Jarvis OS
PYQ papersPricingSign inGet started
  1. Home
  2. /JEE Chemistry PYQs
  3. /Amines

Amines — JEE Previous Year Questions

Every Amines question asked in JEE Main and JEE Advanced across the last 186 papers — 173 questions, each with its correct answer. Free to read, no account needed.

Questions

173

Papers it appeared in

133/186

Appearance rate

72%

All 173 Amines questions

Most recent papers first.

Q1·ChemistrySingle correctJEE Advanced 2026
Match the major products obtained in the reactions given in List-I with the corresponding structures in List-II and choose the correct option.
  1. (A)P → 2; Q → 1; R → 5; S → 4
  2. (B)P → 1; Q → 2; R → 4; S → 5
  3. (C)P → 1; Q → 2; R → 3; S → 4
  4. (D)P → 2; Q → 1; R → 3; S → 5

Correct answer: (B)

Step-by-step solution →
Q2·ChemistrySingle correctJEE Main 2026
Which statements are True? A. In Hoffmann bromamide degradation, 4 moles of NaOH and 2 moles of Br2Br_2Br2​ are consumed per mole of an amide B. Hoffmann bromamide reaction is not given by alkyl amides. C. Primary amines can be synthesized by Hoffmann bromamide degradation. D. Secondary amide on reaction with Br2Br_2Br2​ and NaOH will give secondary amine. E. The by-products of Hoffmann degradation are Na2CO3Na_2CO_3Na2​CO3​, NaBr and H2OH_2OH2​O. Choose the correct answer from the options given below:
  1. (A)A, C and E only
  2. (B)B, C and D only
  3. (C)C and E only
  4. (D)C, D and E only

Correct answer: (C)

Step-by-step solution →
Q3·ChemistrySingle correctJEE Main 2026
Arrange the following compounds according to increasing order of boiling points. n-C₄H₉OH (A), n-C₄H₉NH₂ (B), n-C₄H₁₀ (C) and C₂H₅NHC₂H₅ (D).
  1. (A)C<B<A<DC < B < A < DC<B<A<D
  2. (B)D<C<B<AD < C < B < AD<C<B<A
  3. (C)C<D<B<AC < D < B < AC<D<B<A
  4. (D)D<B<A<CD < B < A < CD<B<A<C

Correct answer: (C)

Step-by-step solution →
Q4·ChemistrySingle correctJEE Main 2026
The number of compounds from the following which can undergo reaction with Br2\mathrm{Br_{2}}Br2​/KOH (alcoholic) to give respective products and these respective products can also be obtained separately by Gabriel phthalimide reaction is :
  1. (A)5
  2. (B)4
  3. (C)3
  4. (D)6

Correct answer: (C)

Step-by-step solution →
Q5·ChemistrySingle correctJEE Main 2026
Consider the following organic reaction sequence. Choose the final product (X)(X)(X) from the following (consider the major product in all intermediate reactions)
  1. (A)Benzene
  2. (B)Phenol
  3. (C)Propanol
  4. (D)Chlorobenzene

Correct answer: (A)

Step-by-step solution →
Q6·ChemistrySingle correctJEE Main 2026
Identify the incorrect statements. Choose the correct answer from the options given below:
  1. (A)A and D Only
  2. (B)A and C Only
  3. (C)B and C Only
  4. (D)A and B Only

Correct answer: (C)

Step-by-step solution →
Q7·ChemistrySingle correctJEE Main 2026
Given below are two statements : Statement I: Heating benzamide with bromine in an ethanolic solution of sodium hydroxide will give benzylamine. Statement II: Nitration of aniline with HNO₃/H₂SO₄ at 288 K produces m-nitroaniline in higher amount than o-nitroaniline (pH adjusted). In the light of the above statements, choose the correct answer from the options given below :
  1. (A)Both Statement I and Statement II are true
  2. (B)Both Statement I and Statement II are false
  3. (C)Statement I is true but Statement II is false
  4. (D)Statement I is false but Statement II is true

Correct answer: (D)

Step-by-step solution →
Q8·ChemistrySingle correctJEE Main 2026
Benzyl isocyanide can be obtained from Choose the correct answer from the options given below:
  1. (A)A and B Only
  2. (B)A and C Only
  3. (C)B and D Only
  4. (D)D and E Only

Correct answer: (A)

Step-by-step solution →
Q9·ChemistrySingle correctJEE Main 2026
The strongest conjugate acid will result from:
  1. (A)aniline
  2. (B)4-methoxyaniline
  3. (C)4-nitroaniline
  4. (D)4-methylaniline (p-toluidine)

Correct answer: (C)

Step-by-step solution →
Q10·ChemistrySingle correctJEE Main 2026
Consider the three aromatic molecules (P, Q and R) whose structures have been given below : The correct order regarding the reactivity of these compounds with Ph−N≡NCl(+)(−)Ph-N\equiv NCl^{(-)}_{(+)}Ph−N≡NCl(+)(−)​ under optimum but slightly acidic medium is :
  1. (A)P>Q>RP>Q>RP>Q>R
  2. (B)R>P>QR>P>QR>P>Q
  3. (C)R>Q>PR>Q>PR>Q>P
  4. (D)P>R>QP>R>QP>R>Q

Correct answer: (A)

Step-by-step solution →
Q11·ChemistrySingle correctJEE Main 2026
Consider the following reactions giving major product. Identify the correct reaction.
  1. (A)(1)
  2. (B)(2)
  3. (C)(3)
  4. (D)(4)

Correct answer: (D)

Step-by-step solution →
Q12·ChemistrySingle correctJEE Main 2026
A student performed analysis of aliphatic organic compound 'X' which on analysis gave C = 61.01%, H=15.25%, N=23.74%. This compound, on treatment with HNO2/H2OHNO_2/H_2OHNO2​/H2​O produced another compound 'Y' which did not contain any nitrogen atom. However, the compound 'Y' upon controlled oxidation produced another compound 'Z' that responded to iodoform test. The structure of 'X' is:
  1. (A)(1)
  2. (B)(2)
  3. (C)(3)
  4. (D)(4)

Correct answer: (C)

Step-by-step solution →
Q13·ChemistrySingle correctJEE Main 2026
Total number of alkali insoluble solid sulphonamides obtained by reaction of given amines with Hinsberg's reagent is ……….. . Aniline, N-Methylaniline, Methanamine, N, N-Dimethylmethanamine, N-Methyl methanamine, Phenylmethanamine, N-propylaniline, N-phenylaniline, N, N-Dimethylaniline, Allyl amine, Isopropyl amine
  1. (A)4
  2. (B)2
  3. (C)8
  4. (D)5

Correct answer: (A)

Step-by-step solution →
Q14·ChemistrySingle correctJEE Main 2026
A student has planned to prepare acetanilide from aniline using acetic anhydride. The student has started from 9.3g of aniline. However, the student has managed to obtain 11 g of dry acetanilide. The % yield of this reaction is :-
  1. (A)81.5%
  2. (B)97.5%
  3. (C)59.5%
  4. (D)72.5%

Correct answer: (A)

Step-by-step solution →
Q15·ChemistrySingle correctJEE Main 2026
Given below are two statements : Statement I : The dipole moment of R-CN is greater than R-NC and R-NC can undergo hydrolysis under acidic medium to produce R−C∥O−OH\text{R}-\overset{\text{O}}{\overset{\|}{\text{C}}}-\text{OH}R−C∥O−OH . Statement II : R-CN hydrolyses under acidic medium to produce a compound which on treatment with SOCl2\text{SOCl}_{2}SOCl2​, followed by the addition of NH3\text{NH}_{3}NH3​ gives another compound(x). This compound (x) on treatment with NaOCl/NaOH\text{NaOCl}/\text{NaOH}NaOCl/NaOH gives a product, that on treatment with CHCl3/KOH/Δ\text{CHCl}_{3}/\text{KOH}/\DeltaCHCl3​/KOH/Δ produces R-NC In the light of the above statements, choose the correct answer from the options given below :
  1. (A)Both Statement I and Statement II are false
  2. (B)Both Statement I and Statement II are true
  3. (C)Statement I is true but Statement II is false
  4. (D)Statement I is false but Statement II is true

Correct answer: (D)

Step-by-step solution →
Q16·ChemistrySingle correctJEE Main 2026
Compound 'P' undergoes the following sequence of reactions : 'P' is :
  1. (A)(1)
  2. (B)(2)
  3. (C)(3)
  4. (D)(4)

Correct answer: (B)

Step-by-step solution →
Q17·ChemistrySingle correctJEE Main 2026
Consider the following sequence of reactions. 4-Nitrotoluene Assuming that the reaction proceeds to completion, then 137 mg of 4-nitrotoluene will produce ______mg of B. (Given molar mass in g mol−1^{-1}−1 H : 1, C : 12, N :14, O :16, Br : 80)
  1. (A)301
  2. (B)146
  3. (C)228
  4. (D)208

Correct answer: (C)

Step-by-step solution →
Q18·ChemistrySingle correctJEE Main 2026
A student has been given a compound “x” of molecular formula – C6_{6}6​H7_{7}7​N. ‘x’ is sparingly soluble in water. However, on addition of dilute mineral acid , ‘x’ becomes soluble in water. ‘x’ when treated with CHCl3_{3}3​ and KOH (alc.) ‘y’ is produced. ‘y’ has a specific unpleasant smell. On treatment with benzenesulphonyl chloride, ‘x’ gives a compound ‘z’ which is soluble in alkali. The number of different “H” atoms present in ‘z’ is:-
  1. (A)5
  2. (B)8
  3. (C)4
  4. (D)7

Correct answer: (D)

Step-by-step solution →
Q19·ChemistrySingle correctJEE Main 2026
Given below are two statements: In the light of the above statements, choose the correct answer from the options given below
  1. (A)Both Statement I and Statement II are false
  2. (B)Statement I is true but Statement II is false
  3. (C)Both Statement I and Statement II are true
  4. (D)Statement I is false but Statement II is true

Correct answer: (C)

Step-by-step solution →
Q20·ChemistrySingle correctJEE Main 2026
The final product [B] is :
  1. (A)(1)
  2. (B)(2)
  3. (C)(3)
  4. (D)(4)

Correct answer: (C)

Step-by-step solution →
Q21·ChemistryNumericalJEE Main 2026
The mass of benzanilide obtained from the benzoylation reaction of 5.8 g of aniline, if yield of product is 82%, is__________g (nearest integer). (Given molar mass in g mol−1mol^{-1}mol−1 H:1, C:12, N:14, O:16)

Correct answer: 10

Step-by-step solution →
Q22·ChemistrySingle correctJEE Main 2026
A hydrocarbon 'P' (C4H8C_4H_8C4​H8​) on reaction with HCl gives an optically active compound 'Q' (C4H9ClC_4H_9ClC4​H9​Cl) which on reaction with one mole of ammonia gives compound 'R' (C4H11NC_4H_{11}NC4​H11​N). 'R' on diazotization followed by hydrolysis gives 'S'. Identify P, Q, R and S.
  1. (A)(1)
  2. (B)(2)
  3. (C)(3)
  4. (D)(4)

Correct answer: (C)

Step-by-step solution →
Q23·ChemistryNumericalJEE Main 2026
Consider the following reaction sequence The percentage of nitrogen in product ‘T’ formed is ________%. (Nearest integer) (Given molar mass in g mol−1^{-1}−1 H:1, C:12, N:14, O:16)

Correct answer: 20

Step-by-step solution →
Q24·ChemistryMultiple correctJEE Advanced 2025
For the reaction sequence given below, the correct statement(s) is(are)
  1. (A)Both X and Y are oxygen containing compounds.
  2. (B)Y on heating with CHCl3_{3}3​/KOH forms isocyanide.
  3. (C)Z reacts with Hinsberg's reagent.
  4. (D)Z is an aromatic primary amine.

