Jarvis OS
PYQ papersPricingSign inGet started
  1. Home
  2. /JEE Main PYQs
  3. /2020
  4. /7 Jan Shift 2

JEE Main 7 January 2020 Shift 2 Question Paper with Answers

7 January 2020 · January session · 70 questions

70 of the 75 questions from the JEE Main 7 January 2020 Shift 2 paper, each with its correct answer and tagged to the chapter it tests. Free to read, no account needed.

5 questions are held back from this paper while we re-check the transcription or the answer key. We would rather show you nothing than show you an answer we are not confident is right.

Physics
23
Chemistry
24
Mathematics
23

Physics — JEE Main 7 January 2020 Shift 2

Q1·PhysicsSingle correct
A particle of mass m and charge q has an initial velocity v⃗=v0j^\vec{v} = v_0\hat{j}v=v0​j^​. If an electric field E⃗=E0i^\vec{E} = E_0\hat{i}E=E0​i^ and magnetic field B⃗=B0i^\vec{B} = B_0\hat{i}B=B0​i^ act on the particle, its speed will double after a time:
  1. (A)2mv0qE0\dfrac{2mv_0}{qE_0}qE0​2mv0​​
  2. (B)2mv0qE0\dfrac{\sqrt{2}mv_0}{qE_0}qE0​2​mv0​​
  3. (C)3mv0qE0\dfrac{\sqrt{3}mv_0}{qE_0}qE0​3​mv0​​
  4. (D)3mv0qE0\dfrac{3mv_0}{qE_0}qE0​3mv0​​

Correct answer: (C)

Step-by-step solution →
Q2·PhysicsSingle correct
In a building there are 15 bulbs of 45 W, 15 bulbs of 100 W, 15 small fans of 10 W and 2 heaters of 1 kW. The voltage of electric main is 220 V. The minimum fuse capacity (rated value) of the building will be
  1. (A)10 A
  2. (B)20 A
  3. (C)25 A
  4. (D)15 A

Correct answer: (B)

Step-by-step solution →
Q3·PhysicsSingle correct
An electron (of mass m) and a photon have the same energy E in the range of a few eV. The ratio of the de-Broglie wavelength associated with the electron and the wavelength of the photon is (c = speed of light in vacuum)
  1. (A)c(2mE)1/2^{1/2}1/2
  2. (B)1c(E2m)1/2\dfrac{1}{c}\left(\dfrac{E}{2m}\right)^{1/2}c1​(2mE​)1/2
  3. (C)1c(2Em)1/2\dfrac{1}{c}\left(\dfrac{2E}{m}\right)^{1/2}c1​(m2E​)1/2
  4. (D)(E2m)1/2\left(\dfrac{E}{2m}\right)^{1/2}(2mE​)1/2

Correct answer: (B)

Step-by-step solution →
Q4·PhysicsSingle correct
A thin lens made of glass (refractive index = 1.5) of focal length f = 16 cm is immersed in a liquid of refractive index 1.42. If its focal length in liquid is fℓ_{\ell}ℓ​, then the ratio fℓ_{\ell}ℓ​/f is closest to the integer:
  1. (A)17
  2. (B)1
  3. (C)9
  4. (D)5

Correct answer: (C)

Step-by-step solution →
Q5·PhysicsSingle correct
A stationary observer receives sound from two identical tuning forks, one of which approaches and the other one recedes with the same speed (much les than the speed of sound). The observers hears 2 beats/sec. The oscillation frequency of each tuning fork is ν0\nu_0ν0​ = 1400 Hz and the velocity of sound in air is 350 m/s. The speed of each tuning fork is close to:
  1. (A)14\dfrac{1}{4}41​ m/s
  2. (B)1 m/s
  3. (C)12\dfrac{1}{2}21​ m/s
  4. (D)18\dfrac{1}{8}81​ m/s

Correct answer: (A)

Step-by-step solution →
Q6·PhysicsSingle correct
Mass per unit are of a circular disc of radius a depends on the distance r from its centre as σ(r)=A+Br\sigma(r) = A + Brσ(r)=A+Br. The moment of inertia of the disc about the axis, perpendicular to the plane and passing through its centre is:
  1. (A)2πa4(A4+B5)2\pi a^{4}\left(\dfrac{A}{4}+\dfrac{B}{5}\right)2πa4(4A​+5B​)
  2. (B)2πa4(A4+aB5)2\pi a^{4}\left(\dfrac{A}{4}+\dfrac{aB}{5}\right)2πa4(4A​+5aB​)
  3. (C)2πa4(aA4+B5)2\pi a^{4}\left(\dfrac{aA}{4}+\dfrac{B}{5}\right)2πa4(4aA​+5B​)
  4. (D)πa4(A4+aB5)\pi a^{4}\left(\dfrac{A}{4}+\dfrac{aB}{5}\right)πa4(4A​+5aB​)

Correct answer: (B)

Step-by-step solution →
Q7·PhysicsSingle correct
A planar loop of wire rotates in a uniform magnetic field. Initially, at t = 0, the plane of the loop is perpendicular to the magnetic field. If it rotates with a period of 10 s about an axis in its plane then the magnitude of induced emf will be maximum and minimum, respectively at:
  1. (A)2.5 s and 5.0 s
  2. (B)5.0 s and 10.0 s
  3. (C)2.5 s and 7.5 s
  4. (D)5.0 and 7.5 s

Correct answer: (A)

Step-by-step solution →
Q8·PhysicsSingle correct
Two ideal Carnot engines operate in cascade (all heat given up by one engine is used by the other engine to produce work) between temperatures, T1_11​ and T2_22​. The temperature of the hot reservoir of the first engine is T1_11​ and the temperature of the cold reservoir of the second engine is T2_22​. T is temperature of the sink of first engine which is also the source for the second engine. How is T related to T1_11​ and T2_22​, if both the engines perform equal amount of work?
  1. (A)T = T1T2\sqrt{T_1T_2}T1​T2​​
  2. (B)T = T1+T22\dfrac{T_1+T_2}{2}2T1​+T2​​
  3. (C)T = 2T1T2T1+T2\dfrac{2T_1T_2}{T_1+T_2}T1​+T2​2T1​T2​​
  4. (D)T = 0

