atomic numbers of Cr = 24 and Mn = 25]
  1. (A)Cr2+\mathrm{Cr^{2+}}Cr2+ is a reducing agent
  2. (B)Mn3+\mathrm{Mn^{3+}}Mn3+ is an oxidizing agent
  3. (C)Both Cr2+\mathrm{Cr^{2+}}Cr2+ and Mn3+\mathrm{Mn^{3+}}Mn3+ exhibit d4d^{4}d4 electronic configuration
  4. (D)When Cr2+\mathrm{Cr^{2+}}Cr2+ is used as a reducing agent, the chromium ion attains d5d^{5}d5 electronic configuration

Correct answer: (A), (B), (C)

Step-by-step solution →

d- and f-Block Elements — frequently asked

How many questions from d- and f-Block Elements appear in JEE?

d- and f-Block Elements has appeared in 126 of the last 186 JEE Main and JEE Advanced papers — about 68% of them — contributing 202 questions in total across those papers.

Is d- and f-Block Elements an important chapter for JEE?

Judged by how often it is actually tested, it appears in roughly 68% of papers. Chapters above about 50% are effectively guaranteed to show up every session, so they repay thorough preparation; lower-frequency chapters are better treated as targeted revision.

Where do these d- and f-Block Elements questions come from?

Every question is from an official JEE Main or JEE Advanced paper, transcribed from the original paper and tagged to this chapter. Answers follow the official answer key.

Other Chemistry chapters

  • Coordination Compounds 318
  • p-Block Elements 276
  • Redox Reactions and Electrochemistry 265
  • Chemical Bonding and Molecular Structure 207
  • Aldehydes and Ketones 199
  • Equilibrium 199
  • Solutions 198
  • Chemical Thermodynamics 195

All 36 Chemistry chapters →

Practise d- and f-Block Elements until it stops costing you marks.

Build a timed test from these 202 questions in one click. Jarvis marks it, names the specific misconception behind each wrong answer, and brings the ones you failed back at the right interval.

Practise d- and f-Block Elements freeSee pricing

Free plan, no time limit · No credit card needed

Jarvis OS

AI-powered JEE preparation.

Question papers

JEE Main PYQsJEE Advanced PYQsPhysics PYQsChemistry PYQsMaths PYQs

Product

TourPricingSign inCreate account

Legal

Privacy PolicyTerms of ServiceRefund & CancellationShipping & DeliveryContact Us

Operated by

Venyou Craft Private Limited

info@jarvisos.net

© 2026 Jarvis OS