Correct answer: (A), (C)

Step-by-step solution →
Q25·ChemistrySingle correctJEE Advanced 2025
The major products obtained from the reactions in List-II are the reactants for the named reactions mentioned in List-I. Match each entry in List-I with the appropriate entry in List-II and choose the correct option.
List-IList-II
P.Stephen reaction1.see figure
Q.Sandmeyer reaction2.see figure
R.Hoffmann bromamide degradation reaction3.see figure
S.Cannizzaro reaction4.see figure
5.see figure
  1. (A)P → 2; Q → 4; R → 1: S → 3
  2. (B)P → 2; Q → 3; R → 4: S → 1
  3. (C)P → 5; Q → 3; R → 4: S → 2
  4. (D)P → 5; Q → 4; R → 2: S → 1

Correct answer: (B)

Step-by-step solution →
Q26·ChemistrySingle correctJEE Main 2025
Which of the following amine(s) show(s) positive carbylamines test? (A) C6H5NH2C_6H_5NH_2C6​H5​NH2​ (aniline) (B) (CH3)2NH(CH_3)_2NH(CH3​)2​NH (C) CH3NH2CH_3NH_2CH3​NH2​ (D) (CH3)3N(CH_3)_3N(CH3​)3​N (E) C6H5NHCH3C_6H_5NHCH_3C6​H5​NHCH3​ (N-methylaniline). Choose the correct answer from the options given below:
  1. (A)A and E Only
  2. (B)C Only
  3. (C)A and C Only
  4. (D)B, C and D Only

Correct answer: (C)

Step-by-step solution →
Q27·ChemistrySingle correctJEE Main 2025
The descending order of basicity of the following amines is:
  1. (A)B > E > D > A > C
  2. (B)E > D > B > A > C
  3. (C)E > D > A > B > C
  4. (D)E > A > D > C > B

Correct answer: (B)

Step-by-step solution →
Q28·ChemistrySingle correctJEE Main 2025
The major product (A) formed when nitrobenzene is treated with the following reagents in sequence — (i) Sn, HCl; (ii) Ac2_22​O, Pyridine; (iii) Br2_22​, AcOH; (iv) NaOH(aq) — is:
  1. (A)(1)
  2. (B)(2)
  3. (C)(3)
  4. (D)(4)

Correct answer: (A)

Step-by-step solution →
Q29·ChemistrySingle correctJEE Main 2025
The correct order of basicity for the following molecules is:
  1. (A)P>Q>RP > Q > RP>Q>R
  2. (B)R>P>QR > P > QR>P>Q
  3. (C)Q>P>RQ > P > RQ>P>R
  4. (D)R>Q>PR > Q > PR>Q>P

Correct answer: (D)

Step-by-step solution →
Q30·ChemistrySingle correctJEE Main 2025
In the following reactions (shown in the figure), which one is NOT correct? Choose the correct option:
  1. (A)(1)
  2. (B)(2)
  3. (C)(3)
  4. (D)(4)

Correct answer: (A)

Step-by-step solution →
Q31·ChemistrySingle correctJEE Main 2025
The sequence from the following that would result in giving predominantly 3, 4, 5-Tribromoaniline is:
  1. (A)(1)
  2. (B)(2)
  3. (C)(3)
  4. (D)(4)

Correct answer: (C)

Step-by-step solution →
Q32·ChemistrySingle correctJEE Main 2025
The correct order of basic nature in aqueous solution for the bases NH3NH_3NH3​, H2N−NH2H_2N-NH_2H2​N−NH2​, CH3CH2NH2CH_3CH_2NH_2CH3​CH2​NH2​, (CH3CH2)2NH(CH_3CH_2)_2NH(CH3​CH2​)2​NH and (CH3CH2)3N(CH_3CH_2)_3N(CH3​CH2​)3​N is:
  1. (A)NH3<H2N−NH2<(CH3CH2)2NH<CH3CH2NH2<(CH3CH2)3NNH_3<H_2N-NH_2<(CH_3CH_2)_2NH<CH_3CH_2NH_2<(CH_3CH_2)_3NNH3​<H2​N−NH2​<(CH3​CH2​)2​NH<CH3​CH2​NH2​<(CH3​CH2​)3​N
  2. (B)NH3<H2N−NH2<CH3CH2NH2<(CH3CH2)3N<(CH3CH2)2NHNH_3<H_2N-NH_2<CH_3CH_2NH_2<(CH_3CH_2)_3N<(CH_3CH_2)_2NHNH3​<H2​N−NH2​<CH3​CH2​NH2​<(CH3​CH2​)3​N<(CH3​CH2​)2​NH
  3. (C)H2N−NH2<NH3<(CH3CH2)3N<CH3CH2NH2<(CH3CH2)2NHH_2N-NH_2<NH_3<(CH_3CH_2)_3N<CH_3CH_2NH_2<(CH_3CH_2)_2NHH2​N−NH2​<NH3​<(CH3​CH2​)3​N<CH3​CH2​NH2​<(CH3​CH2​)2​NH
  4. (D)H2N−NH2<NH3<CH3CH2NH2<(CH3CH2)3N<(CH3CH2)2NHH_2N-NH_2<NH_3<CH_3CH_2NH_2<(CH_3CH_2)_3N<(CH_3CH_2)_2NHH2​N−NH2​<NH3​<CH3​CH2​NH2​<(CH3​CH2​)3​N<(CH3​CH2​)2​NH

Correct answer: (D)

Step-by-step solution →
Q33·ChemistryIntegerJEE Main 2025
Given below are some nitrogen containing compounds (structures shown in the figure). Each of them is treated with HCl separately. 1.0 g of the most basic compound will consume ______ mg of HCl. (Given molar mass in g mol−1^{-1}−1: C:12, H:1, O:16, Cl:35.5)

Correct answer: 341

Step-by-step solution →
Q34·ChemistrySingle correctJEE Main 2025
The steam volatile compounds among the following are (structures (A), (B), (C), (D) shown in the figure). Choose the correct answer from the options given below:
  1. (A)(B) and (D) only
  2. (B)(A) and (C) only
  3. (C)(A) and (B) only
  4. (D)(A), (B) and (D) only

Correct answer: (C)

Step-by-step solution →
Q35·ChemistryIntegerJEE Main 2025
Consider the following sequence of reactions: Chlorobenzene →(i) Mg, dry ether (ii) CO2 (iii) H3O+\xrightarrow{\text{(i) Mg, dry ether (ii) CO}_2\text{ (iii) H}_3\text{O}^+}(i) Mg, dry ether (ii) CO2​ (iii) H3​O+​ A →Br2,NaOH\xrightarrow{\text{Br}_2,\text{NaOH}}Br2​,NaOH​ B. 11.25 mg of chlorobenzene produces x×10−1x\times10^{-1}x×10−1 mg of product B. (Consider the reactions result in complete conversion.) The value of x is ______. [Given molar mass of C, H, O, N and Cl as 12, 1, 16, 14 and 35.5 g mol−1^{-1}−1 respectively]

Correct answer: 93

Step-by-step solution →
Q36·ChemistrySingle correctJEE Main 2025
Identify correct statements: (A) Primary amines do not give diazonium salts when reacted with NaNO2_22​ in acidic condition. (B) Aliphatic and aromatic primary amines on heating with CHCl3_33​ and ethanolic KOH form carbylamines. (C) Secondary and tertiary amines also give carbylamine reaction. (D) Benzenesulfonyl chloride is known as Hinsberg's reagent. (E) Tertiary amines reacts with benzenesulfonyl chloride easily. Choose the correct answer from the options given below:
  1. (A)(B) and (D) only
  2. (B)(A) and (B) only
  3. (C)(D) and (E) only
  4. (D)(B) and (C) only

Correct answer: (A)

Step-by-step solution →
Q37·ChemistrySingle correctJEE Main 2025
For the reaction in which aniline is converted to o-bromoaniline (2-bromoaniline) as the major product, the correct order of set of reagents for the above conversion is :
  1. (A)Br2 ∣ FeBr3, H2O(Δ), NaOHBr_2\,|\,FeBr_3,\ H_2O(\Delta),\ NaOHBr2​∣FeBr3​, H2​O(Δ), NaOH
  2. (B)H2SO4, Ac2O, Br2, H2O(Δ), NaOHH_2SO_4,\ Ac_2O,\ Br_2,\ H_2O(\Delta),\ NaOHH2​SO4​, Ac2​O, Br2​, H2​O(Δ), NaOH
  3. (C)Ac2O, Br2, H2O(Δ), NaOHAc_2O,\ Br_2,\ H_2O(\Delta),\ NaOHAc2​O, Br2​, H2​O(Δ), NaOH
  4. (D)Ac2O, H2SO4, Br2, NaOHAc_2O,\ H_2SO_4,\ Br_2,\ NaOHAc2​O, H2​SO4​, Br2​, NaOH

Correct answer: (B)

Step-by-step solution →
Q38·ChemistrySingle correctJEE Main 2025
Which among the following react with Hinsberg's reagent? (A) C6H5−NH2C_6H_5{-}NH_2C6​H5​−NH2​ (2) C6H5−N(CH3)2C_6H_5{-}N(CH_3)_2C6​H5​−N(CH3​)2​ (C) CH3−NH2CH_3{-}NH_2CH3​−NH2​ (4) N(CH3)3N(CH_3)_3N(CH3​)3​ (E) C6H5−NH−C6H5C_6H_5{-}NH{-}C_6H_5C6​H5​−NH−C6​H5​. Choose the correct answer from the options given below :
  1. (A)B and D only
  2. (B)C and D only
  3. (C)A, B and E only
  4. (D)A, C and E only

Correct answer: (D)