Correct answer: (B)

Step-by-step solution →
Q9·PhysicsSingle correct
A box weighs 196 N on a spring balance at the north pole. Its weight recorded on the same balance if it is shifted to the equator is close to (Take g = 10 ms−2^{-2}−2 at the north pole and the radius of the earth = 6400 km)
  1. (A)194.66 N
  2. (B)194.32 N
  3. (C)195.32 N
  4. (D)195.66 N

Correct answer: (C)

Step-by-step solution →
Q10·PhysicsSingle correct
The dimension of B22μ0\frac{B^{2}}{2\mu_{0}}2μ0​B2​, where B is magnetic field and μ0\mu_{0}μ0​ is the magnetic permeability of vacuum, is
  1. (A)ML2^{2}2T−1^{-1}−1
  2. (B)ML2^{2}2T−2^{-2}−2
  3. (C)ML−1^{-1}−1T−2^{-2}−2
  4. (D)MLT−2^{-2}−2

Correct answer: (C)

Step-by-step solution →
Q11·PhysicsSingle correct
In a Young's double slit experiment, the separation between the slits is 0.15 mm. In the experiment, a source of light of wavelength 589 nm is used and the interference pattern is observed on a screen kept 1.5 m away. The separation between the successive bright fringes on the screen is:
  1. (A)4.9 mm
  2. (B)6.9 mm
  3. (C)3.9 mm
  4. (D)5.9 mm

Correct answer: (D)

Step-by-step solution →
Q12·PhysicsSingle correct
The figure gives experimentally measured B vs H variation in a ferromagnetic material. The retentivity, co-ercivity and saturation, respectively, of the material are
  1. (A)1.0 T, 50 A/m and 1.5 T
  2. (B)1.5 T, 50 A/m and 1.0 T
  3. (C)150 A/m, 1.0 T and 1.5 T
  4. (D)1.5 T, 50 A/m and 1.0 T

Correct answer: (A)

Step-by-step solution →
Q13·PhysicsSingle correct
The activity of a radioactive sample falls from 700 s−1^{-1}−1 to 500 s−1^{-1}−1 in 30 minutes. Its half life is close to
  1. (A)66 min
  2. (B)52 min
  3. (C)62 min
  4. (D)72 min

Correct answer: (C)

Step-by-step solution →
Q14·PhysicsSingle correct
An ideal fluid flows (laminar flow) through a pipe of non-uniform diameter. The maximum and minimum diameters of the pipes are 6.4 cm and 4.8 cm, respectively. The ratio of the minimum and the maximum velocities of fluid in this pipe is
  1. (A)34\frac{3}{4}43​
  2. (B)81256\frac{81}{256}25681​
  3. (C)32\frac{\sqrt{3}}{2}23​​
  4. (D)916\frac{9}{16}169​

Correct answer: (D)

Step-by-step solution →
Q15·PhysicsSingle correct
A mass of 10 kg is suspended by a rope of length 4 m, from the ceiling. A force F is applied horizontally at the mid-point of the rope such that the top half of the rope makes an angle of 45° with the vertical. Then F equals: (Take g = 10 ms−2^{-2}−2 and the rope to be massless)
  1. (A)100 N
  2. (B)75 N
  3. (C)70 N
  4. (D)90 N

Correct answer: (A)

Step-by-step solution →
Q16·PhysicsSingle correct
The electric field of a plane electromagnetic wave is given by E⃗=E0i^+j^2cos⁡(kz+ωt)\vec{E} = E_0 \dfrac{\hat{i}+\hat{j}}{\sqrt{2}}\cos(kz+\omega t)E=E0​2​i^+j^​​cos(kz+ωt) At t = 0, a positively charged particle is at the point (x, y, z) =(0,0,πk)= \left(0, 0, \dfrac{\pi}{k}\right)=(0,0,kπ​). If its instantaneous velocity at (t = 0) is v0k^v_0\hat{k}v0​k^, the force acting on it due to the wave is:
  1. (A)zero
  2. (B)parallel to i^+j^2\dfrac{\hat{i}+\hat{j}}{\sqrt{2}}2​i^+j^​​
  3. (C)parallel to k^\hat{k}k^
  4. (D)antiparallel to i^+j^2\dfrac{\hat{i}+\hat{j}}{\sqrt{2}}2​i^+j^​​

Correct answer: (D)

Step-by-step solution →
Q17·PhysicsSingle correct
An elevator in a building can carry a maximum of 10 persons, with the average mass of each person being 68 kg. The mass of the elevator itself is 920 kg and it moves with a constant speed of 3 m/s. the frictional force opposing the motion is 6000 N. If the elevator is moving up with its full capacity, the power delivered by the motor to the elevator (g = 10 m/s2^22) must be at least:
  1. (A)56300 W
  2. (B)66000 W
  3. (C)62360 W
  4. (D)48000 W

Correct answer: (B)

Step-by-step solution →
Q18·PhysicsSingle correct
In the figure, potential difference between A and B is:
  1. (A)5 V
  2. (B)10 V
  3. (C)zero
  4. (D)15 V

Correct answer: (B)

Step-by-step solution →
Q19·PhysicsNumerical
Consider a uniform cubical box of side a on a rough floor that is to be moved by applying minimum possible force F at a point b above its centre of mass (see figure). If the coefficient of friction is μ\muμ = 0.4, the maximum possible value of 100×ba100 \times \dfrac{b}{a}100×ab​ for box not to topple before moving is __________.