Step-by-step solution →
Q39·ChemistrySingle correctJEE Main 2025
Match List-I (Compound) with List-II (Catalyst/Reagents). Choose the correct answer from the options given below:
List-I (Compound)List-II (Catalyst/Reagents)
A.see figureI.NaOH (aqueous)
B.see figureII.H2H_2H2​/Ni
C.see figureIII.LiAlH4LiAlH_4LiAlH4​, H2OH_2OH2​O
D.see figureIV.Sn, HCl
  1. (A)(A)-(III), (B)-(II), (C)-(IV), (D)-(I)
  2. (B)(A)-(II), (B)-(IV), (C)-(III), (D)-(I)
  3. (C)(A)-(II), (B)-(I), (C)-(III), (D)-(IV)
  4. (D)(A)-(III), (B)-(IV), (C)-(II), (D)-(I)

Correct answer: (D)

Step-by-step solution →
Q40·ChemistrySingle correctJEE Main 2024
Correct order of basic strength of Pyrrole, Pyridine and Piperidine is :
  1. (A)Piperidine > Pyridine > Pyrrole
  2. (B)Pyrrole > Pyridine > Piperidine
  3. (C)Pyridine > Piperidine > Pyrrole
  4. (D)Pyrrole > Piperidine > Pyridine

Correct answer: (A)

Step-by-step solution →
Q41·ChemistrySingle correctJEE Main 2024
Given below are two statements: Statement (I): All the following compounds react with p-toluenesulfonyl chloride. C6H5NH2\text{C}_6\text{H}_5\text{NH}_2C6​H5​NH2​, (C6H5)2NH(\text{C}_6\text{H}_5)_2\text{NH}(C6​H5​)2​NH, (C6H5)3N(\text{C}_6\text{H}_5)_3\text{N}(C6​H5​)3​N. Statement (II): Their products in the above reaction are soluble in aqueous NaOH. In the light of the above statements, choose the correct answer from the options given below.
  1. (A)Both Statement I and Statement II is false
  2. (B)Statement I is true but Statement II is false
  3. (C)Statement I is false but Statement II is true
  4. (D)Both Statement I and Statement II is true

Correct answer: (A)

Step-by-step solution →
Q42·ChemistryNumericalJEE Main 2024
Number of amine compounds from the following giving solids which are soluble in NaOH upon reaction with Hinsberg's reagent is ___ (structures shown)

Correct answer: 5

Step-by-step solution →
Q43·ChemistryNumericalJEE Main 2024
An amine (X) is prepared by ammonolysis of benzyl chloride. On adding p-toluenesulphonyl chloride to it the solution remains clear. Molar mass of the amine (X) formed is _______ g mol−1^{-1}−1. (Given molar mass in g mol−1^{-1}−1 C : 12, H : 1, O : 16, N : 14)

Correct answer: 287

Step-by-step solution →
Q44·ChemistryNumericalJEE Main 2024
From the following monohalobenzenes — fluorobenzene, chlorobenzene, bromobenzene, iodobenzene and astatobenzene — the number that can be prepared by Sandmeyer's reaction is ___.

Correct answer: 2

Step-by-step solution →
Q45·ChemistryNumericalJEE Main 2024
9.3 g of pure aniline is treated with bromine water at room temperature to give a white precipitate of the product 'P'. The mass of product 'P' obtained is 26.4 g. The percentage yield is ___ %.

Correct answer: 80

Step-by-step solution →
Q46·ChemistryNumericalJEE Main 2024
X g of ethanamine was subjected to reaction with NaNO2\text{NaNO}_2NaNO2​/HCl, followed by hydrolysis to liberate N2\text{N}_2N2​ and HCl. The HCl generated was completely neutralised by 0.2 moles of NaOH. X is __________ g.

Correct answer: 9

Step-by-step solution →
Q47·ChemistryNumericalJEE Main 2024
From 6.55 g of aniline, the maximum amount of acetanilide that can be prepared will be ______ ×10−1\times10^{-1}×10−1 g.

Correct answer: 95

Step-by-step solution →
Q48·ChemistryNumericalJEE Main 2024
XXX g of ethylamine is subjected to reaction with NaNO2/HClNaNO_2/HClNaNO2​/HCl followed by water; evolved dinitrogen gas which occupied 2.24 L2.24\,L2.24L volume at STP. XXX is ___ ×10−1\times10^{-1}×10−1 g.

Correct answer: 45

Step-by-step solution →
Q49·ChemistryNumericalJEE Main 2024
Phthalimide is made to undergo the following sequence of reactions: Phthalimide reacts with (i) KOH then (ii) Benzyl chloride to give product 'P'. Total number of π\piπ bonds present in product 'P' is/are ______.

Correct answer: 8

Step-by-step solution →
Q50·ChemistrySingle correctJEE Main 2024
Given below are two statements: Statement (I): The NH2NH_2NH2​ group in Aniline is ortho and para directing and a powerful activating group. Statement (II): Aniline does not undergo Friedel-Craft's reaction (alkylation and acylation). In the light of the above statements, choose the most appropriate answer from the options given below:
  1. (A)Both Statement I and Statement II are correct
  2. (B)Both Statement I and Statement II are incorrect
  3. (C)Statement I is incorrect but Statement II is correct
  4. (D)Statement I is correct but Statement II is incorrect

Correct answer: (A)

Step-by-step solution →
Q51·ChemistryNumericalJEE Main 2024
Number of compounds which give reaction with Hinsberg's reagent is __________.

Correct answer: 5

Step-by-step solution →
Q52·ChemistrySingle correctJEE Main 2024
Given below are two statements: Statement (I): Aminobenzene and aniline are same organic compounds. Statement (II): Aminobenzene and aniline are different organic compounds. In the light of the above statements, choose the most appropriate answer from the options given below:
  1. (A)Both Statement I and Statement II are correct
  2. (B)Statement I is correct but Statement II is incorrect
  3. (C)Statement I is incorrect but Statement II is correct
  4. (D)Both Statement I and Statement II are incorrect

Correct answer: (B)

Step-by-step solution →
Q53·ChemistrySingle correctJEE Main 2024
Identify A and B in the following reaction sequence (shown in the figure).
  1. (A)(1)
  2. (B)(2)
  3. (C)(3)
  4. (D)(4)

Correct answer: (A)

Step-by-step solution →
Q54·ChemistrySingle correctJEE Main 2024
Given below are two statements: Statement-I: Aniline reacts with conc. H2_22​SO4_44​ followed by heating at 453-473 K gives p-aminobenzene sulphonic acid, which gives blood red colour in the 'Lassaigne's test'. Statement-II: In Friedel-Crafts alkylation and acylation reactions, aniline forms salt with the AlCl3_33​ catalyst. Due to this, nitrogen of aniline acquires a positive charge and acts as deactivating group. In the light of the above statements, choose the correct answer from the options given below:
  1. (A)Statement I is false but statement II is true
  2. (B)Both statement I and statement II are false
  3. (C)Statement I is true but statement II is false
  4. (D)Both statement I and statement II are true

Correct answer: (D)

Step-by-step solution →
Q55·ChemistryNumericalJEE Main 2024
A compound (x) with molar mass 108 g mol−1^{-1}−1 undergoes acetylation to give product with molar mass 192 g mol−1^{-1}−1. The number of amino groups in the compound (x) is ______.

Correct answer: 2

Step-by-step solution →
Q56·ChemistrySingle correctJEE Main 2024
Following is a confirmatory test for aromatic primary amines. Identify reagent (A) and (B).
  1. (A)(1)
  2. (B)(2)
  3. (C)(3)
  4. (D)(4)

Correct answer: (D)

Step-by-step solution →
Q57·ChemistrySingle correctJEE Main 2024
The final product AAA, formed in the following multistep reaction sequence is:
  1. (A)(1)
  2. (B)(2)
  3. (C)(3)
  4. (D)(4)

Correct answer: (B)

Step-by-step solution →
Q58·ChemistrySingle correctJEE Main 2024
The products A and B formed in the following reaction scheme are respectively:
  1. (A)(1)
  2. (B)(2)
  3. (C)(3)
  4. (D)(4)

Correct answer: (C)

Step-by-step solution →
Q59·ChemistrySingle correctJEE Main 2024
The product A formed in the following reaction is:
  1. (A)(1)
  2. (B)(2)
  3. (C)(3)
  4. (D)(4)

Correct answer: (C)

Step-by-step solution →
Q60·ChemistrySingle correctJEE Main 2024
The arenium ion which is not involved in the bromination of Aniline is
  1. (A)(1)
  2. (B)(2)
  3. (C)(3)
  4. (D)(4)

Correct answer: (C)

Step-by-step solution →
Q61·ChemistrySingle correctJEE Main 2024
Which of the following reaction is correct?
  1. (A)(1)
  2. (B)(2)
  3. (C)(3)
  4. (D)(4)

Correct answer: (B)

Step-by-step solution →
Q62·ChemistrySingle correctJEE Main 2024
Identify B formed in the reaction. Cl–(CH2)4–Cl+excess NH3⟶A→NaOHB+H2O+NaClCl–(CH_2)_4–Cl + \text{excess } NH_3 \longrightarrow A \xrightarrow{NaOH} B + H_2O + NaClCl–(CH2​)4​–Cl+excess NH3​⟶ANaOH​B+H2​O+NaCl
  1. (A)(1)
  2. (B)(2)
  3. (C)(3)
  4. (D)(4)

Correct answer: (A)

Step-by-step solution →
Q63·ChemistrySingle correctJEE Main 2024
Which of the following is strongest Bronsted base?
  1. (A)(1)
  2. (B)(2)
  3. (C)(3)
  4. (D)(4)

Correct answer: (D)

Step-by-step solution →
Q64·ChemistryIntegerJEE Advanced 2023
The reaction of 4-methyloct-1-ene (P\mathbf{P}P, 2.52 g) with HBr in the presence of (C6H5CO)2O2(\mathrm{C_6H_5CO})_2\mathrm{O_2}(C6​H5​CO)2​O2​ gives two isomeric bromides in a 9 : 1 ratio, with a combined yield of 50%. Of these, the entire amount of the primary alkyl bromide was reacted with an appropriate amount of diethylamine followed by treatment with aq. K2CO3\mathrm{K_2CO_3}K2​CO3​ to give a non-ionic product S\mathbf{S}S in 100% yield. The mass (in mg) of S\mathbf{S}S obtained is ___. [Use molar mass (in g mol−1^{-1}−1): H = 1, C = 12, N = 14, Br = 80]

Correct answer: 1791

Step-by-step solution →
Q65·ChemistryNumericalJEE Advanced 2023
The total number of sp2sp^2sp2 hybridised carbon atoms in the major product P (a non-heterocyclic compound) of the following reaction is ___.

Correct answer: 28

Step-by-step solution →
Q66·ChemistrySingle correctJEE Main 2023
In the reaction given below, ′A′'A'′A′ is:
  1. (A)(1)
  2. (B)(2)
  3. (C)(3)
  4. (D)(4)

Correct answer: (A)

Step-by-step solution →
Q67·ChemistrySingle correctJEE Main 2023
In the reaction given below, ′B′'B'′B′ is:
  1. (A)(1)
  2. (B)(2)
  3. (C)(3)
  4. (D)(4)

Correct answer: (C)

Step-by-step solution →
Q68·ChemistryNumericalJEE Main 2023
For the substrate shown undergoing the reaction sequence (i) HBr(2eq)/H2_22​O2_22​; (ii) H2_22​/Pd, Δ\DeltaΔ to give 'A', then a further multi-step sequence to give 'D' = C13_{13}13​H19_{19}19​NO4_44​Ix_xx​, the value of x in compound 'D' is _________.

Correct answer: 15

Step-by-step solution →
Q69·ChemistrySingle correctJEE Main 2023
The incorrect statement regarding the reaction of the given secondary amine 'A' (shown) with NaNO2NaNO_2NaNO2​ and HX to give 'B' is
  1. (A)The electrophile involved in the reaction is NO+^++
  2. (B)‘B’ is N-nitroso ammonium compound
  3. (C)The reaction occurs at low temperature
  4. (D)The product ‘B’ formed in the above reaction is p-nitroso compound at low temperature

Correct answer: (B)

Step-by-step solution →
Q70·ChemistrySingle correctJEE Main 2023
Isomeric amines with molecular formula C8_88​H11_{11}11​N give the following tests. Isomer (P): can be prepared by Gabriel phthalimide synthesis. Isomer (Q): reacts with Hinsberg's reagent to give solid insoluble in NaOH. Isomer (R): reacts with HONO followed by β\betaβ-naphthol in NaOH to give red dye. Isomers (P), (Q) and (R) respectively are
  1. (A)(1)
  2. (B)(2)
  3. (C)(3)
  4. (D)(4)

Correct answer: (A)

Step-by-step solution →
Q71·ChemistrySingle correctJEE Main 2023
In the reaction given in the figure, the product 'X' is:
  1. (A)(1)
  2. (B)(2)
  3. (C)(3)
  4. (D)(4)

Correct answer: (A)

Step-by-step solution →
Q72·ChemistrySingle correctJEE Main 2023
The major products AAA and BBB from the following reactions are:
  1. (A)(1)
  2. (B)(2)
  3. (C)(3)
  4. (D)(4)

Correct answer: (D)

Step-by-step solution →
Q73·ChemistrySingle correctJEE Main 2023
The major product formed in the following reaction is:
  1. (A)(1)
  2. (B)(2)
  3. (C)(3)
  4. (D)(4)

Correct answer: (C)

Step-by-step solution →
Q74·ChemistrySingle correctJEE Main 2023
Compound PPP (M.F. C11H13NOC_{11}H_{13}NOC11​H13​NO) gives effervescence with NaHCO3NaHCO_3NaHCO3​, while RRR reacts with Hinsberg's reagent to give a solid soluble in NaOH. Compound PPP is:
  1. (A)(1)
  2. (B)(2)
  3. (C)(3)
  4. (D)(4)

Correct answer: (B)

Step-by-step solution →
Q75·ChemistryNumericalJEE Main 2023
Number of isomeric aromatic amines with molecular formula C8H11NC_8H_{11}NC8​H11​N, which can be synthesized by Gabriel Phthalimide synthesis is ____.

Correct answer: 5

Step-by-step solution →
Q76·ChemistrySingle correctJEE Main 2023
Given below are two statements: one is labelled as Assertion (A) and the other is labelled as Reason (R). Assertion (A): α\alphaα-halocarboxylic acid on reaction with dil NH3NH_3NH3​ gives good yield of α\alphaα-amino carboxylic acid whereas the yield of amines is very low when prepared from alkyl halides. Reason (R): Amino acids exist in zwitter ion form in aqueous medium. In the light of the above statements, choose the correct answer from the options given below:
  1. (A)Both (A) and (R) are correct and (R) is the correct explanation of (A)
  2. (B)(A) is not correct but (R) is correct
  3. (C)Both (A) and (R) are correct but (R) is not the correct explanation of (A)
  4. (D)(A) is correct but (R) is not correct

Correct answer: (A)

Step-by-step solution →
Q77·ChemistrySingle correctJEE Main 2023
In the reaction shown in the figure, 'AAA' is:
  1. (A)(1)
  2. (B)(2)
  3. (C)(3)
  4. (D)(4)

Correct answer: (C)

Step-by-step solution →
Q78·ChemistrySingle correctJEE Main 2023
Consider the following reaction and identify the product B. Ph−NO2→C2H5OHH2/Pd[A]→Pyridine(CH3CO)2O[B]Ph-NO_2 \xrightarrow[C_2H_5OH]{H_2/Pd} [A] \xrightarrow[Pyridine]{(CH_3CO)_2O} [B]Ph−NO2​H2​/PdC2​H5​OH​[A](CH3​CO)2​OPyridine​[B]
  1. (A)(1)
  2. (B)(2)
  3. (C)(3)
  4. (D)(4)

Correct answer: (A)

Step-by-step solution →
Q79·ChemistryNumericalJEE Main 2023
How many of the transformations given below would result in aromatic amines ?

Correct answer: 3

Step-by-step solution →
Q80·ChemistrySingle correctJEE Main 2023
An organic compound [A] (C4H11NC_4H_{11}NC4​H11​N), shows optical activity and gives N2N_2N2​ gas on treatment with HNO2HNO_2HNO2​. The compound [A] reacts with PhSO2ClPhSO_2ClPhSO2​Cl producing a compound which is soluble in KOH.
  1. (A)(1)
  2. (B)(2)
  3. (C)(3)
  4. (D)(4)

Correct answer: (D)

Step-by-step solution →
Q81·ChemistrySingle correctJEE Main 2023
Benzyl isocyanide can be obtained by the reactions shown. Choose the correct answer from the options given below:
  1. (A)A and D
  2. (B)Only B
  3. (C)B and C
  4. (D)A and B

Correct answer: (D)

Step-by-step solution →
Q82·ChemistrySingle correctJEE Main 2023
Reaction of propanamide with Br2/KOH (aq)Br_2/KOH\,(aq)Br2​/KOH(aq) produces:
  1. (A)Propylamine
  2. (B)Ethylnitrile
  3. (C)Propanenitrile
  4. (D)Ethylamine

Correct answer: (D)

Step-by-step solution →
Q83·ChemistrySingle correctJEE Main 2023
Match List I (Amines) with List II (pKbpK_bpKb​ values) and choose the correct answer from the options given below.
LIST I (Amines)LIST II ($pK_b$)
A.AnilineI.3.25
B.EthanamineII.3.00
C.N-EthylethanamineIII.9.38
D.N,N-DiethylethanamineIV.3.29
  1. (A)A-III, B-IV, C-II, D-I
  2. (B)A-III, B-II, C-I, D-IV
  3. (C)A-I, B-IV, C-II, D-III
  4. (D)A-III, B-II, C-IV, D-I

Correct answer: (A)

Step-by-step solution →
Q84·ChemistrySingle correctJEE Main 2023
The correct order in aqueous medium of basic strength in case of methyl substituted amines is:
  1. (A)Me3N>Me2NH>MeNH2>NH3Me_3N > Me_2NH > MeNH_2 > NH_3Me3​N>Me2​NH>MeNH2​>NH3​
  2. (B)Me2NH>MeNH2>Me3N>NH3Me_2NH > MeNH_2 > Me_3N > NH_3Me2​NH>MeNH2​>Me3​N>NH3​
  3. (C)Me3N>Me2NH>NH3>MeNH2Me_3N > Me_2NH > NH_3 > MeNH_2Me3​N>Me2​NH>NH3​>MeNH2​
  4. (D)NH3>Me3N>Me2NH>MeNH2NH_3 > Me_3N > Me_2NH > MeNH_2NH3​>Me3​N>Me2​NH>MeNH2​

Correct answer: (B)

Step-by-step solution →
Q85·ChemistrySingle correctJEE Main 2023
Given below are two statements: Statement I: Pure Aniline and other arylamines are usually colourless. Statement II: Arylamines get coloured on storage due to atmospheric reduction. In the light of the above statements, choose the most appropriate answer from the options given below:
  1. (A)Both Statement I and Statement II are incorrect
  2. (B)Statement I is incorrect but Statement II is correct
  3. (C)Statement I is correct but Statement II is incorrect
  4. (D)Both Statement I and Statement II are correct

Correct answer: (C)

Step-by-step solution →
Q86·ChemistrySingle correctJEE Main 2022
Consider the above reaction, the compound 'A' is :
  1. (A)(A)
  2. (B)(B)
  3. (C)(C)
  4. (D)(D)

Correct answer: (C)

Step-by-step solution →
Q87·ChemistrySingle correctJEE Main 2022
Which among the following is the strongest Bronsted base ?
  1. (A)Aldrin and Dieldrin
  2. (B)Sodium chlorate and Aldrin
  3. (C)Sodium arsinate and Dieldrin
  4. (D)Sodium chlorate and sodium arsinite.

Correct answer: (D)

Step-by-step solution →
Q88·ChemistrySingle correctJEE Main 2022
The Hinsberg reagent is :
  1. (A)(A)
  2. (B)(B)
  3. (C)(C)
  4. (D)(D)

Correct answer: (A)

Step-by-step solution →
Q89·ChemistrySingle correctJEE Main 2022
Given below are two statements : one is labelled as Assertion A and the other is labelled as Reason R Assertion A : Aniline on nitration yields ortho, meta & para nitro derivatives of aniline. Reason R: Nitrating mixture is a strong acidic mixture. In the light of the above statements, choose the correct answer from the options given below
  1. (A)Both A and R are true and R is the correct explanation of A
  2. (B)Both A and R are true but R is NOT the correct explanation of A
  3. (C)A is true but R is false
  4. (D)A is false but R is true

Correct answer: (A)

Step-by-step solution →
Q90·ChemistrySingle correctJEE Main 2022
Identify the correct statement for the below given transformation.
  1. (A)A - CH3_33​CH2_22​CH = CH–CH3_33​, B – CH3_33​CH2_22​CH2_22​CH = CH2_22​, Saytzeff products
  2. (B)A - CH3_33​CH2_22​CH = CH–CH3_33​, B – CH3_33​CH2_22​CH2_22​CH = CH2_22​, Hafmann products
  3. (C)A - CH3_33​CH2_22​CH2_22​CH = CH2_22​, B – CH3_33​CH2_22​CH = CHCH3_33​, Hofmann products
  4. (D)A - CH3_33​CH2_22​CH2_22​CH = CH2_22​, B – CH3_33​CH2_22​CH = CHCH3_33​, Saytzeff products

Correct answer: (C)

Step-by-step solution →
Q91·ChemistrySingle correctJEE Main 2022
An organic compound 'A' contains nitrogen and chlorine. It dissolves readily in water to give a solution that turns litmus red. Titration of compound 'A' with standard base indicates that the molecular weight of 'A' is 131 ± 2. When a sample of 'A' is treated with aq. NaOH, a liquid separates which contains N but not Cl. Treatment of the obtained liquid with nitrous acid followed by phenol gives orange precipitate. The compound 'A' is :
  1. (A)(A)
  2. (B)(B)
  3. (C)(C)
  4. (D)(D)

Correct answer: (D)

Step-by-step solution →
Q92·ChemistrySingle correctJEE Main 2022
Match List I with List II Choose the correct answer from the options given below:
List IList II
A.Benzenesulphonyl chlorideI.Test for primary amines
B.Hoffmann bromamide reactionII.Anti Saytzeff
C.Carbylamine reactionIII.Hinsberg reagent
D.Hoffmann orientationIV.Known reaction of Isocyanates.
  1. (A)A-IV, B –III, C-II, D-I
  2. (B)A-IV, B –II, C-I, D-III
  3. (C)A-III, B –IV, C-I, D-II
  4. (D)A-IV, B –III, C-I, D-II

Correct answer: (C)

Step-by-step solution →
Q93·ChemistrySingle correctJEE Main 2022
Given below are two statements : one is labelled as Assertion (A) and the other is labelled as Reason (R). Assertion (A) : Experimental reaction of CH3_33​Cl with aniline and anhydrous AlCl3_33​ does not give o and p-methylaniline. Reason (R) : The — NH2_22​ group of aniline becomes deactivating because of salt formation with anhydrous AlCl3_33​ and hence yields m-methyl aniline as the product. In the light of the above statements, choose the most appropriate answer from the options given below :
  1. (A)Both (A) and (R) are true and (R) is the correct explanation of (A).
  2. (B)Both (A) and (R) are true but (R) is not the correct explanation of (A).
  3. (C)(A) is true, but (R) is false.
  4. (D)(A) is false, but (R) is true.