Correct answer: 50.00

Step-by-step solution →
Q20·PhysicsNumerical
M grams of steam at 100°C is mixed with 200 g of ice at its melting point in a thermally insulated container. If it produces liquid water at 40°C [heat of vaporization of water is 540 cal/g and heat of fusion of ice is 80 cal/g], the value of M is __________.

Correct answer: 40

Step-by-step solution →
Q21·PhysicsNumerical
A 60 pF capacitor is fully charged by a 20 V supply. It is then disconnected from the supply and is connected to another uncharged 60 pF capacitor in parallel. The electrostatic energy that is lost in this process by the time the charge is redistributed between them is (in nJ) __________.

Correct answer: 6

Step-by-step solution →
Q22·PhysicsNumerical
The balancing length for a cell is 560 cm in a potentiometer experiment. When an external resistance of 10 Ω\OmegaΩ is connected in parallel to the cell, the balancing length changes by 60 cm. If the internal resistance of the cell is N10Ω\dfrac{N}{10}\Omega10N​Ω, where N is an integer then value of N is __________.

Correct answer: 12

Step-by-step solution →
Q23·PhysicsNumerical
The sum of two forces P⃗\vec{P}P and Q⃗\vec{Q}Q​ is R⃗\vec{R}R such that ∣R⃗∣=∣P⃗∣|\vec{R}| = |\vec{P}|∣R∣=∣P∣. The angle θ\thetaθ (in degrees) that the resultant of 2P⃗2\vec{P}2P and Q⃗\vec{Q}Q​ will make with Q⃗\vec{Q}Q​ is, __________.

Correct answer: 90

Step-by-step solution →

Chemistry — JEE Main 7 January 2020 Shift 2

Q24·ChemistrySingle correct
In the following reactions, products(A) and (B) respectively are NaOH+Cl2→Hot and Conc(A)+side products\mathrm{NaOH + Cl_2} \xrightarrow{\text{Hot and Conc}} (A) + \text{side products}NaOH+Cl2​Hot and Conc​(A)+side products Ca(OH)2 Cl2→Dry(B)+side products\mathrm{Ca(OH)_2\,Cl_2} \xrightarrow{\text{Dry}} (B) + \text{side products}Ca(OH)2​Cl2​Dry​(B)+side products
  1. (A)NaClO3\mathrm{NaClO_3}NaClO3​ and Ca(OCl)2\mathrm{Ca(OCl)_2}Ca(OCl)2​
  2. (B)NaOCl\mathrm{NaOCl}NaOCl and Ca(OCl)2\mathrm{Ca(OCl)_2}Ca(OCl)2​
  3. (C)NaOCl\mathrm{NaOCl}NaOCl and Ca(ClO3)2\mathrm{Ca(ClO_3)_2}Ca(ClO3​)2​
  4. (D)NaClO3\mathrm{NaClO_3}NaClO3​ and Ca(ClO3)2\mathrm{Ca(ClO_3)_2}Ca(ClO3​)2​

Correct answer: (A)

Step-by-step solution →
Q25·ChemistrySingle correct
The refining method used when the metal and the impurities have low and high melting temperatures, respectively is
  1. (A)zone refining
  2. (B)vapour phase refining
  3. (C)liquation
  4. (D)distillation

Correct answer: (C)

Step-by-step solution →
Q26·ChemistrySingle correct
The redox reaction among the following is
  1. (A)reaction of [Co(H2O)6]Cl3\mathrm{[Co(H_2O)_6]Cl_3}[Co(H2​O)6​]Cl3​ with AgNO3\mathrm{AgNO_3}AgNO3​
  2. (B)combination of dinitrogen with dioxygen at 2000 K
  3. (C)reaction of H2SO4\mathrm{H_2SO_4}H2​SO4​ with NaOH
  4. (D)formation of ozone from atmospheric oxygen in the presence of sunlight

Correct answer: (B)

Step-by-step solution →
Q27·ChemistrySingle correct
Within each pair of elements F & Cl, S & Se and Li & Na, respectively, the elements that release more energy upon an electron gain are
  1. (A)F, Se and Na
  2. (B)Cl, Se and Na
  3. (C)F, S and Li
  4. (D)Cl, S and Li

Correct answer: (D)

Step-by-step solution →
Q28·ChemistrySingle correct
Identify the correct labels of A, B and C in the following graph from the options given below Root mean square speed(VrmsV_{rms}Vrms​); most probable speed(VmpV_{\mathrm{m}\mathrm{p}}Vmp​); Average speed(VavV_{av}Vav​)
  1. (A)A-VavV_{av}Vav​, B-VrmsV_{rms}Vrms​, C-VmpV_{\mathrm{m}\mathrm{p}}Vmp​
  2. (B)A-VrmsV_{rms}Vrms​, B-VmpV_{\mathrm{m}\mathrm{p}}Vmp​, C-VavV_{av}Vav​
  3. (C)A-VmpV_{\mathrm{m}\mathrm{p}}Vmp​, B-VrmsV_{rms}Vrms​, C-VavV_{av}Vav​
  4. (D)A-VmpV_{\mathrm{m}\mathrm{p}}Vmp​, B-VavV_{av}Vav​, C-VrmsV_{rms}Vrms​

Correct answer: (D)

Step-by-step solution →
Q29·ChemistrySingle correct
For the reaction 2H2(g)+2NO(g)⟶N2(g)+2H2O2H_2(g) + 2NO(g) \longrightarrow N_2(g) + 2H_2O2H2​(g)+2NO(g)⟶N2​(g)+2H2​O, the observed rate expression is, rate = kf[NO]2[H2]k_f[NO]^2[H_2]kf​[NO]2[H2​]. The rate expression for the reverse reaction is:
  1. (A)kb[N2][H2O]k_b[N_2][H_2O]kb​[N2​][H2​O]
  2. (B)kb[N2][H2O]2/[NO]k_b[N_2][H_2O]^2/[NO]kb​[N2​][H2​O]2/[NO]
  3. (C)kb[N2][H2O]2/[H2]k_b[N_2][H_2O]^2/[H_2]kb​[N2​][H2​O]2/[H2​]
  4. (D)kb[N2][H2O]2k_b[N_2][H_2O]^2kb​[N2​][H2​O]2

Correct answer: (C)

Step-by-step solution →
Q30·ChemistrySingle correct
In the following reaction sequence The major product B is
  1. (A)(A)
  2. (B)(B)
  3. (C)(C)
  4. (D)(D)

Correct answer: (D)

Step-by-step solution →
Q31·ChemistrySingle correct
Which of the following statements is correct?
  1. (A)Gluconic acid is a dicarboxylic acid
  2. (B)Gluconic acid can form cyclic(acetal/hemiacetal) structure
  3. (C)Gluconic acid is a partial oxidation product of glucose
  4. (D)Gluconic acid is obtained by oxidation of glucose with HNO3\mathrm{HNO_3}HNO3​

Correct answer: (C)

Step-by-step solution →
Q32·ChemistrySingle correct
The equation that is incorrect is
  1. (A)(Λm0)NaBr−(Λm0)NaI=(Λm0)KBr−(Λm0)NaBr(\Lambda_m^0)_{NaBr} - (\Lambda_m^0)_{NaI} = (\Lambda_m^0)_{KBr} - (\Lambda_m^0)_{NaBr}(Λm0​)NaBr​−(Λm0​)NaI​=(Λm0​)KBr​−(Λm0​)NaBr​
  2. (B)(Λm0)NaBr−(Λm0)NaCl=(Λm0)KBr−(Λm0)KCl(\Lambda_m^0)_{NaBr} - (\Lambda_m^0)_{NaCl} = (\Lambda_m^0)_{KBr} - (\Lambda_m^0)_{KCl}(Λm0​)NaBr​−(Λm0​)NaCl​=(Λm0​)KBr​−(Λm0​)KCl​
  3. (C)(Λm0)H2O=(Λm0)HCl+(Λm0)NaOH−(Λm0)NaCl(\Lambda_m^0)_{H_2O} = (\Lambda_m^0)_{HCl} + (\Lambda_m^0)_{NaOH} - (\Lambda_m^0)_{NaCl}(Λm0​)H2​O​=(Λm0​)HCl​+(Λm0​)NaOH​−(Λm0​)NaCl​
  4. (D)(Λm0)KCl−(Λm0)NaCl=(Λm0)KBr−(Λm0)NaBr(\Lambda_m^0)_{KCl} - (\Lambda_m^0)_{NaCl} = (\Lambda_m^0)_{KBr} - (\Lambda_m^0)_{NaBr}(Λm0​)KCl​−(Λm0​)NaCl​=(Λm0​)KBr​−(Λm0​)NaBr​

Correct answer: (A)

Step-by-step solution →
Q33·ChemistrySingle correct
Consider the following reactions: Which of these reactions are possible?
  1. (A)(b) and (d)
  2. (B)(a) and (d)
  3. (C)(a) and (b)
  4. (D)(b), (c) and (d)

Correct answer: (A)

Step-by-step solution →
Q34·ChemistrySingle correct
The number of possible optical isomers for the complexes MA2B2\mathrm{MA_2B_2}MA2​B2​ with sp3sp^3sp3 and dsp2dsp^2dsp2 hybridized metal atom, respectively is: [Note: A and B are unidentate neutral and unidentate monoanionnic ligands, respectively]
  1. (A)2 and 2
  2. (B)0 and 2
  3. (C)0 and 1
  4. (D)0 and 0

Correct answer: (D)

Step-by-step solution →
Q35·ChemistrySingle correct
In the following reaction sequence, structures of A and B respectively will be
  1. (A)(A)
  2. (B)(B)
  3. (C)(C)
  4. (D)(D)

Correct answer: (D)

Step-by-step solution →
Q36·ChemistrySingle correct
The bond order and the magnetic characteristics of CN−CN^-CN− are
  1. (A)3, paramagnetic
  2. (B)2½, diamagnetic
  3. (C)3, diamagnetic
  4. (D)2½, paramagnetic

Correct answer: (C)

Step-by-step solution →
Q37·ChemistrySingle correct
For the following reactions: ksk_sks​ and kek_eke​ are respectively, the rate constant for substitution and elimination, and μ=kske\mu = \dfrac{k_s}{k_e}μ=ke​ks​​, the correct option is__________
  1. (A)μB>μA\mu_B > \mu_AμB​>μA​ and ke(A)>ke(B)k_e(A) > k_e(B)ke​(A)>ke​(B)
  2. (B)μA>μB\mu_A > \mu_BμA​>μB​ and ke(A)>ke(B)k_e(A) > k_e(B)ke​(A)>ke​(B)
  3. (C)μA>μB\mu_A > \mu_BμA​>μB​ and ke(B)>ke(A)k_e(B) > k_e(A)ke​(B)>ke​(A)
  4. (D)μB>μA\mu_B > \mu_AμB​>μA​ and ke(B)>ke(A)k_e(B) > k_e(A)ke​(B)>ke​(A)

Correct answer: (C)

Step-by-step solution →
Q38·ChemistrySingle correct
Among the statements (a - d), the incorrect ones are: (a) Octahedral Co(III) complexes with strong field ligands have very high magnetic moments (b) When Δ0<P\Delta_0 < PΔ0​<P, the d-electron configuration of Co(III) in an octahedral complex is teg4eg2t_{eg}^4 e_g^2teg4​eg2​ (c) Wavelength of light absorbed by [Co(en)3]3+[Co(en)_3]^{3+}[Co(en)3​]3+ is lower than that of [CoF6]3−[CoF_6]^{3-}[CoF6​]3− (d) If the Δ0\Delta_0Δ0​ for an octahedral complex of Co(III) is 18,000 cm−1^{-1}−1, the Δt\Delta_tΔt​ for its tetrahedral complex with the same ligand will be 16,000 cm−1^{-1}−1
  1. (A)(b) and (c) only
  2. (B)(a) and (b) only
  3. (C)(c) and (d) only
  4. (D)(a) and (d) only