Correct answer: (C)

Step-by-step solution →
Q94·ChemistrySingle correctJEE Main 2022
An organic compound 'A' on reaction with NH3NH_{3}NH3​ followed by heating gives compound B. Which on further strong heating gives compound C (C8H5NO2C_{8}H_{5}NO_{2}C8​H5​NO2​). Compound C on sequential reaction with ethanolic KOH, alkyl chloride and hydrolysis with alkali gives a primary amine. The compound A is :
  1. (A)(A)
  2. (B)(B)
  3. (C)(C)
  4. (D)(D)

Correct answer: (C)

Step-by-step solution →
Q95·ChemistrySingle correctJEE Main 2022
In Friedel-Crafts alkylation of aniline, one gets :
  1. (A)alkylated product with ortho and para substitution.
  2. (B)secondary amine after acidic treatment.
  3. (C)an amide product.
  4. (D)positively charged nitrogen at benzene ring.

Correct answer: (D)

Step-by-step solution →
Q96·ChemistrySingle correctJEE Main 2022
Consider the above reaction, the product A and product B respectively are
  1. (A)(A)
  2. (B)(B)
  3. (C)(C)
  4. (D)(D)

Correct answer: (C)

Step-by-step solution →
Q97·ChemistrySingle correctJEE Main 2022
With respect to the following reaction, consider the given statements : (A) o-Nitroaniline and p-nitroaniline are the predominant products (B) p-Nitroaniline and m-nitroaniline are the predominant products (C) HNO3_33​ acts as an acid (D) H2_22​SO4_44​ acts as an acid
  1. (A)(A) and (C) are correct statements.
  2. (B)(A) and (D) are correct statements.
  3. (C)(B) and (D) are correct statements.
  4. (D)(B) and (C) are correct statements.

Correct answer: (C)

Step-by-step solution →
Q98·ChemistrySingle correctJEE Main 2022
A primary aliphatic amine on reaction with nitrous acid in cold (273 K) and there after raising temperature of reaction mixture to room temperature (298 K). Gives a/an
  1. (A)nitrile
  2. (B)alcohol
  3. (C)diazonium salt
  4. (D)secondary amine

Correct answer: (B)

Step-by-step solution →
Q99·ChemistrySingle correctJEE Main 2022
Given below are two statements: Statements-I : In Hofmann degradation reaction, the migration of only an alkyl group takes place from carbonyl carbon of the amide to the nitrogen atom. Statement-II : The group is migrated in Hofmann degradation reaction to electron deficient atom. In the light of the above statement, choose the most appropriate answer from the options given below:
  1. (A)Both Statement-I and Statement-II are correct
  2. (B)Both Statement-I and Statement-II are incorrect
  3. (C)Statement-I is correct but Statement-II is incorrect
  4. (D)Statement-I is incorrect but Statement-II is correct

Correct answer: (D)

Step-by-step solution →
Q100·ChemistrySingle correctJEE Main 2022
Decarboxylation of all six possible forms of diaminobenzoic acids C6_66​H3_33​(NH2_22​)2_22​COOH yields three products A, B and C. Three acids give a product 'A', two acids gives a product 'B' and one acid give a product 'C'. The melting point of product 'C' is
  1. (A)63∘^{\circ}∘C
  2. (B)90∘^{\circ}∘C
  3. (C)104∘^{\circ}∘C
  4. (D)142∘^{\circ}∘C

Correct answer: (D)

Step-by-step solution →
Q101·ChemistrySingle correctJEE Main 2022
Which statement is NOT correct for p-toluenesulphonyl chloride?
  1. (A)It is known as Hinsberg's reagent.
  2. (B)It is used to distinguish primary and secondary amines.
  3. (C)On treatment with secondary amine, it leads to a product, that is soluble in alkali.
  4. (D)It doesn't react with tertiary amines.

Correct answer: (C)

Step-by-step solution →
Q102·ChemistrySingle correctJEE Main 2022
The reaction of R−C∥O−NH2R-\underset{\substack{\parallel \\ O}}{C}-NH_2R−∥O​C​−NH2​ with bromine and KOH gives RNH2RNH_2RNH2​ as the end product. Which one of the following is the intermediate product formed in this reaction ?
  1. (A)R−C∥O−NH−BrR-\underset{\substack{\parallel \\ O}}{C}-NH-BrR−∥O​C​−NH−Br
  2. (B)R−NH−BrR-NH-BrR−NH−Br
  3. (C)R−N=C=OR-N=C=OR−N=C=O
  4. (D)R−C∥O−NBr2R-\underset{\substack{\parallel \\ O}}{C}-NBr_2R−∥O​C​−NBr2​

Correct answer: (C)

Step-by-step solution →
Q103·ChemistrySingle correctJEE Main 2022
The major product of the above reaction is
  1. (A)(A)
  2. (B)(B)
  3. (C)(C)
  4. (D)(D)

Correct answer: (D)

Step-by-step solution →
Q104·ChemistrySingle correctJEE Main 2022
The conversion of propan-1-ol to n-butylamine involves the sequential addition of reagents. The correct sequential order of reagents is.
  1. (A)(i) SOCl2_22​ (ii) KCN (iii) H2_22​/Ni,Na(Hg)/C2_22​H5_55​OH
  2. (B)(i) HCl (ii) H2_22​/Ni, Na(Hg)/C2_22​H5_55​OH
  3. (C)(i) SOCl2_22​ (ii) KCN (iii) CH3_33​NH2_22​
  4. (D)(i) HCl (ii) CH3_33​NH2_22​

Correct answer: (A)

Step-by-step solution →
Q105·ChemistryMultiple correctJEE Advanced 2021
Correct option(s) for the following sequence of reactions is(are)
  1. (A)Q\mathbf{Q}Q = KNO2_{2}2​, W\mathbf{W}W = LiAlH4_{4}4​
  2. (B)R\mathbf{R}R = benzenamine, V\mathbf{V}V = KCN
  3. (C)Q\mathbf{Q}Q = AgNO2_{2}2​, R\mathbf{R}R = phenylmethanamine
  4. (D)W\mathbf{W}W = LiAlH4_{4}4​, V\mathbf{V}V = AgCN

Correct answer: (C), (D)

Step-by-step solution →
Q106·ChemistrySingle correctJEE Main 2021
Identify A in the following reaction.
  1. (A)(1)
  2. (B)(2)
  3. (C)(3)
  4. (D)(4)

Correct answer: (A)

Step-by-step solution →
Q107·ChemistryNumericalJEE Main 2021
The total number of reagents from those given below, that can convert nitrobenzene into aniline is __. (Integer answer) I. Sn −-− HCl II. Sn −-− NH4OH\mathrm{NH_4OH}NH4​OH III. Fe −-− HCl IV. Zn −-− HCl V. H2\mathrm{H_2}H2​ −-− Pd VI. H2\mathrm{H_2}H2​ −-− Raney Nickel

Correct answer: 5

Step-by-step solution →
Q108·ChemistrySingle correctJEE Main 2021
Identify correct A, B and C in the reaction sequence given below :
  1. (A)(1)
  2. (B)(2)
  3. (C)(3)
  4. (D)(4)

Correct answer: (A)

Step-by-step solution →
Q109·ChemistrySingle correctJEE Main 2021
The major products A and B in the following set of reactions are :
  1. (A)(1)
  2. (B)(2)
  3. (C)(3)
  4. (D)(4)

Correct answer: (C)

Step-by-step solution →
Q110·ChemistrySingle correctJEE Main 2021
The major products A and B formed in the following reaction sequence are :
  1. (A)(1)
  2. (B)(2)
  3. (C)(3)
  4. (D)(4)

Correct answer: (B)

Step-by-step solution →
Q111·ChemistrySingle correctJEE Main 2021
The major product of the following reaction is :
  1. (A)CH3−CH∣CH3−CH∣Br−CH2OH\mathrm{CH_3-}\underset{\mathrm{CH_3}}{\underset{|}{\mathrm{CH}}}\mathrm{-}\overset{\mathrm{Br}}{\overset{|}{\mathrm{CH}}}\mathrm{-CH_2OH}CH3​−CH3​∣CH​​−CH∣Br−CH2​OH
  2. (B)CH3−CH∣CH3−CH2−CH2−CH2OH\mathrm{CH_3-}\underset{\mathrm{CH_3}}{\underset{|}{\mathrm{CH}}}\mathrm{-CH_2-CH_2-CH_2OH}CH3​−CH3​∣CH​​−CH2​−CH2​−CH2​OH
  3. (C)CH3−CH∣CH3−CH2−CH2OH\mathrm{CH_3-}\underset{\mathrm{CH_3}}{\underset{|}{\mathrm{CH}}}\mathrm{-CH_2-CH_2OH}CH3​−CH3​∣CH​​−CH2​−CH2​OH
  4. (D)CH3−CH∣CH3−CH2−CH2−Cl\mathrm{CH_3-}\underset{\mathrm{CH_3}}{\underset{|}{\mathrm{CH}}}\mathrm{-CH_2-CH_2-Cl}CH3​−CH3​∣CH​​−CH2​−CH2​−Cl

Correct answer: (C)

Step-by-step solution →
Q112·ChemistrySingle correctJEE Main 2021
Which of the following is not a correct statement for primary aliphatic amines?
  1. (A)The intermolecular association in primary amines is less than the intermolecular association in secondary amines.
  2. (B)Primary amines on treating with nitrous acid solution form corresponding alcohols except methyl amine.
  3. (C)Primary amines are less basic than the secondary amines.
  4. (D)Primary amines can be prepared by the Gabriel phthalimide synthesis.

Correct answer: (A)

Step-by-step solution →
Q113·ChemistrySingle correctJEE Main 2021
The correct structures of A and B formed in the following reactions are :
  1. (A)(1)
  2. (B)(2)
  3. (C)(3)
  4. (D)(4)

Correct answer: (D)

Step-by-step solution →
Q114·ChemistrySingle correctJEE Main 2021
The major product in the above reaction is :
  1. (A)(1)
  2. (B)(2)
  3. (C)(3)
  4. (D)(4)

Correct answer: (D)

Step-by-step solution →
Q115·ChemistrySingle correctJEE Main 2021
Given below are two statements: Statement I: Aniline is less basic than acetamide. Statement II: In aniline, the lone pair of electrons on nitrogen atom is delocalised over benzene ring due to resonance and hence less available to a proton. Choose the most appropriate option:
  1. (A)Statement I is true but statement II is false.
  2. (B)Statement I is false but Statement II is true
  3. (C)Both Statement I and Statement II are true.
  4. (D)Both Statement I and Statement II are false.

Correct answer: (B)

Step-by-step solution →
Q116·ChemistrySingle correctJEE Main 2021
What is A in the following reaction?
  1. (A)(A)
  2. (B)(B)
  3. (C)(C)
  4. (D)(D)

Correct answer: (A)

Step-by-step solution →
Q117·ChemistryNumericalJEE Main 2021
In gaseous triethyl amine the "– C – N – C –" bond angle is ____________ degree.

Correct answer: 108

Step-by-step solution →
Q118·ChemistrySingle correctJEE Main 2021
Which one of the products of the following reactions does not react with Hingberg reagent to form sulphonamide?
  1. (A)(A)
  2. (B)(B)
  3. (C)(C)
  4. (D)(D)

Correct answer: (D)

Step-by-step solution →
Q119·ChemistrySingle correctJEE Main 2021
What is the major product "P" of the following reaction?
  1. (A)(A)
  2. (B)(B)
  3. (C)(C)
  4. (D)(D)

Correct answer: (D)

Step-by-step solution →
Q120·ChemistrySingle correctJEE Main 2021
Which one of the following compounds will liberate CO2CO_2CO2​, when treated with NaHCO3NaHCO_3NaHCO3​?
  1. (A)(CH3)4N⊕ O⊖H(CH_3)_4\overset{\oplus}{N}\,\overset{\ominus}{O}H(CH3​)4​N⊕O⊖H
  2. (B)CH3NH2CH_3NH_2CH3​NH2​
  3. (C)(CH3)3N⊕H Cl⊖(CH_3)_3\overset{\oplus}{N}H\,\overset{\ominus}{Cl}(CH3​)3​N⊕HCl⊖
  4. (D)CH3−CO−NH2CH_3-CO-NH_2CH3​−CO−NH2​

Correct answer: (C)

Step-by-step solution →
Q121·ChemistrySingle correctJEE Main 2021
Given below are two statements, one is labelled as Assertion (A) and other is labelled as Reason (R) Assertion (A): Gabriel phthalimide synthesis cannot be used to prepare aromatic primary amines. Reason (R): Aryl halides do not undergo nucleophilic substitution reaction. In the light of the above statements, choose the correct answer from the options given below:
  1. (A)Both (A) and (R) are true and (R) is correct explanation of (A).
  2. (B)(A) is false but (R) is true.
  3. (C)(A) is true but (R) is false
  4. (D)Both (A) and (R) are true but (R) is not the correct explanation of (A).

Correct answer: (A)

Step-by-step solution →
Q122·ChemistrySingle correctJEE Main 2021
Which one of the following reactions does not occur?
  1. (A)(A)
  2. (B)(B)
  3. (C)(C)
  4. (D)(D)

Correct answer: (A)

Step-by-step solution →
Q123·ChemistrySingle correctJEE Main 2021
Compound A is converted to B on reaction with CHCl3CHCl_3CHCl3​ and KOH. The compound B is toxic and can be decomposed by C. A, B and C respectively are:
  1. (A)Primary amine, nitrile compound, conc. HCl
  2. (B)Primary amine, isonitrile compound , conc. HCl
  3. (C)Secondary amine, isonitrile compound, conc NaOH
  4. (D)Secondary amine, nitrile compound, conc. NaOH

Correct answer: (B)

Step-by-step solution →
Q124·ChemistrySingle correctJEE Main 2021
In the above reactions, product A and product B respectively are:
  1. (A)(A)
  2. (B)(B)
  3. (C)(C)
  4. (D)(D)

Correct answer: (B)

Step-by-step solution →
Q125·ChemistryNumericalJEE Main 2021
A reaction of 0.1 mole of Benzylamine with bromomethane gave 23 g of Benzyl trimethyl ammonium bromide. The number of moles of bromomethane consumed in this reaction are n × 10−1^{-1}−1, when n = ______. (Round off to the Nearest Integer). (Given : Atomic masses : C : 12.0 u, H : 1.0 u, N : 14.0 u, Br : 80.0 u]

Correct answer: 3

Step-by-step solution →
Q126·ChemistrySingle correctJEE Main 2021
Consider the given reaction, percentage yield of :
  1. (A)C > A > B
  2. (B)B > C > A
  3. (C)A > C > B
  4. (D)C > B > A

Correct answer: (D)

Step-by-step solution →
Q127·ChemistrySingle correctJEE Main 2021
An organic compound "A" on treatment with benzene sulphonyl chloride gives compound B. B is soluble in dil. NaOH solution. Compound A is :
  1. (A)C6_{6}6​H5_{5}5​–N–(CH3_{3}3​)2_{2}2​
  2. (B)C6_{6}6​H5_{5}5​–NHCH2_{2}2​CH3_{3}3​
  3. (C)C6_{6}6​H5_{5}5​–CH2_{2}2​ NHCH3_{3}3​
  4. (D)C6_{6}6​H5_{5}5​–CH(CH3_{3}3​)–NH2_{2}2​

Correct answer: (D)

Step-by-step solution →
Q128·ChemistrySingle correctJEE Main 2021
In the reaction of hypobromite with amide, the carbonyl carbon is lost as :
  1. (A)CO32−_{3}^{2-}32−​
  2. (B)HCO3−_{3}^{-}3−​
  3. (C)CO2_{2}2​
  4. (D)CO

Correct answer: (A)

Step-by-step solution →
Q129·ChemistrySingle correctJEE Main 2021
Which of the following reaction is an example of ammonolysis?
  1. (A)C6H5COCl+C6H5NH2⟶C6H5CONHC6H5\mathrm{C_6H_5COCl + C_6H_5NH_2 \longrightarrow C_6H_5CONHC_6H_5}C6​H5​COCl+C6​H5​NH2​⟶C6​H5​CONHC6​H5​
  2. (B)C6H5CH2CN→[H]C6H5CH2CH2NH2\mathrm{C_6H_5CH_2CN \xrightarrow{[H]} C_6H_5CH_2CH_2NH_2}C6​H5​CH2​CN[H]​C6​H5​CH2​CH2​NH2​
  3. (C)C6H5NH2→HClC6H5N+H3Cl−\mathrm{C_6H_5NH_2 \xrightarrow{HCl} C_6H_5\overset{+}{N}H_3Cl^-}C6​H5​NH2​HCl​C6​H5​N+H3​Cl−
  4. (D)C6H5CH2Cl+NH3⟶C6H5CH2NH2\mathrm{C_6H_5CH_2Cl + NH_3 \longrightarrow C_6H_5CH_2NH_2}C6​H5​CH2​Cl+NH3​⟶C6​H5​CH2​NH2​

Correct answer: (D)

Step-by-step solution →
Q130·ChemistrySingle correctJEE Main 2021
Hoffmann bromomide degradation of benzamide gives product A, which upon heating with CHCl3\mathrm{CHCl_3}CHCl3​ and NaOH gives product B. The structures of A and B are :
  1. (A)(1)
  2. (B)(2)
  3. (C)(3)
  4. (D)(4)

Correct answer: (B)

Step-by-step solution →
Q131·ChemistrySingle correctJEE Main 2021
Primary, secondary and tertiary amines can be separated using :-
  1. (A)Para-Toluene sulphonyl chloride
  2. (B)Chloroform and KOH
  3. (C)Benzene sulphonic acid
  4. (D)Acetyl amide

Correct answer: (A)

Step-by-step solution →
Q132·ChemistrySingle correctJEE Main 2021
Ammonolysis of Alkyl halides followed by the treatment with NaOH solution can be used to prepare primary, secondary and tertiary amines. The purpose of NaOH in the reaction is :
  1. (A)to remove basic impurities
  2. (B)to activate NH3_{3}3​ used in the reaction
  3. (C)to remove acidic impurities
  4. (D)to increase the reactivity of alkyl halide

Correct answer: (C)

Step-by-step solution →
Q133·ChemistrySingle correctJEE Main 2021
Which of the following is least basic ?
  1. (A)(CH3_{3}3​CO)N¨\ddot{\mathrm{N}}N¨HC2_{2}2​H5_{5}5​
  2. (B)(C2_{2}2​H5_{5}5​)3N¨_{3}\ddot{\mathrm{N}}3​N¨
  3. (C)(CH3_{3}3​CO)2N¨_{2}\ddot{\mathrm{N}}2​N¨H
  4. (D)(C2_{2}2​H5_{5}5​)2N¨_{2}\ddot{\mathrm{N}}2​N¨H

Correct answer: (C)

Step-by-step solution →
Q134·ChemistrySingle correctJEE Main 2021
A. Phenyl methanamine B. N, N-Dimethylaniline C. N-Methyl aniline D. Benzenamine Choose the correct order of basic nature of the above amines.
  1. (A)D > C > B > A
  2. (B)D > B > C > A
  3. (C)A > C > B > D
  4. (D)A > B > C > D

Correct answer: (D)

Step-by-step solution →
Q135·ChemistrySingle correctJEE Main 2021
An amine on reaction with benzenesulphonyl chloride produces a compound insoluble in alkaline solution. This amine can be prepared by ammonolysis of ethyl chloride. The correct structure of amine is :
  1. (A)(A)
  2. (B)(B)
  3. (C)(C)
  4. (D)(D)

Correct answer: (A)

Step-by-step solution →
Q136·ChemistrySingle correctJEE Main 2021
Carbylamine test is used to detect the presence of primary amino group in an organic compound. Which of the following compound is formed when this test is performed with aniline ? CONH2NC NHCH3^{3}3CN
  1. (A)(A)
  2. (B)(B)
  3. (C)(C)
  4. (D)(D)

Correct answer: (B)

Step-by-step solution →
Q137·ChemistrySingle correctJEE Main 2021
288K^{288K}288KNO2 NO2 (A) (B) (C) Correct statement about the given chemical reaction is :
  1. (A)Reaction is possible and compound (A) will be major product.
  2. (B)The reaction will form sulphonated product instead of nitration. ¨
  3. (C)— N H 2_{2}2​group is ortho and para directive, so product (B) is not possible.
  4. (D)Reaction is possible and compound (B) will be the major product.