Correct answer: (D)

Step-by-step solution →
Q39·ChemistrySingle correct
A Chromatography column, packed with silica gel as stationary phase, was used to separate a mixture of compounds consisting of (a) benzanilide, (b) aniline and (c) acetophenone. When the column is eluted with a mixture of solvents, hexane; ethyl acetate(20:80), the sequence of obtained compounds is
  1. (A)(b), (c) and (a)
  2. (B)(a), (b) and (c)
  3. (C)(c), (a) and (b)
  4. (D)(b), (a) and (c)

Correct answer: (C)

Step-by-step solution →
Q40·ChemistrySingle correct
The correct order of stability for the following alkoxides is
  1. (A)(B) > (C) > A
  2. (B)(C) > (A) > (B)
  3. (C)(C) > (B) > (A)
  4. (D)(B) > (A) > (C)

Correct answer: (C)

Step-by-step solution →
Q41·ChemistrySingle correct
Among statements (a) - (d), the correct ones are (a) decomposition of hydrogen peroxide gives dioxygen. (b) like hydrogen peroxide, compounds such as KClO3KClO_3KClO3​, Pb(NO3)2Pb(NO_3)_2Pb(NO3​)2​ and NaNO3NaNO_3NaNO3​ when heated liberated dioxygen. (c) 2-Ethylanthraquinone is useful for the industrial preparation of hydrogen peroxide (d) Hydrogen peroxide is used for the manufacture of sodium perborate
  1. (A)(a), (b), (c) and (d)
  2. (B)(a) and (c) only
  3. (C)(a), (b) and (c) only
  4. (D)(a), (c) and (d) only

Correct answer: (A)

Step-by-step solution →
Q42·ChemistrySingle correct
The ammonia(NH3NH_3NH3​) released on quantitative reaction of 0.6 g urea (NH2CONH2NH_2CONH_2NH2​CONH2​) with sodium hydroxide(NaOH) can be neutralized by
  1. (A)100 mL of 0.1 N HCl
  2. (B)100 mL of 0.2 N HCl
  3. (C)200 mL of 0.2 N HCl
  4. (D)200 mL of 0.4 N HCl

Correct answer: (B)

Step-by-step solution →
Q43·ChemistrySingle correct
Two open beakers one containing a solvent and the other containing a mixture of that solvent with a non-volatile solute are together sealed in a container. Over time
  1. (A)the volume of the solution increases and the volume of the solvent decreases
  2. (B)the volume of the solution and the solvent does not change
  3. (C)the volume of the solution does not change and the volume of the solvent decreases
  4. (D)the volume of the solution decreases and the volume of the solvent increases

Correct answer: (A)

Step-by-step solution →
Q44·ChemistryNumerical
Consider the following reactions: NaCl+K2Cr2O7+H2SO4(Conc.)⟶(A)+side products\mathrm{NaCl + K_2Cr_2O_7 + H_2SO_4(Conc.) \longrightarrow (A) + side\ products}NaCl+K2​Cr2​O7​+H2​SO4​(Conc.)⟶(A)+side products (A)+NaOH⟶(B)+Side products\mathrm{(A) + NaOH \longrightarrow (B) + Side\ products}(A)+NaOH⟶(B)+Side products (B)+H2SO4+H2O2(dilute)⟶(C)+Side products\mathrm{(B) + H_2SO_4 + H_2O_2(dilute) \longrightarrow (C) + Side\ products}(B)+H2​SO4​+H2​O2​(dilute)⟶(C)+Side products The sum of the total number of atoms in one molecule each of (A), (B) and (C) is __________

Correct answer: 18

Step-by-step solution →
Q45·ChemistryNumerical
The flocculation value of HCl for arsenic sulphide sol is 30 m mol L−1^{-1}−1. If H2SO4H_2SO_4H2​SO4​ is used for the flocculation of arsenic sulphide, the amount, in grams of H2SO4H_2SO_4H2​SO4​ in 250 mL required for the above purpose is __________ (Molecular mass of H2SO4H_2SO_4H2​SO4​ = 98 g/mol)

Correct answer: 0.3675

Step-by-step solution →
Q46·ChemistryNumerical
The number of sp2sp^2sp2-hybridized carbons present in "Aspartame" is __________

Correct answer: 9

Step-by-step solution →
Q47·ChemistryNumerical
3 g of acetic acid is added to 250 mL of 0.1 M HCl and the solution made up to 500 mL. To 20 mL of this solution ½ mL of 5 M NaOH is added. The pH of the solution is __________ [Given: pKaK_aKa​ of acetic acid = 4.75, molar mass of acetic acid = 60 g/mol, log 3 = 0.4771] Neglect any changes in volume.