Correct answer: (A)

Step-by-step solution →
Q138·ChemistrySingle correctJEE Main 2021
Which of the following reaction/s will not give p-aminoazobenzene?
  1. (A)B only
  2. (B)A and B
  3. (C)C only
  4. (D)A only

Correct answer: (A)

Step-by-step solution →
Q139·ChemistrySingle correctJEE Main 2021
In the following reaction the reason why meta−nitro product also formed is:
  1. (A)Formation of anilinium ion
  2. (B)−NO2\mathrm{-NO_2}−NO2​ substitution always takes place at meta−position
  3. (C)low temperature
  4. (D)−NH2\mathrm{-NH_2}−NH2​ group is highly meta−directive

Correct answer: (A)

Step-by-step solution →
Q140·ChemistryNumericalJEE Main 2021
The total number of amines among the following which can be synthesized by Gabriel synthesis is _________.

Correct answer: 3

Step-by-step solution →
Q141·ChemistryNumericalJEE Main 2021
1.86 g of aniline completely reacts to form acetanilide. 10% of the product is lost during purificatiion. Amount of acetanilide obtained after purification (in g) is ____× 10−210^{-2}10−2 .

Correct answer: 243

Step-by-step solution →
Q142·ChemistryMultiple correctJEE Advanced 2020
Consider the following four compounds I, II, III, and IV. Choose the correct statement(s).
  1. (A)The order of basicity is II > I > III > IV.
  2. (B)The magnitude of pKbpK_{b}pKb​ difference between I and II is more than that between III and IV.
  3. (C)Resonance effect is more in III than in IV.
  4. (D)Steric effect makes compound IV more basic than III.

Correct answer: (C), (D)

Step-by-step solution →
Q143·ChemistrySingle correctJEE Main 2020
The increasing order of pKbpK_bpKb​ values of the following compounds is:
  1. (A)II < IV < III < I
  2. (B)I < II < IV < III
  3. (C)II < I < III < IV
  4. (D)I < II < III < IV

Correct answer: (B)

Step-by-step solution →
Q144·ChemistrySingle correctJEE Main 2020
Which of the following compounds can e prepared in good yield by Gabriel phthalimide synthesis?
  1. (A)(A)
  2. (B)CH3_33​–CH2_22​–NHCH3_33​
  3. (C)(C)
  4. (D)(D)

Correct answer: (A)

Step-by-step solution →
Q145·ChemistrySingle correctJEE Main 2020
The most appropriate reagent for conversion of C2H5CNC_2H_5CNC2​H5​CN into CH3CH2CH2NH2CH_3CH_2CH_2NH_2CH3​CH2​CH2​NH2​ is:
  1. (A)CaH2CaH_2CaH2​
  2. (B)Na(CN)BH3Na(CN)BH_3Na(CN)BH3​
  3. (C)LiAlH4LiAlH_4LiAlH4​
  4. (D)NaBH4NaBH_4NaBH4​

Correct answer: (C)

Step-by-step solution →
Q146·ChemistrySingle correctJEE Main 2020
Three isomers A, B and C (mol. formula C8_{8}8​H11_{11}11​N) give the following results: R has lower boiling point than S B →C6H5SO2Cl\xrightarrow{\text{C}_{6}\text{H}_{5}\text{SO}_{2}\text{Cl}}C6​H5​SO2​Cl​ alkali – insoluble product A, B and C, respectively are:
  1. (A)(A)
  2. (B)(B)
  3. (C)(C)
  4. (D)(D)

Correct answer: (B)

Step-by-step solution →
Q147·ChemistrySingle correctJEE Main 2020
Consider the following reactions: The compound[P] is
  1. (A)(A)
  2. (B)(B)
  3. (C)(C)
  4. (D)(D)

Correct answer: (B)

Step-by-step solution →
Q148·ChemistrySingle correctJEE Main 2020
The decreasing order of basicity of the following amines is
  1. (A)(III) > (I) > (II) > (IV)
  2. (B)(II) > (III) > (IV) > (I)
  3. (C)(I) > (III) > (IV) > (II)
  4. (D)(III) > (II) > (I) > (IV)

Correct answer: (D)

Step-by-step solution →
Q149·ChemistrySingle correctJEE Main 2020
In the following reaction sequence The major product B is
  1. (A)(A)
  2. (B)(B)
  3. (C)(C)
  4. (D)(D)

Correct answer: (D)

Step-by-step solution →
Q150·ChemistrySingle correctJEE Main 2020
The increasing order of pKb_bb​ for the following compounds will be (a) NH2_22​-CH=NH2_22​ (b) [structure shown] (c) CH3_33​NHCH3_33​
  1. (A)b < c < a
  2. (B)c < a < b
  3. (C)b < a < c
  4. (D)a < b < c

Correct answer: (C)

Step-by-step solution →
Q151·ChemistrySingle correctJEE Main 2019
Which of the following is NOT a correct method of the preparation of benzylamine from cyanobenzene?
  1. (A)(i) HCl/H2_22​O (ii) NaBH4_44​
  2. (B)(i) LiAlH4_44​ (ii) H3_33​O+
  3. (C)(i) SnCl2_22​ + HCl(gas) (ii) NaBH4_44​
  4. (D)H2_22​/Ni

Correct answer: (A)

Step-by-step solution →
Q152·ChemistrySingle correctJEE Main 2019
The major product of the following reaction is CH3_33​CH(OH)CH2_22​CH2_22​NH2_22​ →ethyl formate (1 equiv.), triethylamine\xrightarrow{\text{ethyl formate (1 equiv.), triethylamine}}ethyl formate (1 equiv.), triethylamine​
  1. (A)CH3_33​CH(OH)CH=CH2_22​
  2. (B)HCO-O-CH(CH3_33​)CH2_22​CH2_22​NH2_22​
  3. (C)CH3_33​CH=CH-CH2_22​NH2_22​
  4. (D)CH3_33​CH(OH)CH2_22​CH2_22​NHCHO

Correct answer: (D)

Step-by-step solution →
Q153·ChemistrySingle correctJEE Main 2019
Ethylamine (C2H5NH2C_2H_5NH_2C2​H5​NH2​) can be obtained from N-ethylphthalimide on treatment with:
  1. (A)CaH2CaH_2CaH2​
  2. (B)H2OH_2OH2​O
  3. (C)NaBH4NaBH_4NaBH4​
  4. (D)NH2NH2NH_2NH_2NH2​NH2​

Correct answer: (D)

Step-by-step solution →
Q154·ChemistrySingle correctJEE Main 2019
Hinsberg's reagent is:
  1. (A)C6_66​H5_55​SO2_22​Cl
  2. (B)C6_66​H5_55​COCl
  3. (C)SOCl2_22​
  4. (D)(COCl)2_22​

Correct answer: (A)

Step-by-step solution →
Q155·ChemistrySingle correctJEE Main 2019
Which of the following amines can be prepared by Gabriel phthalimide reaction?
  1. (A)t – butylamine
  2. (B)n – butylamine
  3. (C)neo – pentylamine
  4. (D)triethylamine

Correct answer: (B)

Step-by-step solution →
Q156·ChemistrySingle correctJEE Main 2019
The major product obtained in the following reactions is"
  1. (A)(A)
  2. (B)(B)
  3. (C)(C)
  4. (D)(D)

Correct answer: (D)

Step-by-step solution →
Q157·ChemistrySingle correctJEE Main 2019
In the following compounds, the decreasing order of basic strength will be:
  1. (A)C2H5NH2>NH3>(C2H5)2NHC_2H_5NH_2 > NH_3 > (C_2H_5)_2NHC2​H5​NH2​>NH3​>(C2​H5​)2​NH
  2. (B)NH3>C2H5NH2>(C2H5)2NHNH_3 > C_2H_5NH_2 > (C_2H_5)_2NHNH3​>C2​H5​NH2​>(C2​H5​)2​NH
  3. (C)(C2H5)2NH>C2H5NH2>NH3(C_2H_5)_2NH > C_2H_5NH_2 > NH_3(C2​H5​)2​NH>C2​H5​NH2​>NH3​
  4. (D)(C2H5)2NH>NH3>C2H5NH2(C_2H_5)_2NH > NH_3 > C_2H_5NH_2(C2​H5​)2​NH>NH3​>C2​H5​NH2​

Correct answer: (C)

Step-by-step solution →
Q158·ChemistrySingle correctJEE Main 2019
The major product of the following reaction is:
  1. (A)(A)
  2. (B)(B)
  3. (C)(C)
  4. (D)(D)

Correct answer: (A)

Step-by-step solution →
Q159·ChemistrySingle correctJEE Main 2019
The increasing order of reactivity of the following compounds towards reaction with alkyl halide directly is:
  1. (A)(b) < (a) < (c) < (d)
  2. (B)(a) < (b) < (c) < (d)
  3. (C)(b) < (a) < (d) < (c)
  4. (D)(a) < (c) < (d) < (b)

Correct answer: (A)

Step-by-step solution →
Q160·ChemistrySingle correctJEE Main 2019
The major product of the following reaction is:
  1. (A)(A)
  2. (B)(B)
  3. (C)(C)
  4. (D)(D)

Correct answer: (D)

Step-by-step solution →
Q161·ChemistrySingle correctJEE Main 2019
A compound 'X' on treatment with Br2_22​/NaOH, provided C3_33​H9_99​N, which gives positive carbylamine test. Compound 'X' is:
  1. (A)CH3_33​COCH2_22​NHCH3_33​
  2. (B)CH3_33​CH2_22​COCH2_22​NH2_22​
  3. (C)CH3_33​CH2_22​CH2_22​CONH2_22​
  4. (D)CH3_33​CON(CH3_33​)2_22​

Correct answer: (C)

Step-by-step solution →
Q162·ChemistrySingle correctJEE Main 2019
The major product obtained in the following reaction is:
  1. (A)(A)
  2. (B)(B)
  3. (C)(C)
  4. (D)(D)

Correct answer: (D)

Step-by-step solution →
Q163·ChemistrySingle correctJEE Main 2019
The increasing basicity order of the following compounds is (1) CH3_33​CH2_22​NH2_22​ (2) CH3_33​CH2_22​NH-CH2_22​CH3_33​ (3) (CH3_33​)3_33​N (4) Ph-N(CH3_33​)-H
  1. (A)(4) < (3) < (2) < (1)
  2. (B)(4) < (3) < (1) < (2)
  3. (C)(1) < (2) < (3) < (4)
  4. (D)(1) < (2) < (4) < (3)

Correct answer: (B)