Correct answer: 5.2271

Step-by-step solution →

Mathematics — JEE Main 7 January 2020 Shift 2

Q48·MathematicsSingle correct
The number of ordered pairs (r, k) for which 6⋅ 35Cr=(k2−3)⋅ 36Cr+16\cdot\,^{35}C_r=(k^{2}-3)\cdot\,^{36}C_{r+1}6⋅35Cr​=(k2−3)⋅36Cr+1​, where k is an integer, is:
  1. (A)3
  2. (B)6
  3. (C)4
  4. (D)2

Correct answer: (C)

Step-by-step solution →
Q49·MathematicsSingle correct
If 3x+4y=1223x+4y=12\sqrt{2}3x+4y=122​ is a tangent to the ellipse x2a2+y29=1\frac{x^2}{a^2}+\frac{y^2}{9}=1a2x2​+9y2​=1 for some a∈Ra \in Ra∈R, then the distance between the foci of the ellipse is:
  1. (A)222\sqrt{2}22​
  2. (B)272\sqrt{7}27​
  3. (C)444
  4. (D)252\sqrt{5}25​

Correct answer: (B)

Step-by-step solution →
Q50·MathematicsSingle correct
If the sum of the first 40 terms of the series, 3+4+8+9+13+14+18+19+....3+4+8+9+13+14+18+19+....3+4+8+9+13+14+18+19+.... is (102)m, then m is equal to:
  1. (A)10
  2. (B)5
  3. (C)20
  4. (D)25

Correct answer: (C)

Step-by-step solution →
Q51·MathematicsSingle correct
Let A=[aij]A=[a_{ij}]A=[aij​] and B=[bij]B=[b_{ij}]B=[bij​] be two 3×33\times 33×3 real matrices such that bij=(3)(i+j−2)ajib_{ij}=(3)^{(i+j-2)}a_{ji}bij​=(3)(i+j−2)aji​, where i,j=1,2,3i,j=1,2,3i,j=1,2,3. If the determinant of B is 81, then the determinant of A is:
  1. (A)13\dfrac{1}{3}31​
  2. (B)19\dfrac{1}{9}91​
  3. (C)181\dfrac{1}{81}811​
  4. (D)3

Correct answer: (B)

Step-by-step solution →
Q52·MathematicsSingle correct
The value of c in the Lagrange's mean value theorem for the function f(x)=x3−4x2+8x+11f(x)=x^{3}-4x^{2}+8x+11f(x)=x3−4x2+8x+11, when x∈[0,1]x\in[0,1]x∈[0,1] is:
  1. (A)7−23\dfrac{\sqrt{7}-2}{3}37​−2​
  2. (B)4−53\dfrac{4-\sqrt{5}}{3}34−5​​
  3. (C)4−73\dfrac{4-\sqrt{7}}{3}34−7​​
  4. (D)23\dfrac{2}{3}32​

Correct answer: (C)

Step-by-step solution →
Q53·MathematicsSingle correct
The value of α\alphaα for which 4α∫−12e−α∣x∣ dx=54\alpha\int_{-1}^{2} e^{-\alpha|x|}\,dx=54α∫−12​e−α∣x∣dx=5, is
  1. (A)log⁡e(32)\log_e\left(\frac{3}{2}\right)loge​(23​)
  2. (B)log⁡e(43)\log_e\left(\frac{4}{3}\right)loge​(34​)
  3. (C)log⁡e2\log_e\sqrt{2}loge​2​
  4. (D)log⁡e2\log_e 2loge​2

Correct answer: (D)

Step-by-step solution →
Q54·MathematicsSingle correct
Let y=y(x)y=y(x)y=y(x) be a function of x satisfying y1−x2=k−x1−y2y\sqrt{1-x^{2}}=k-x\sqrt{1-y^{2}}y1−x2​=k−x1−y2​ where k is a constant and y(12)=−14y\left(\dfrac{1}{2}\right)=-\dfrac{1}{4}y(21​)=−41​. Then dydx\dfrac{dy}{dx}dxdy​ at x=12x=\dfrac{1}{2}x=21​, is equal to:
  1. (A)−54-\dfrac{\sqrt{5}}{4}−45​​
  2. (B)−52-\dfrac{\sqrt{5}}{2}−25​​
  3. (C)25\dfrac{2}{\sqrt{5}}5​2​
  4. (D)52\dfrac{\sqrt{5}}{2}25​​

Correct answer: (B)

Step-by-step solution →
Q55·MathematicsSingle correct
Let y=y(x)y=y(x)y=y(x) be the solution curve of the differential equation, (y2−x)dydx=1(y^{2}-x)\dfrac{dy}{dx}=1(y2−x)dxdy​=1, satisfying y(0)=1y(0)=1y(0)=1. This curve intersects the x-axis at a point whose abscissa is:
  1. (A)2+e2+e2+e
  2. (B)−e-e−e
  3. (C)2
  4. (D)2−e2-e2−e

Correct answer: (D)

Step-by-step solution →
Q56·MathematicsSingle correct
Let f(x)f(x)f(x) be a polynomial of degree 5 such that x=±1x=\pm1x=±1 are its critical points. If lim⁡x→0(2+f(x)x3)=4\displaystyle\lim_{x\to0}\left(2+\dfrac{f(x)}{x^{3}}\right)=4x→0lim​(2+x3f(x)​)=4, then which one of the following is not true?
  1. (A)x = 1 is a point of minima and x = -1 is a point of maxims of f.
  2. (B)x = 1 is a point of maxima and x = -1 is a point of minimum of f
  3. (C)f is an odd function
  4. (D)f(1)−4f(−1)=4f(1)-4f(-1)=4f(1)−4f(−1)=4

Correct answer: (A)

Step-by-step solution →
Q57·MathematicsSingle correct
The area (in sq. units of the region {(x,y)∈R2 ∣ 4x2≤y≤8x+12}\{(x,y)\in R^{2}\,|\,4x^{2}\le y\le 8x+12\}{(x,y)∈R2∣4x2≤y≤8x+12} is:
  1. (A)1243\dfrac{124}{3}3124​
  2. (B)1253\dfrac{125}{3}3125​
  3. (C)1283\dfrac{128}{3}3128​
  4. (D)1273\dfrac{127}{3}3127​

Correct answer: (C)

Step-by-step solution →
Q58·MathematicsSingle correct
The locus of the mid-points of the perpendiculars drawn from points on the line, x=2yx=2yx=2y to the line x=yx=yx=y is:
  1. (A)7x−5y=07x-5y=07x−5y=0
  2. (B)3x−2y=03x-2y=03x−2y=0
  3. (C)2x−3y=02x-3y=02x−3y=0
  4. (D)5x−7y=05x-7y=05x−7y=0

Correct answer: (D)

Step-by-step solution →
Q59·MathematicsSingle correct
Let a1,a2,a3,........a_1,a_2,a_3,........a1​,a2​,a3​,........ be a G.P. such that a1<0,a1+a2=4a_1<0, a_1+a_2=4a1​<0,a1​+a2​=4 and a3+a4=16a_3+a_4=16a3​+a4​=16. If ∑i=19ai=4λ\displaystyle\sum_{i=1}^{9}a_i=4\lambdai=1∑9​ai​=4λ, then λ\lambdaλ is equal to:
  1. (A)-171
  2. (B)-513
  3. (C)171
  4. (D)5113\dfrac{511}{3}3511​

Correct answer: (A)

Step-by-step solution →
Q60·MathematicsSingle correct
Let α\alphaα and β\betaβ be the roots of the equation x2−x−1=0x^{2}-x-1=0x2−x−1=0. If Pk=(α)k+(β)k,k≥1P_{k}=(\alpha)^{k}+(\beta)^{k}, k \ge 1Pk​=(α)k+(β)k,k≥1, then which one of the following statements is not true?
  1. (A)p5=11p_{5}=11p5​=11
  2. (B)(p1+p2+p3+p4+p5)=26(p_{1}+p_{2}+p_{3}+p_{4}+p_{5})=26(p1​+p2​+p3​+p4​+p5​)=26
  3. (C)p3=p5−p4p_{3}=p_{5}-p_{4}p3​=p5​−p4​
  4. (D)p5=p2.p3p_{5}=p_{2}.p_{3}p5​=p2​.p3​

Correct answer: (D)

Step-by-step solution →
Q61·MathematicsSingle correct
If 3+isin⁡θ4−icos⁡θ,θ∈[0,2π]\dfrac{3+i\sin\theta}{4-i\cos\theta}, \theta \in [0,2\pi]4−icosθ3+isinθ​,θ∈[0,2π], is a real number, then an argument of sin⁡θ+icos⁡θ\sin\theta+i\cos\thetasinθ+icosθ is:
  1. (A)−tan⁡−1(34)-\tan^{-1}\left(\dfrac{3}{4}\right)−tan−1(43​)
  2. (B)π−tan⁡−1(43)\pi-\tan^{-1}\left(\dfrac{4}{3}\right)π−tan−1(34​)
  3. (C)π−tan⁡−1(34)\pi-\tan^{-1}\left(\dfrac{3}{4}\right)π−tan−1(43​)
  4. (D)tan⁡−1(43)\tan^{-1}\left(\dfrac{4}{3}\right)tan−1(34​)

Correct answer: (B)

Step-by-step solution →
Q62·MathematicsSingle correct
In a workshop, there are five machines and the probability of any one of them to be out of service on a day is 14\dfrac{1}{4}41​. If the probability that at most two machines will be out of service on the same day is (34)3k\left(\dfrac{3}{4}\right)^{3}k(43​)3k, then k is equal to:
  1. (A)444
  2. (B)178\dfrac{17}{8}817​
  3. (C)172\dfrac{17}{2}217​
  4. (D)174\dfrac{17}{4}417​

Correct answer: (B)

Step-by-step solution →
Q63·MathematicsSingle correct
Let the tangents drawn from the origin to the circle, x2+y2−8x−4y+16=0x^{2}+y^{2}-8x-4y+16=0x2+y2−8x−4y+16=0 touch it at the points A and B. Then (AB)2(AB)^{2}(AB)2 is equal to:
  1. (A)565\dfrac{56}{5}556​
  2. (B)325\dfrac{32}{5}532​
  3. (C)645\dfrac{64}{5}564​
  4. (D)525\dfrac{52}{5}552​

Correct answer: (C)

Step-by-step solution →
Q64·MathematicsSingle correct
If θ1\theta_{1}θ1​ and θ2\theta_{2}θ2​ be respectively the smallest and the largest values of θ\thetaθ in (0,2π)−{π}(0,2\pi)-\{\pi\}(0,2π)−{π} which satisfy the equation, 2cot⁡2θ−5sin⁡θ+4=02\cot^{2}\theta-\dfrac{5}{\sin\theta}+4=02cot2θ−sinθ5​+4=0, then ∫θ1θ2cos⁡23θ dθ\displaystyle\int_{\theta_{1}}^{\theta_{2}}\cos^{2}3\theta \, d\theta∫θ1​θ2​​cos23θdθ is equal to:
  1. (A)π3+16\dfrac{\pi}{3}+\dfrac{1}{6}3π​+61​
  2. (B)π3\dfrac{\pi}{3}3π​
  3. (C)π9\dfrac{\pi}{9}9π​
  4. (D)2π3\dfrac{2\pi}{3}32π​

Correct answer: (B)

Step-by-step solution →
Q65·MathematicsSingle correct
Let A, B, C and D be four non-empty sets. The contrapositive statement of "If A⊆BA \subseteq BA⊆B and B⊆DB \subseteq DB⊆D, then A⊆CA \subseteq CA⊆C" is:
  1. (A)If A⊆CA \subseteq CA⊆C, then B⊂AB \subset AB⊂A or D⊂BD \subset BD⊂B
  2. (B)If A⊈CA \not\subseteq CA⊆C, then A⊈BA \not\subseteq BA⊆B or B⊆DB \subseteq DB⊆D
  3. (C)If A⊈CA \not\subseteq CA⊆C, then A⊈BA \not\subseteq BA⊆B or B⊈DB \not\subseteq DB⊆D
  4. (D)If A⊈CA \not\subseteq CA⊆C, then A⊆BA \subseteq BA⊆B or B⊆DB \subseteq DB⊆D

Correct answer: (C)

Step-by-step solution →
Q66·MathematicsNumerical
If the function f defined on (−13,13)\left(-\dfrac{1}{3},\dfrac{1}{3}\right)(−31​,31​) by f(x)={1xlog⁡e(1+3x1−2x),when x≠0k,when x=0f(x)=\begin{cases}\dfrac{1}{x}\log_{e}\left(\dfrac{1+3x}{1-2x}\right), & \text{when } x \ne 0 \\ k, & \text{when } x=0\end{cases}f(x)=⎩⎨⎧​x1​loge​(1−2x1+3x​),k,​when x=0when x=0​ is continuous, then k is equal to __________.