Step-by-step solution →
Q164·ChemistrySingle correctJEE Advanced 2018
PARAGRAPH "A" An organic acid P (C11H12O2C_{11}H_{12}O_{2}C11​H12​O2​) can easily be oxidized to a dibasic acid which reacts with ethylene glycol to produce a polymer dacron. Upon ozonolysis, P gives an aliphatic ketone as one of the products. P undergoes the following reaction sequences to furnish R via Q. The compound P also undergoes another set of reactions to produce S. S ←\xleftarrow{}​ [1) H2H_{2}H2​/Pd−C, 2) NH3NH_{3}NH3​/Δ\DeltaΔ, 3) Br2Br_{2}Br2​/NaOH, 4) CHCl3CHCl_{3}CHCl3​, KOH, Δ\DeltaΔ, 5) H2H_{2}H2​/Pd−C] P →\xrightarrow{}​ [1) H2H_{2}H2​/Pd−C, 2) SOCl2SOCl_{2}SOCl2​, 3) MeMgBr, CdCl2CdCl_{2}CdCl2​, 4) NaBH4NaBH_{4}NaBH4​] Q →\xrightarrow{}​ [1) HCl, 2) Mg/Et2OEt_{2}OEt2​O, 3) CO2CO_{2}CO2​ (dry ice), 4) H3O+H_{3}O^{+}H3​O+] R (There are two questions based on PARAGRAPH "A", the question given below is one of them) The compound S is
  1. (A)(A)
  2. (B)(B)
  3. (C)(C)
  4. (D)(D)

Correct answer: (B)

Step-by-step solution →
Q165·ChemistryNumericalJEE Advanced 2018
In the following reaction sequence, the amount of D (in g) formed from 10 moles of acetophenone is ____. (Atomic weights in g mol−1mol^{-1}mol−1: H = 1, C = 12, N = 14, O = 16, Br = 80. The yield (%) corresponding to the product in each step is given in the parenthesis)

Correct answer: 495

Step-by-step solution →
Q166·ChemistryMultiple correctJEE Advanced 2018
Aniline reacts with mixed acid (conc. HNO3HNO_{3}HNO3​ and conc. H2SO4H_{2}SO_{4}H2​SO4​) at 288 K to give P (51%), Q (47%) and R(2%). The major product(s) of the following reaction sequence is (are) R →(1) Ac2O, pyridine; (2) Br2, CH3CO2H; (3) H3O+; (4) NaNO2, HCl/273–278 K; (5) EtOH, Δ\xrightarrow{\text{(1) Ac}_{2}\text{O, pyridine; (2) Br}_{2}\text{, CH}_{3}\text{CO}_{2}\text{H; (3) H}_{3}\text{O}^{+}\text{; (4) NaNO}_{2}\text{, HCl/273--278 K; (5) EtOH, }\Delta}(1) Ac2​O, pyridine; (2) Br2​, CH3​CO2​H; (3) H3​O+; (4) NaNO2​, HCl/273–278 K; (5) EtOH, Δ​ S →(1) Sn/HCl; (2) Br2/H2O (excess); (3) NaNO2, HCl/273–278 K; (4) H3PO2\xrightarrow{\text{(1) Sn/HCl; (2) Br}_{2}\text{/H}_{2}\text{O (excess); (3) NaNO}_{2}\text{, HCl/273--278 K; (4) H}_{3}\text{PO}_{2}}(1) Sn/HCl; (2) Br2​/H2​O (excess); (3) NaNO2​, HCl/273–278 K; (4) H3​PO2​​ major product(s)
  1. (A)(A)
  2. (B)(B)
  3. (C)(C)
  4. (D)(D)

Correct answer: (D)

Step-by-step solution →
Q167·ChemistrySingle correctJEE Advanced 2017
The order of basicity among the following compound is
  1. (A)II > I > IV > III
  2. (B)IV > II > III > I
  3. (C)IV > I > II > III
  4. (D)I > IV > III > II

Correct answer: (C)

Step-by-step solution →
Q168·ChemistrySingle correctJEE Advanced 2016
Treatment of compound O with KMnO4/H+KMnO_{4}/H^{+}KMnO4​/H+ gave P, which on heating with ammonia gave Q. The compound Q on treatment with Br2Br_{2}Br2​/NaOH produced R. On strong heating, Q gave S, which on further treatment with ethyl 2-bromopropanoate in the presence of KOH followed by acidification, gave a compound T. The compound R is
  1. (A)(A)
  2. (B)(B)
  3. (C)(C)
  4. (D)(D)

Correct answer: (A)

Step-by-step solution →
Q169·ChemistrySingle correctJEE Advanced 2016
Treatment of compound O with KMnO4/H+KMnO_{4}/H^{+}KMnO4​/H+ gave P, which on heating with ammonia gave Q. The compound Q on treatment with Br2Br_{2}Br2​/NaOH produced R. On strong heating, Q gave S, which on further treatment with ethyl 2-bromopropanoate in the presence of KOH followed by acidification, gave a compound T. The compound T is
  1. (A)glycine
  2. (B)alanine
  3. (C)valine
  4. (D)serine

Correct answer: (B)

Step-by-step solution →
Q170·ChemistryMultiple correctJEE Advanced 2015
The major product of the reaction is
  1. (A)(A)
  2. (B)(B)
  3. (C)(C)
  4. (D)(D)

Correct answer: (C)

Step-by-step solution →
Q171·ChemistryMultiple correctJEE Advanced 2015
In the following reactions, the product S\mathbf{S}S is
  1. (A)(A)
  2. (B)(B)
  3. (C)(C)
  4. (D)(D)

Correct answer: (A)

Step-by-step solution →
Q172·ChemistrySingle correctJEE Advanced 2014
Match the four starting materials (P, Q, R, S) given in List I with the corresponding reaction schemes (I, II, III, IV) provided in List II and select the correct answer using the code given below the lists.
List-IList-II
P.see figure1.Scheme I: ? →(iii) SOCl2 (iv) NH3(i) KMnO4, HO−, heat (ii) H+, H2O\xrightarrow[\text{(iii) } \mathrm{SOCl_2}\ \text{(iv) } \mathrm{NH_3}]{\text{(i) } \mathrm{KMnO_4},\ \mathrm{HO^-},\ \text{heat (ii) } \mathrm{H^+},\ \mathrm{H_2O}}(i) KMnO4​, HO−, heat (ii) H+, H2​O(iii) SOCl2​ (iv) NH3​​ C7H6N2O3\mathrm{C_7H_6N_2O_3}C7​H6​N2​O3​
Q.see figure2.Scheme II: ? →(iv) HNO3 (v) dil. H2SO4, heat (vi) HO−(i) Sn/HCl (ii) CH3COCl (iii) conc. H2SO4\xrightarrow[\text{(iv) } \mathrm{HNO_3}\ \text{(v) dil. } \mathrm{H_2SO_4},\ \text{heat (vi) } \mathrm{HO^-}]{\text{(i) Sn/HCl (ii) } \mathrm{CH_3COCl}\ \text{(iii) conc. } \mathrm{H_2SO_4}}(i) Sn/HCl (ii) CH3​COCl (iii) conc. H2​SO4​(iv) HNO3​ (v) dil. H2​SO4​, heat (vi) HO−​ C6H6N2O2\mathrm{C_6H_6N_2O_2}C6​H6​N2​O2​
R.see figure3.Scheme III: ? →(iii) H2S.NH3 (iv) NaNO2, H2SO4 (v) hydrolysis(i) red hot iron, 873 K (ii) fuming HNO3, H2SO4, heat\xrightarrow[\text{(iii) } \mathrm{H_2S.NH_3}\ \text{(iv) } \mathrm{NaNO_2},\ \mathrm{H_2SO_4}\ \text{(v) hydrolysis}]{\text{(i) red hot iron, 873 K (ii) fuming } \mathrm{HNO_3},\ \mathrm{H_2SO_4},\ \text{heat}}(i) red hot iron, 873 K (ii) fuming HNO3​, H2​SO4​, heat(iii) H2​S.NH3​ (iv) NaNO2​, H2​SO4​ (v) hydrolysis​ C6H5NO3\mathrm{C_6H_5NO_3}C6​H5​NO3​
S.see figure4.Scheme IV: ? →(ii) conc. HNO3, conc. H2SO4 (iii) dil. H2SO4, heat(i) conc. H2SO4, 60∘C\xrightarrow[\text{(ii) conc. } \mathrm{HNO_3},\ \text{conc. } \mathrm{H_2SO_4}\ \text{(iii) dil. } \mathrm{H_2SO_4},\ \text{heat}]{\text{(i) conc. } \mathrm{H_2SO_4},\ 60^\circ\mathrm{C}}(i) conc. H2​SO4​, 60∘C(ii) conc. HNO3​, conc. H2​SO4​ (iii) dil. H2​SO4​, heat​ C6H5NO4\mathrm{C_6H_5NO_4}C6​H5​NO4​
  1. (A)P-1, Q-4, R-2, S-3
  2. (B)P-3, Q-1, R-4, S-2
  3. (C)P-3, Q-4, R-2, S-1
  4. (D)P-4, Q-1, R-3, S-2

Correct answer: (C)

Step-by-step solution →
Q173·ChemistryMultiple correctJEE Advanced 2014
In the reaction shown below, the major product(s) formed is/are
  1. (A)(A)
  2. (B)(B)
  3. (C)(C)
  4. (D)(D)

Correct answer: (A)

Step-by-step solution →

Amines — frequently asked

How many questions from Amines appear in JEE?

Amines has appeared in 133 of the last 186 JEE Main and JEE Advanced papers — about 72% of them — contributing 173 questions in total across those papers.

Is Amines an important chapter for JEE?

Judged by how often it is actually tested, it appears in roughly 72% of papers. Chapters above about 50% are effectively guaranteed to show up every session, so they repay thorough preparation; lower-frequency chapters are better treated as targeted revision.

Where do these Amines questions come from?

Every question is from an official JEE Main or JEE Advanced paper, transcribed from the original paper and tagged to this chapter. Answers follow the official answer key.

Other Chemistry chapters

  • Coordination Compounds 318
  • p-Block Elements 276
  • Redox Reactions and Electrochemistry 265
  • Chemical Bonding and Molecular Structure 207
  • d- and f-Block Elements 202
  • Aldehydes and Ketones 199
  • Equilibrium 199
  • Solutions 198

All 36 Chemistry chapters →

Practise Amines until it stops costing you marks.

Build a timed test from these 173 questions in one click. Jarvis marks it, names the specific misconception behind each wrong answer, and brings the ones you failed back at the right interval.

Practise Amines freeSee pricing

Free plan, no time limit · No credit card needed

Jarvis OS

AI-powered JEE preparation.

Question papers

JEE Main PYQsJEE Advanced PYQsPhysics PYQsChemistry PYQsMaths PYQs

Product

TourPricingSign inCreate account

Legal

Privacy PolicyTerms of ServiceRefund & CancellationShipping & DeliveryContact Us

Operated by

Venyou Craft Private Limited

info@jarvisos.net

© 2026 Jarvis OS