Correct answer: 5

Step-by-step solution →
Q67·MathematicsNumerical
If the system of linear equations, x+y+z=6x+y+z=6x+y+z=6, x+2y+3z=10x+2y+3z=10x+2y+3z=10, 3x+2y+λz=μ3x+2y+\lambda z=\mu3x+2y+λz=μ has more than two solutions, then μ−λ2\mu-\lambda^{2}μ−λ2 is equal to __________.

Correct answer: 13

Step-by-step solution →
Q68·MathematicsNumerical
If the mean and variance of eight numbers 3, 7, 9, 12, 13, 20, x and y be 10 and 25 respectively, then xy is equal to __________.

Correct answer: 54

Step-by-step solution →
Q69·MathematicsNumerical
If the foot of the perpendicular drawn from the point (1, 0, 3) on a line passing through (α,7,1)(\alpha,7,1)(α,7,1) is (53,73,173)\left(\dfrac{5}{3},\dfrac{7}{3},\dfrac{17}{3}\right)(35​,37​,317​), then α\alphaα is equal to __________.

Correct answer: 4

Step-by-step solution →
Q70·MathematicsNumerical
Let X={n∈N:1≤n≤50}X=\{n \in N : 1 \le n \le 50\}X={n∈N:1≤n≤50}. If A={n∈X:n is a multiple of 2}A=\{n \in X : n \text{ is a multiple of } 2\}A={n∈X:n is a multiple of 2} and B={n∈X,n is a multiple of 7}B=\{n \in X, n \text{ is a multiple of } 7\}B={n∈X,n is a multiple of 7}, then the number of elements in the smallest subset of X containing both A and B is __________.

Correct answer: 29

Step-by-step solution →

Chapters tested in this paper

Open any chapter to practise every past-year question on that topic across all papers, and see how often it has actually appeared.

  • Properties of Solids and Liquids 172/186
  • Three Dimensional Geometry 176/186
  • Matrices and Determinants 180/186
  • Coordination Compounds 176/186
  • Sets, Relations and Functions 165/186
  • Current Electricity 160/186
  • Sequence and Series 164/186
  • p-Block Elements 164/186
  • Definite Integration 168/186
  • Rotational Motion 172/186
  • Redox Reactions and Electrochemistry 177/186
  • Geometrical Optics 172/186
  • Kinematics 156/186
  • Differential Equations 167/186
  • Probability 176/186
  • Permutations and Combinations 162/186
  • Magnetic Field of Current 147/186
  • Electromagnetic Waves 144/186
  • Chemical Bonding and Molecular Structure 151/186
  • Application of Derivatives 139/186
  • Limits and Continuity 149/186
  • d- and f-Block Elements 126/186
  • Thermodynamics 154/186
  • Equilibrium 163/186
  • Solutions 158/186
  • Laws of Motion 130/186
  • Units and Measurements 149/186
  • Hydrocarbons 126/186
  • Complex Numbers 165/186
  • Trigonometric Functions 144/186
  • Biomolecules 162/186
  • Chemical Kinetics 169/186
  • Gravitation 152/186
  • Electronic Devices 145/186
  • Circles 142/186
  • Dual Nature of Matter and Radiation 155/186
  • Amines 133/186
  • Quadratic Equations 148/186
  • Work, Energy and Power 132/186
  • Some Basic Concepts in Chemistry 129/186
  • Electromagnetic Induction 120/186
  • Wave Optics 130/186
  • Area Under Curves 139/186
  • Alcohols and Ethers 106/186
  • Purification and Characterisation of Organic Compounds 116/186
  • Nuclei 116/186
  • Organic Compounds Containing Halogens 109/186
  • Straight Lines 114/186
  • Waves 109/186
  • Capacitors and Dielectrics 115/186
  • Classification of Elements and Periodicity in Properties 113/186
  • Statistics 118/186
  • Ellipse 103/186
  • Isolation of Metals 106/186
  • Differentiability 91/186
  • Surface Chemistry 98/186
  • Hydrogen 81/186
  • Electronic Effects and Stability 74/186
  • Chemistry in Everyday Life 60/186
  • States of Matter: Gases and Liquids 52/186
  • Magnetism and Matter 50/186
  • Mathematical Reasoning 26/186
← 7 Jan Shift 1 2020All papers8 Jan Shift 1 2020 →

Attempt this paper under exam timing.

Take the 7 January 2020 Shift 2 paper as a timed mock and Jarvis marks it, then tells you which errors were conceptual gaps, which were silly mistakes, and which pattern you have now repeated. Step-by-step solutions for every question included.

Attempt this paper freeSee pricing

Free plan, no time limit · No credit card needed

Jarvis OS

AI-powered JEE preparation.

Question papers

JEE Main PYQsJEE Advanced PYQsPhysics PYQsChemistry PYQsMaths PYQs

Product

TourPricingSign inCreate account

Legal

Privacy PolicyTerms of ServiceRefund & CancellationShipping & DeliveryContact Us

Operated by

Venyou Craft Private Limited

info@jarvisos.net

© 2026 Jarvis OS